Index of /sites/default/files/imagecache/mini
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | -dar-amor.jpg | 2026-01-31 22:29 | 3.8K | |
| 0_0.jpg | 2026-01-31 22:29 | 4.8K | |
| 0_1.jpg | 2026-01-31 22:29 | 4.8K | |
| 0_2.jpg | 2026-01-31 22:29 | 5.4K | |
| 0_foto_208x224.jpg | 2026-01-31 22:29 | 3.1K | |
| 00.jpg | 2026-01-31 22:29 | 5.3K | |
| 0000000045I Educaci..> | 2026-01-31 22:29 | 9.8K | |
| 0000000598prw-experi..> | 2026-01-31 22:29 | 3.8K | |
| 0000000729prw-encues..> | 2026-01-31 22:29 | 3.9K | |
| 0000001214prw-2018-0..> | 2026-01-31 22:29 | 4.4K | |
| 0000001375prw-2019-0..> | 2026-01-31 22:29 | 5.0K | |
| 0000001404prw-2019-0..> | 2026-01-31 22:29 | 3.7K | |
| 0000001661prw-2019_a..> | 2026-01-31 22:29 | 4.8K | |
| 0005180832.jpg | 2026-01-31 22:29 | 1.9K | |
| 0007763137.jpg | 2026-01-31 22:29 | 4.2K | |
| 0023215508.jpg | 2026-01-31 22:29 | 3.0K | |
| 01.jpg | 2026-01-31 22:29 | 5.0K | |
| 013 International Co..> | 2026-01-31 22:29 | 2.9K | |
| 02fc168051b8779ea7f9..> | 2026-01-31 22:29 | 4.3K | |
| 030221emp.jpg | 2026-01-31 22:29 | 5.3K | |
| 04ebbe3a-c362-425f-b..> | 2026-01-31 22:29 | 4.1K | |
| 050516acoso.jpg | 2026-01-31 22:29 | 4.2K | |
| 050618134402_27.jpg | 2026-01-31 22:29 | 4.0K | |
| 078f3a6f-c49e-474e-8..> | 2026-01-31 22:29 | 5.4K | |
| 1-5c5af30200Intelige..> | 2026-01-31 22:29 | 4.7K | |
| 1.2.jpg | 2026-01-31 22:29 | 4.0K | |
| 1.4.jpg | 2026-01-31 22:29 | 4.2K | |
| 1.4_0.jpg | 2026-01-31 22:29 | 4.2K | |
| 1. Maltato Infantil ..> | 2026-01-31 22:29 | 3.4K | |
| 1. Marihuana.jpg | 2026-01-31 22:29 | 3.3K | |
| 1.Pautas para el cui..> | 2026-01-31 22:29 | 2.9K | |
| 1. Seminario Pablo_0..> | 2026-01-31 22:29 | 5.4K | |
| 1 Bullying.jpg | 2026-01-31 22:29 | 4.0K | |
| 1Chubut_Logo_Ministe..> | 2026-01-31 22:29 | 2.8K | |
| 1 Congresso Mundial ..> | 2026-01-31 22:29 | 14K | |
| 1 Congresso Mundial ..> | 2026-01-31 22:29 | 14K | |
| 1 Embarazo_0.jpg | 2026-01-31 22:29 | 3.3K | |
| 1 Logo-para-WEB2.png | 2026-01-31 22:29 | 8.2K | |
| 1 Reunion 24.09.21.jpg | 2026-01-31 22:29 | 4.7K | |
| 1 Seminario.jpg | 2026-01-31 22:29 | 4.2K | |
| 1 Seminario Internac..> | 2026-01-31 22:29 | 5.0K | |
| 1 Seminario Internac..> | 2026-01-31 22:29 | 5.0K | |
| 1_0.jpg | 2026-01-31 22:29 | 2.9K | |
| 1_1.jpg | 2026-01-31 22:29 | 5.2K | |
| 1_2.jpg | 2026-01-31 22:29 | 4.8K | |
| 1_3.jpg | 2026-01-31 22:29 | 5.4K | |
| 1_4.jpg | 2026-01-31 22:29 | 4.6K | |
| 1_5.jpg | 2026-01-31 22:29 | 2.7K | |
| 1_6.jpg | 2026-01-31 22:29 | 3.9K | |
| 1_7.jpg | 2026-01-31 22:29 | 3.7K | |
| 1_8.jpg | 2026-01-31 22:29 | 4.5K | |
| 1_Pubertad_Munch.jpg | 2026-01-31 22:29 | 3.5K | |
| 1 simposio Rio.png | 2026-01-31 22:29 | 11K | |
| 2º-Encuentro Univer..> | 2026-01-31 22:29 | 3.1K | |
| 2-reunion-virtual-ju..> | 2026-01-31 22:29 | 15K | |
| 2. Derechos.jpg | 2026-01-31 22:29 | 3.9K | |
| 2. Guía práctica d..> | 2026-01-31 22:29 | 3.1K | |
| 2_0.jpg | 2026-01-31 22:29 | 3.2K | |
| 2_1.jpg | 2026-01-31 22:29 | 4.2K | |
| 2_2.jpg | 2026-01-31 22:29 | 3.8K | |
| 2 alcohol.jpg | 2026-01-31 22:29 | 4.4K | |
| 2 congreso.jpg | 2026-01-31 22:29 | 4.5K | |
| 2 congreso_0.jpg | 2026-01-31 22:29 | 4.5K | |
| 2 conversatorio.jpg | 2026-01-31 22:29 | 2.8K | |
| 3º Informe Noctambu..> | 2026-01-31 22:29 | 2.6K | |
| 3.º Congresso Inter..> | 2026-01-31 22:29 | 3.8K | |
| 3 Premio.jpg | 2026-01-31 22:29 | 5.2K | |
| 4º Informe Noctámb..> | 2026-01-31 22:29 | 17K | |
| 4-como-me-siento.jpg | 2026-01-31 22:29 | 4.0K | |
| 4Jornada_0.png | 2026-01-31 22:29 | 21K | |
| 4e264f20-88ca-4dd4-b..> | 2026-01-31 22:29 | 2.9K | |
| 5th ENSEC Conference..> | 2026-01-31 22:29 | 4.3K | |
| 6.06.20 Adolescenci..> | 2026-01-31 22:29 | 5.4K | |
| 6 años.jpg | 2026-01-31 22:29 | 3.1K | |
| 8ef0280ff8569beb7c02..> | 2026-01-31 22:29 | 2.9K | |
| 9 de junio.jpg | 2026-01-31 22:29 | 4.1K | |
| 10 Mitos Sobre la Ed..> | 2026-01-31 22:29 | 4.9K | |
| 12º Congresso Brasi..> | 2026-01-31 22:29 | 4.9K | |
| 12.jpg | 2026-01-31 22:29 | 5.2K | |
| 14 Congreso Paraguay..> | 2026-01-31 22:29 | 3.6K | |
| 19th European Congre..> | 2026-01-31 22:29 | 4.2K | |
| 23f769_d340cdfad53a4..> | 2026-01-31 22:29 | 3.8K | |
| 28 de mayo- Día de ..> | 2026-01-31 22:29 | 3.6K | |
| 30 Congreso Latinoam..> | 2026-01-31 22:29 | 3.2K | |
| 33.jpg | 2026-01-31 22:29 | 4.4K | |
| 50 razones.jpg | 2026-01-31 22:29 | 4.5K | |
| 51-cambialacabeza.png | 2026-01-31 22:29 | 28K | |
| 56º Congreso Intern..> | 2026-01-31 22:29 | 4.5K | |
| 56º Congreso Intern..> | 2026-01-31 22:29 | 4.0K | |
| 56º Congreso Intern..> | 2026-01-31 22:29 | 4.0K | |
| 56º Congreso Intern..> | 2026-01-31 22:29 | 4.0K | |
| 56º Congreso Intern..> | 2026-01-31 22:29 | 4.5K | |
| 56º Congreso Intern..> | 2026-01-31 22:29 | 4.5K | |
| 61ff87a6-9bf1-4758-b..> | 2026-01-31 22:29 | 4.1K | |
| 63bbb3b7-c925-4cb6-b..> | 2026-01-31 22:29 | 4.6K | |
| 70 años de Suicidio..> | 2026-01-31 22:29 | 3.7K | |
| 100 Preguntas Sobre ..> | 2026-01-31 22:29 | 4.0K | |
| 100 formas.jpg | 2026-01-31 22:29 | 3.8K | |
| 122_a.png | 2026-01-31 22:29 | 14K | |
| 395-467.png | 2026-01-31 22:29 | 14K | |
| 432_educar-en-relaci..> | 2026-01-31 22:29 | 3.5K | |
| 450_1000.jpg | 2026-01-31 22:29 | 3.1K | |
| 456 Juegos y Dinámi..> | 2026-01-31 22:29 | 4.5K | |
| 501ac1_0072f740af6a4..> | 2026-01-31 22:29 | 13K | |
| 592abb42c9756.jpg | 2026-01-31 22:29 | 4.2K | |
| 646x420_104369_20150..> | 2026-01-31 22:29 | 3.4K | |
| 649a8d8a-c8df-4391-b..> | 2026-01-31 22:29 | 5.0K | |
| 737.jpg | 2026-01-31 22:29 | 6.4K | |
| 738.jpg | 2026-01-31 22:29 | 5.6K | |
| 741ff1520bb5d3ebd02b..> | 2026-01-31 22:29 | 2.9K | |
| 780eac9c43c04194b428..> | 2026-01-31 22:29 | 3.6K | |
| 842bbf_04691a0d21124..> | 2026-01-31 22:29 | 5.4K | |
| 842bbf_6d34777c00444..> | 2026-01-31 22:29 | 7.6K | |
| 954e2915-screen-shot..> | 2026-01-31 22:29 | 25K | |
| 954f2556-db65-4c48-9..> | 2026-01-31 22:29 | 4.4K | |
| 1211_323611867749456..> | 2026-01-31 22:29 | 4.5K | |
| 1373-original-bookco..> | 2026-01-31 22:29 | 4.3K | |
| 2012-Paternidad-Acti..> | 2026-01-31 22:29 | 3.8K | |
| 2014-6-4-Guía_de_pa..> | 2026-01-31 22:29 | 3.5K | |
| 2015-07-02_dia-mundi..> | 2026-01-31 22:29 | 28K | |
| 2015-11-26_boletin-e..> | 2026-01-31 22:29 | 3.9K | |
| 2015-emct-hiv-americ..> | 2026-01-31 22:29 | 3.7K | |
| 2016-06-03_guia-para..> | 2026-01-31 22:29 | 25K | |
| 2016-06-03_guia-para..> | 2026-01-31 22:29 | 23K | |
| 2016-uhc-espa-pin-30..> | 2026-01-31 22:29 | 4.3K | |
| 2018 Orientacion.jpg | 2026-01-31 22:29 | 4.5K | |
| 2020-03-09-14-41-fun..> | 2026-01-31 22:29 | 21K | |
| 2020-header-web-coro..> | 2026-01-31 22:29 | 2.7K | |
| 2021-06-24-recomenda..> | 2026-01-31 22:29 | 3.6K | |
| 4091_idBig_Guia_Groo..> | 2026-01-31 22:29 | 9.4K | |
| 4665_idBig_entiendem..> | 2026-01-31 22:29 | 34K | |
| 4997_idBig_MenoresVu..> | 2026-01-31 22:29 | 4.4K | |
| 5765_idBig_LigaEduca..> | 2026-01-31 22:29 | 4.5K | |
| 6616.jpg | 2026-01-31 22:29 | 4.7K | |
| 7041_idBig_A-tu-lado..> | 2026-01-31 22:29 | 11K | |
| 9872_101569935183727..> | 2026-01-31 22:29 | 4.3K | |
| 20932_1.jpg | 2026-01-31 22:29 | 4.7K | |
| 37888_57976_doble-2.jpg | 2026-01-31 22:29 | 4.1K | |
| 42855c1e-be78-4ce3-9..> | 2026-01-31 22:29 | 3.9K | |
| 67301_85866540088091..> | 2026-01-31 22:29 | 5.5K | |
| 67771-Intervenciones..> | 2026-01-31 22:29 | 14K | |
| 92875.jpg | 2026-01-31 22:29 | 3.2K | |
| 92898.jpg | 2026-01-31 22:29 | 4.7K | |
| 93013.jpg | 2026-01-31 22:29 | 4.9K | |
| 100419down.jpg | 2026-01-31 22:29 | 4.4K | |
| 100719v.jpg | 2026-01-31 22:29 | 2.7K | |
| 127025_1_thumb.porta..> | 2026-01-31 22:29 | 4.5K | |
| 127066_1_thumb.porta..> | 2026-01-31 22:29 | 4.2K | |
| 127084_1_thumb.porta..> | 2026-01-31 22:29 | 4.3K | |
| 150118cie11.jpg | 2026-01-31 22:29 | 3.6K | |
| 150618FAROS.jpg | 2026-01-31 22:29 | 3.3K | |
| 190619j.jpg | 2026-01-31 22:29 | 3.8K | |
| 191118autismo.jpg | 2026-01-31 22:29 | 3.7K | |
| 197622_Miguel-Angel-..> | 2026-01-31 22:29 | 3.6K | |
| 203480p3290EDNmain60..> | 2026-01-31 22:29 | 19K | |
| 207645.jpg | 2026-01-31 22:29 | 4.9K | |
| 210619internet.jpg | 2026-01-31 22:29 | 4.2K | |
| 213536n.jpg | 2026-01-31 22:29 | 3.8K | |
| 255394_1015094633045..> | 2026-01-31 22:29 | 3.5K | |
| 280745.jpg | 2026-01-31 22:29 | 3.7K | |
| 290829e0e708ef84afe7..> | 2026-01-31 22:29 | 25K | |
| 300616copm.jpg | 2026-01-31 22:29 | 5.3K | |
| 376390_4806229053005..> | 2026-01-31 22:29 | 2.9K | |
| 376390_4806229053005..> | 2026-01-31 22:29 | 2.9K | |
| 543303_4868356846663..> | 2026-01-31 22:29 | 2.4K | |
| 654377_1473083863105..> | 2026-01-31 22:29 | 17K | |
| 911828.jpg | 2026-01-31 22:29 | 3.6K | |
| 923206_1020325554764..> | 2026-01-31 22:29 | 5.5K | |
| 962646.jpg_big.jpg | 2026-01-31 22:29 | 4.5K | |
| 962646.jpg_crop.jpg | 2026-01-31 22:29 | 5.4K | |
| 1186206_737554549604..> | 2026-01-31 22:29 | 4.7K | |
| 1186206_737554549604..> | 2026-01-31 22:29 | 4.7K | |
| 1384274_634986203190..> | 2026-01-31 22:29 | 2.8K | |
| 1471988_677387092303..> | 2026-01-31 22:29 | 3.9K | |
| 1508993_323008414573..> | 2026-01-31 22:29 | 4.8K | |
| 1508993_323008414573..> | 2026-01-31 22:29 | 4.8K | |
| 1601552_428552900613..> | 2026-01-31 22:29 | 5.0K | |
| 1924358_768970909816..> | 2026-01-31 22:29 | 3.9K | |
| 1962781_422243131244..> | 2026-01-31 22:29 | 4.8K | |
| 3489469.jpg | 2026-01-31 22:29 | 2.3K | |
| 9842683-silueta-de-l..> | 2026-01-31 22:29 | 3.7K | |
| 10150553_30890700926..> | 2026-01-31 22:29 | 4.4K | |
| 10155017_72480492087..> | 2026-01-31 22:29 | 4.3K | |
| 10245335_99342042734..> | 2026-01-31 22:29 | 4.8K | |
| 10246562_83980152938..> | 2026-01-31 22:29 | 5.7K | |
| 10258519_64770456197..> | 2026-01-31 22:29 | 3.7K | |
| 10299130_10152518775..> | 2026-01-31 22:29 | 5.5K | |
| 10308142_69509829388..> | 2026-01-31 22:29 | 3.5K | |
| 10330487_84470336556..> | 2026-01-31 22:29 | 18K | |
| 10365718_10203946297..> | 2026-01-31 22:29 | 3.4K | |
| 10425411_10152777451..> | 2026-01-31 22:29 | 4.2K | |
| 10457938_38957478787..> | 2026-01-31 22:29 | 3.9K | |
| 10461730_31362574880..> | 2026-01-31 22:29 | 15K | |
| 10474433_63500980994..> | 2026-01-31 22:29 | 5.0K | |
| 10474433_63500980994..> | 2026-01-31 22:29 | 5.0K | |
| 10483827_10152346463..> | 2026-01-31 22:29 | 4.3K | |
| 10488323_26156649071..> | 2026-01-31 22:29 | 5.6K | |
| 10518653_70214041319..> | 2026-01-31 22:29 | 3.5K | |
| 10556324_10205040673..> | 2026-01-31 22:29 | 4.8K | |
| 10614203_68723026135..> | 2026-01-31 22:29 | 3.7K | |
| 10628613_58724555473..> | 2026-01-31 22:29 | 3.5K | |
| 10644781_74923306179..> | 2026-01-31 22:29 | 25K | |
| 10978715_37906312559..> | 2026-01-31 22:29 | 5.0K | |
| 11012360_10206715603..> | 2026-01-31 22:29 | 4.8K | |
| 11054395_10153190866..> | 2026-01-31 22:29 | 3.9K | |
| 11081319_95380910131..> | 2026-01-31 22:29 | 4.5K | |
| 11136652_10005366466..> | 2026-01-31 22:29 | 4.4K | |
| 11145005_10357812531..> | 2026-01-31 22:29 | 3.5K | |
| 11150492_78587757486..> | 2026-01-31 22:29 | 5.5K | |
| 11226917_81056565903..> | 2026-01-31 22:29 | 5.1K | |
| 11329780_10153324707..> | 2026-01-31 22:29 | 4.7K | |
| 11402450_94655548871..> | 2026-01-31 22:29 | 4.4K | |
| 11745779_16084322094..> | 2026-01-31 22:29 | 17K | |
| 11822341_95533375448..> | 2026-01-31 22:29 | 13K | |
| 12321703_96732486001..> | 2026-01-31 22:29 | 5.8K | |
| 12363065_10153256939..> | 2026-01-31 22:29 | 5.0K | |
| 12615535_93534263654..> | 2026-01-31 22:29 | 4.9K | |
| 12745534_66191872061..> | 2026-01-31 22:29 | 3.7K | |
| 13007335_17111537325..> | 2026-01-31 22:29 | 4.8K | |
| 13043281_10702996930..> | 2026-01-31 22:29 | 4.3K | |
| 13120000_10163971217..> | 2026-01-31 22:29 | 5.3K | |
| 13164206_10154240065..> | 2026-01-31 22:29 | 22K | |
| 13173890_10201726925..> | 2026-01-31 22:29 | 5.2K | |
| 13179174_11157821917..> | 2026-01-31 22:29 | 3.8K | |
| 13301262_12106031122..> | 2026-01-31 22:29 | 4.4K | |
| 13411737_79887807024..> | 2026-01-31 22:29 | 4.5K | |
| 13494778_10154119110..> | 2026-01-31 22:29 | 5.6K | |
| 13537711_10220766878..> | 2026-01-31 22:29 | 4.5K | |
| 13567372_11851955348..> | 2026-01-31 22:29 | 3.5K | |
| 13625388_10785419855..> | 2026-01-31 22:29 | 4.9K | |
| 13626573_11875269546..> | 2026-01-31 22:29 | 16K | |
| 13880359_81296787883..> | 2026-01-31 22:29 | 4.2K | |
| 13942465_10209765031..> | 2026-01-31 22:29 | 4.7K | |
| 13962886_10210085206..> | 2026-01-31 22:29 | 5.0K | |
| 14203184_96966475647..> | 2026-01-31 22:29 | 3.5K | |
| 14695594_14641528969..> | 2026-01-31 22:29 | 4.4K | |
| 14938196_10224469545..> | 2026-01-31 22:29 | 4.7K | |
| 14938196_10224469545..> | 2026-01-31 22:29 | 4.7K | |
| 14938196_10224469545..> | 2026-01-31 22:29 | 4.7K | |
| 14947595_97106502968..> | 2026-01-31 22:29 | 4.8K | |
| 15085546_80809687933..> | 2026-01-31 22:29 | 4.6K | |
| 15977851_15535115679..> | 2026-01-31 22:29 | 15K | |
| 15977851_15535115679..> | 2026-01-31 22:29 | 15K | |
| 16664921_13627439537..> | 2026-01-31 22:29 | 4.2K | |
| 17155777_13458672454..> | 2026-01-31 22:29 | 4.0K | |
| 17545548_19379942331..> | 2026-01-31 22:29 | 2.9K | |
| 18033848_10211465520..> | 2026-01-31 22:29 | 5.6K | |
| 19225989_13378968895..> | 2026-01-31 22:29 | 18K | |
| 20150305_1916869213.png | 2026-01-31 22:29 | 20K | |
| 20150408_espacios_ad..> | 2026-01-31 22:29 | 6.0K | |
| 20151110_logo_proyec..> | 2026-01-31 22:29 | 4.4K | |
| 20191001_184239.jpg | 2026-01-31 22:29 | 3.6K | |
| 20728354_19531155449..> | 2026-01-31 22:29 | 4.5K | |
| 20993877_13287138739..> | 2026-01-31 22:29 | 4.2K | |
| 22366838_15060674628..> | 2026-01-31 22:29 | 3.5K | |
| 23519246_10155985957..> | 2026-01-31 22:29 | 4.0K | |
| 23659470_10213721779..> | 2026-01-31 22:29 | 6.3K | |
| 25353836_16181895415..> | 2026-01-31 22:29 | 3.8K | |
| 25396241_14270270874..> | 2026-01-31 22:29 | 3.0K | |
| 25443023_16073685326..> | 2026-01-31 22:29 | 4.7K | |
| 26229372_20515063817..> | 2026-01-31 22:29 | 3.7K | |
| 26231621_20530334915..> | 2026-01-31 22:29 | 5.0K | |
| 27858323_18335649633..> | 2026-01-31 22:29 | 3.9K | |
| 27972907_17308884169..> | 2026-01-31 22:29 | 4.1K | |
| 27983242_20533499913..> | 2026-01-31 22:29 | 5.3K | |
| 28276940_16669434166..> | 2026-01-31 22:29 | 3.4K | |
| 29744369_21190308081..> | 2026-01-31 22:29 | 5.7K | |
| 29793141_17826145551..> | 2026-01-31 22:29 | 6.4K | |
| 32654358_16856920515..> | 2026-01-31 22:29 | 5.0K | |
| 33896710_17221431611..> | 2026-01-31 22:29 | 4.5K | |
| 33896710_17221431611..> | 2026-01-31 22:29 | 4.5K | |
| 37318874_18595293941..> | 2026-01-31 22:29 | 4.5K | |
| 37671323_20761022224..> | 2026-01-31 22:29 | 4.1K | |
| 38801606_18944190372..> | 2026-01-31 22:29 | 4.1K | |
| 40089842_18476826819..> | 2026-01-31 22:29 | 4.7K | |
| 41141820_19449634222..> | 2026-01-31 22:29 | 4.3K | |
| 41822496_19786979055..> | 2026-01-31 22:29 | 4.1K | |
| 41937275_72726000762..> | 2026-01-31 22:29 | 4.3K | |
| 42539898_19695117431..> | 2026-01-31 22:29 | 5.2K | |
| 43653355_21985996001..> | 2026-01-31 22:29 | 4.2K | |
| 44031737_10217256583..> | 2026-01-31 22:29 | 4.7K | |
| 46389093_10217500201..> | 2026-01-31 22:29 | 4.9K | |
| 46409248_23440630024..> | 2026-01-31 22:29 | 4.2K | |
| 46631783_10155925438..> | 2026-01-31 22:29 | 4.6K | |
| 49203186_21106379089..> | 2026-01-31 22:29 | 17K | |
| 50000000.png | 2026-01-31 22:29 | 28K | |
| 53535867_76953997010..> | 2026-01-31 22:29 | 5.2K | |
| 54264610_10889228579..> | 2026-01-31 22:29 | 4.4K | |
| 55448415_20090693360..> | 2026-01-31 22:29 | 4.4K | |
| 56887163_10028451132..> | 2026-01-31 22:29 | 4.6K | |
| 58373899_10219222204..> | 2026-01-31 22:29 | 6.1K | |
| 61432550_23843430188..> | 2026-01-31 22:29 | 3.7K | |
| 62486421_10615408109..> | 2026-01-31 22:29 | 4.9K | |
| 62493101_11639517704..> | 2026-01-31 22:29 | 3.1K | |
| 64827939_10652186672..> | 2026-01-31 22:29 | 30K | |
| 67914152_29094823524..> | 2026-01-31 22:29 | 2.8K | |
| 70866939_35971512141..> | 2026-01-31 22:29 | 4.2K | |
| 72281697_11880101447..> | 2026-01-31 22:29 | 4.1K | |
| 72691428_24128761721..> | 2026-01-31 22:29 | 5.4K | |
| 74183649_25791090389..> | 2026-01-31 22:29 | 3.3K | |
| 80975385_29684276331..> | 2026-01-31 22:29 | 4.2K | |
| 82623032_25529141748..> | 2026-01-31 22:29 | 3.5K | |
| 96086308_28183969948..> | 2026-01-31 22:29 | 4.2K | |
| 96767609_20987667936..> | 2026-01-31 22:29 | 3.8K | |
| 97019805_35721569494..> | 2026-01-31 22:29 | 3.3K | |
| 99127624_10157430851..> | 2026-01-31 22:29 | 14K | |
| 100581748_3854861701..> | 2026-01-31 22:29 | 4.1K | |
| 107630656_1015883270..> | 2026-01-31 22:29 | 15K | |
| 108203399_2354029728..> | 2026-01-31 22:29 | 3.2K | |
| 116261581_3273285576..> | 2026-01-31 22:29 | 4.2K | |
| 116261581_3273285576..> | 2026-01-31 22:29 | 4.2K | |
| 116261581_3273285576..> | 2026-01-31 22:29 | 4.2K | |
| 116261581_3273285576..> | 2026-01-31 22:29 | 4.2K | |
| 116261581_3273285576..> | 2026-01-31 22:29 | 4.2K | |
| 132426522_4265015956..> | 2026-01-31 22:29 | 2.8K | |
| 164588264_2535334356..> | 2026-01-31 22:29 | 3.8K | |
| 1385355600_138535_13..> | 2026-01-31 22:29 | 5.1K | |
| 1551375633_910244_15..> | 2026-01-31 22:29 | 4.2K | |
| 22317244826_30c70415..> | 2026-01-31 22:29 | 4.2K | |
| 1529854306717-730x41..> | 2026-01-31 22:29 | 4.0K | |
| 9788433025128.jpg | 2026-01-31 22:29 | 4.3K | |
| 9789241508315_eng_15..> | 2026-01-31 22:29 | 4.5K | |
| 9789241515078-eng.pd..> | 2026-01-31 22:29 | 4.5K | |
| 9789243512884-spa.pd..> | 2026-01-31 22:29 | 3.3K | |
| 9789243514093-spa.pd..> | 2026-01-31 22:29 | 4.1K | |
| 9789275318720_esp.pd..> | 2026-01-31 22:29 | 3.0K | |
| 9789275319741_agrade..> | 2026-01-31 22:29 | 3.5K | |
| 9789275320174_spa.pd..> | 2026-01-31 22:29 | 2.5K | |
| 9789275321287_spa.pd..> | 2026-01-31 22:29 | 4.4K | |
| 9789879493731.jpg | 2026-01-31 22:29 | 4.0K | |
| 20121011153631_50.png | 2026-01-31 22:29 | 7.6K | |
| 20121029110917-guia-..> | 2026-01-31 22:29 | 3.3K | |
| 20140325184339-encab..> | 2026-01-31 22:29 | 6.5K | |
| 20160227160823.jpg | 2026-01-31 22:29 | 5.0K | |
| 20170110105855_1212_..> | 2026-01-31 22:29 | 4.2K | |
| 98402611359567.560f6..> | 2026-01-31 22:29 | 3.2K | |
| 4939425775477423_0.jpg | 2026-01-31 22:29 | 3.5K | |
| 2016091214104970265.jpg | 2026-01-31 22:29 | 3.8K | |
| ABC de las hepatitis..> | 2026-01-31 22:29 | 5.2K | |
| ABUSO MANO.jpg | 2026-01-31 22:29 | 2.6K | |
| ACO.jpg | 2026-01-31 22:29 | 3.0K | |
| ACO_0.jpg | 2026-01-31 22:29 | 4.2K | |
| ACO_1.jpg | 2026-01-31 22:29 | 5.2K | |
| ACTORES.gif | 2026-01-31 22:29 | 12K | |
| ADOLECA_0.jpg | 2026-01-31 22:29 | 5.1K | |
| ADOLECA_0_0.jpg | 2026-01-31 22:29 | 5.1K | |
| ADOLECA_1.jpg | 2026-01-31 22:29 | 5.3K | |
| ADOLECA_2.jpg | 2026-01-31 22:29 | 5.2K | |
| ADOLESCENCIA MANUAL ..> | 2026-01-31 22:29 | 4.8K | |
| AEPAP.png | 2026-01-31 22:29 | 19K | |
| AFICHE-IPA.jpg | 2026-01-31 22:29 | 3.5K | |
| AFICHE.jpg | 2026-01-31 22:29 | 4.7K | |
| AFICHE2012FINALCHIQU..> | 2026-01-31 22:29 | 35K | |
| AFICHE2012FINALCHIQU..> | 2026-01-31 22:29 | 35K | |
| AFICHE2013-01.jpeg | 2026-01-31 22:29 | 5.0K | |
| AFICHE CURSO SERJOVE..> | 2026-01-31 22:29 | 4.9K | |
| AFICHE DEFINITIVO.jpg | 2026-01-31 22:29 | 4.6K | |
| AFICHE DEFINITIVO_0.jpg | 2026-01-31 22:29 | 4.6K | |
| AFICHE DEFINITIVO_1.jpg | 2026-01-31 22:29 | 4.6K | |
| AFICHE_0.jpg | 2026-01-31 22:29 | 5.0K | |
| AFICHE_1.jpg | 2026-01-31 22:29 | 5.0K | |
| AFICHE_2.jpg | 2026-01-31 22:29 | 5.0K | |
| AFICHE programa asoc..> | 2026-01-31 22:29 | 4.2K | |
| ALAPE_2015_250X200.jpg | 2026-01-31 22:29 | 5.2K | |
| APAE.jpg | 2026-01-31 22:29 | 5.4K | |
| APAE_0.jpg | 2026-01-31 22:29 | 5.4K | |
| APUNTES, revista de ..> | 2026-01-31 22:29 | 2.0K | |
| ARRIBA PERU_0.JPG | 2026-01-31 22:29 | 4.0K | |
| ASCOFAME.jpg | 2026-01-31 22:29 | 4.2K | |
| ASSE SALUD (2).jpg | 2026-01-31 22:29 | 3.7K | |
| ASSE SALUD (2)_0.jpg | 2026-01-31 22:29 | 3.7K | |
| ASSE SALUD (2)_1.jpg | 2026-01-31 22:29 | 3.7K | |
| AUTOLESIONES.jpg | 2026-01-31 22:29 | 5.1K | |
| Abordaje de la Explo..> | 2026-01-31 22:29 | 3.2K | |
| Abordaje de las adic..> | 2026-01-31 22:29 | 2.8K | |
| Abordaje integral de..> | 2026-01-31 22:29 | 3.4K | |
| Abordando las Barrer..> | 2026-01-31 22:29 | 3.3K | |
| Aborto voluntario y ..> | 2026-01-31 22:29 | 2.1K | |
| Abrazar la diversida..> | 2026-01-31 22:29 | 19K | |
| Abuso-sexual.jpg | 2026-01-31 22:29 | 2.7K | |
| Abuso sexual contra ..> | 2026-01-31 22:29 | 2.9K | |
| Academy on Youth Dev..> | 2026-01-31 22:29 | 4.1K | |
| Academy on Youth Dev..> | 2026-01-31 22:29 | 4.1K | |
| Academy on Youth Dev..> | 2026-01-31 22:29 | 4.1K | |
| Acceso al Aborto No ..> | 2026-01-31 22:29 | 3.5K | |
| Actividad-físco-dep..> | 2026-01-31 22:29 | 8.8K | |
| Actividades 2014.jpg | 2026-01-31 22:29 | 4.4K | |
| Adicciones 1.jpg | 2026-01-31 22:29 | 4.0K | |
| Adicciones y nuevas ..> | 2026-01-31 22:29 | 3.1K | |
| Adicciones y reinser..> | 2026-01-31 22:29 | 3.4K | |
| Adicciones y vulnera..> | 2026-01-31 22:29 | 3.5K | |
| Adolescencia Chile.jpg | 2026-01-31 22:29 | 5.7K | |
| Adolescencia Faculta..> | 2026-01-31 22:29 | 4.4K | |
| Adolescencia y nueva..> | 2026-01-31 22:29 | 4.2K | |
| Adolescente-con-el-c..> | 2026-01-31 22:29 | 2.6K | |
| Adolescentes, lo que..> | 2026-01-31 22:29 | 2.7K | |
| Adolescentes Infract..> | 2026-01-31 22:29 | 3.3K | |
| Adolescentes Vulnera..> | 2026-01-31 22:29 | 14K | |
| Adolescentes con tra..> | 2026-01-31 22:29 | 3.9K | |
| Adolescentes entre l..> | 2026-01-31 22:29 | 2.5K | |
| Adolescent fertility..> | 2026-01-31 22:29 | 5.2K | |
| Adolescenza e transi..> | 2026-01-31 22:29 | 4.1K | |
| Adolescere-2018-2-Po..> | 2026-01-31 22:29 | 3.7K | |
| Adolescere-2019-1-Po..> | 2026-01-31 22:29 | 4.6K | |
| Adolescere-2020-1-WE..> | 2026-01-31 22:29 | 3.6K | |
| Afiche-Congreso-Inte..> | 2026-01-31 22:29 | 5.2K | |
| Afiche-SPAJ-2014-gra..> | 2026-01-31 22:29 | 5.5K | |
| Afiche.jpg | 2026-01-31 22:29 | 4.6K | |
| Afiche COMESAJ.jpg | 2026-01-31 22:29 | 5.9K | |
| Afiche COMESAJ_0.jpg | 2026-01-31 22:29 | 5.9K | |
| Afiche Capacitación..> | 2026-01-31 22:29 | 5.9K | |
| Afiche Congreso.jpg | 2026-01-31 22:29 | 5.0K | |
| Afiche Congreso_1.jpg | 2026-01-31 22:29 | 5.0K | |
| Afiche Ponencias WEB..> | 2026-01-31 22:29 | 19K | |
| Afiche Proyecto FOND..> | 2026-01-31 22:29 | 3.9K | |
| Afiche_0.jpg | 2026-01-31 22:29 | 4.6K | |
| Afiche_1.jpg | 2026-01-31 22:29 | 5.2K | |
| Afiche_ALAPEFEMACAP-..> | 2026-01-31 22:29 | 4.7K | |
| Afiche_Congreso_SSR.jpg | 2026-01-31 22:29 | 5.4K | |
| Afro descendientes.jpg | 2026-01-31 22:29 | 4.7K | |
| Agencia RN.jpg | 2026-01-31 22:29 | 3.5K | |
| Alape 2011.JPG | 2026-01-31 22:29 | 2.2K | |
| Alcohol – Conducci..> | 2026-01-31 22:29 | 3.4K | |
| Alcohol-Tabaco-OMS_O..> | 2026-01-31 22:29 | 3.2K | |
| Alcohol-y-tabaco-2-5..> | 2026-01-31 22:29 | 4.8K | |
| Alcohol . Las 101 ra..> | 2026-01-31 22:29 | 3.7K | |
| Alcohol_PIBA_spa_0.png | 2026-01-31 22:29 | 31K | |
| Alfabetización en S..> | 2026-01-31 22:29 | 16K | |
| Algunas Reflexiones ..> | 2026-01-31 22:29 | 3.0K | |
| Algunos apuntes bio..> | 2026-01-31 22:29 | 5.1K | |
| Alianza_0.jpg | 2026-01-31 22:29 | 4.3K | |
| Alianza_0_0.jpg | 2026-01-31 22:29 | 4.1K | |
| Alianza_0_1.jpg | 2026-01-31 22:29 | 4.1K | |
| Alianza_0_5_0.jpg | 2026-01-31 22:29 | 4.1K | |
| Alicante.jpg | 2026-01-31 22:29 | 3.8K | |
| Alogia 2011_0.jpg | 2026-01-31 22:29 | 5.6K | |
| Alternativas al inte..> | 2026-01-31 22:29 | 3.9K | |
| América Latina y el..> | 2026-01-31 22:29 | 5.4K | |
| Amada 2013.jpg | 2026-01-31 22:29 | 4.5K | |
| Amistad1.jpg | 2026-01-31 22:29 | 3.5K | |
| Amsa_1.jpg | 2026-01-31 22:29 | 2.1K | |
| Análisis sobre legi..> | 2026-01-31 22:29 | 22K | |
| Ansiedad.jpg | 2026-01-31 22:29 | 3.4K | |
| Anuario estadistico ..> | 2026-01-31 22:29 | 2.5K | |
| Anuncio-Convocatoria..> | 2026-01-31 22:29 | 5.2K | |
| Aportes para la inte..> | 2026-01-31 22:29 | 6.2K | |
| Apoyo a Cuba.jpg | 2026-01-31 22:29 | 5.4K | |
| Aprender a convivir ..> | 2026-01-31 22:29 | 4.0K | |
| Aprendiendo-Sobre-La..> | 2026-01-31 22:29 | 5.1K | |
| Arch Arg Pediatria 2..> | 2026-01-31 22:29 | 4.4K | |
| Argentina Cortometra..> | 2026-01-31 22:29 | 5.2K | |
| Argerich.jpg | 2026-01-31 22:29 | 4.5K | |
| Argerich_0.jpg | 2026-01-31 22:29 | 5.5K | |
| Artboard 11-100.jpg | 2026-01-31 22:29 | 3.9K | |
| Asamblea Mundial de ..> | 2026-01-31 22:29 | 4.2K | |
| Asesinato Adolescent..> | 2026-01-31 22:29 | 4.5K | |
| Asesoramiento a los ..> | 2026-01-31 22:29 | 3.4K | |
| Asesorias Adolescent..> | 2026-01-31 22:29 | 4.1K | |
| Asogoes Jornada del..> | 2026-01-31 22:29 | 4.7K | |
| Astilla.gif | 2026-01-31 22:29 | 5.9K | |
| Atención de salud p..> | 2026-01-31 22:29 | 3.6K | |
| Atención en Salud S..> | 2026-01-31 22:29 | 18K | |
| Atención y Consejer..> | 2026-01-31 22:29 | 13K | |
| Atlas de salud menta..> | 2026-01-31 22:29 | 3.2K | |
| Atlas of migration i..> | 2026-01-31 22:29 | 4.0K | |
| Atrapada.jpg | 2026-01-31 22:29 | 5.0K | |
| Auge y caída de la ..> | 2026-01-31 22:29 | 3.0K | |
| Avaliação de.png | 2026-01-31 22:29 | 9.9K | |
| Avianca.jpg | 2026-01-31 22:29 | 4.0K | |
| Aviso2.jpg | 2026-01-31 22:29 | 5.1K | |
| BANNER_Fecha.jpg | 2026-01-31 22:29 | 2.6K | |
| BANNER_HAZTESOCIO.JPG | 2026-01-31 22:29 | 4.1K | |
| BASE_SeguimientoODS.jpg | 2026-01-31 22:29 | 3.5K | |
| BASE_factsheet6.jpg | 2026-01-31 22:29 | 3.5K | |
| BASE_pobrezayprivaci..> | 2026-01-31 22:29 | 3.9K | |
| BB10NxOH.jpg | 2026-01-31 22:29 | 3.9K | |
| BID.jpg | 2026-01-31 22:29 | 2.9K | |
| BID.png | 2026-01-31 22:29 | 23K | |
| BIDA.png | 2026-01-31 22:29 | 19K | |
| BNPNFQSXTMJPVXDEEKLW..> | 2026-01-31 22:29 | 4.7K | |
| BQpkfSEanr-acadar.jpg | 2026-01-31 22:29 | 3.2K | |
| Banner-01 - copia.jpg | 2026-01-31 22:29 | 3.1K | |
| Banner-MOOC2018-800x..> | 2026-01-31 22:29 | 35K | |
| Banner Congreso_HOME..> | 2026-01-31 22:29 | 3.4K | |
| Banner_Congreso_Web.jpg | 2026-01-31 22:29 | 3.8K | |
| Banner_Revista_Grand..> | 2026-01-31 22:29 | 2.2K | |
| Banner_Soy_Adolescen..> | 2026-01-31 22:29 | 3.6K | |
| Bariloche.jpg | 2026-01-31 22:29 | 5.9K | |
| Barometer picture fi..> | 2026-01-31 22:29 | 3.9K | |
| BecasCLACSOAsdi2013.jpg | 2026-01-31 22:29 | 4.1K | |
| Bienestar_Infantil_p..> | 2026-01-31 22:29 | 4.5K | |
| Bioética y big data..> | 2026-01-31 22:29 | 7.0K | |
| Blog1-e1588668062857..> | 2026-01-31 22:29 | 3.2K | |
| Blog Codajic Present..> | 2026-01-31 22:29 | 5.4K | |
| Boton-COCHRANE.jpg | 2026-01-31 22:29 | 4.2K | |
| Brasil.png | 2026-01-31 22:29 | 9.7K | |
| Brasil_0.png | 2026-01-31 22:29 | 9.3K | |
| Brechas, ejes y desa..> | 2026-01-31 22:29 | 4.1K | |
| Breve historia de la..> | 2026-01-31 22:29 | 4.8K | |
| Buenas prácticas en..> | 2026-01-31 22:29 | 3.3K | |
| Buenas prácticas y ..> | 2026-01-31 22:29 | 5.0K | |
| Cómo fomentar el au..> | 2026-01-31 22:29 | 4.1K | |
| CANNABIS_WEB.jpg | 2026-01-31 22:29 | 3.1K | |
| CEPA.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_0.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_0.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_1.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_2.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_3.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_3_0.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_3_1.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_3_2.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_3_3.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_3_4.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_3_5.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_1_3_6.JPG | 2026-01-31 22:29 | 3.4K | |
| CEPA_2.JPG | 2026-01-31 22:29 | 3.4K | |
| CEpal.jpg | 2026-01-31 22:29 | 4.0K | |
| CI2W7LAWcAAMAes.png | 2026-01-31 22:29 | 16K | |
| CICAD.png | 2026-01-31 22:29 | 23K | |
| CIMG1677_0.JPG | 2026-01-31 22:29 | 4.4K | |
| CIMG1677_1.JPG | 2026-01-31 22:29 | 4.4K | |
| CIPS.jpg | 2026-01-31 22:29 | 4.4K | |
| CODAJIC.jpg | 2026-01-31 22:29 | 2.8K | |
| CODAJIC 1.jpg | 2026-01-31 22:29 | 3.3K | |
| CODAJIC Empadronamie..> | 2026-01-31 22:29 | 3.5K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC Logo alta d..> | 2026-01-31 22:29 | 4.7K | |
| CODAJIC_0.jpg | 2026-01-31 22:29 | 4.5K | |
| CODAJIC_1.jpg | 2026-01-31 22:29 | 4.5K | |
| CODAJIC_2.jpg | 2026-01-31 22:29 | 4.5K | |
| CODAJIC_3.jpg | 2026-01-31 22:29 | 4.5K | |
| CODAJIC_4.jpg | 2026-01-31 22:29 | 4.5K | |
| CODAJIC_5.jpg | 2026-01-31 22:29 | 4.5K | |
| CODAJIC alta definic..> | 2026-01-31 22:29 | 4.4K | |
| CODAJIC alta definic..> | 2026-01-31 22:29 | 4.4K | |
| CONGRESO ADOLESCENCI..> | 2026-01-31 22:29 | 6.1K | |
| COPA.png | 2026-01-31 22:29 | 809 | |
| COPA_0.png | 2026-01-31 22:29 | 809 | |
| CRICS9_468x60.jpg | 2026-01-31 22:29 | 2.8K | |
| CUCS_logo.jpg | 2026-01-31 22:29 | 5.0K | |
| Calidad informativa ..> | 2026-01-31 22:29 | 6.2K | |
| Campaña No te pier..> | 2026-01-31 22:29 | 4.1K | |
| CantabriaBandera1.png | 2026-01-31 22:29 | 11K | |
| Capítulo-5-Perspect..> | 2026-01-31 22:29 | 2.9K | |
| Capacituación virtu..> | 2026-01-31 22:29 | 16K | |
| Captura-10.jpg | 2026-01-31 22:29 | 5.0K | |
| Captura-de-pantalla-..> | 2026-01-31 22:29 | 32K | |
| Captura-de-pantalla-..> | 2026-01-31 22:29 | 3.9K | |
| Captura-de-pantalla-..> | 2026-01-31 22:29 | 3.3K | |
| Captura.png | 2026-01-31 22:29 | 9.3K | |
| Captura de pantalla ..> | 2026-01-31 22:29 | 8.1K | |
| Caritas.jpg | 2026-01-31 22:29 | 4.4K | |
| Caritas_0.jpg | 2026-01-31 22:29 | 4.4K | |
| Caritas_1.jpg | 2026-01-31 22:29 | 4.4K | |
| Carne.jpg | 2026-01-31 22:29 | 5.2K | |
| Cartaz IV Congresso ..> | 2026-01-31 22:29 | 4.0K | |
| CartillaDerSex.jpg | 2026-01-31 22:29 | 4.0K | |
| Catálogo de pregunt..> | 2026-01-31 22:29 | 3.7K | |
| Catanzaro.JPG | 2026-01-31 22:29 | 4.6K | |
| Cattura-per-sito-1.png | 2026-01-31 22:29 | 23K | |
| Ceapa.jpg | 2026-01-31 22:29 | 2.4K | |
| Centro de Estudios J..> | 2026-01-31 22:29 | 14K | |
| Chequo Familiar.png | 2026-01-31 22:29 | 20K | |
| Chequo Familiar_0.png | 2026-01-31 22:29 | 20K | |
| Chile 1.gif | 2026-01-31 22:29 | 9.0K | |
| Chile 2018.jpg | 2026-01-31 22:29 | 4.5K | |
| Cine y pediatria.jpg | 2026-01-31 22:29 | 3.8K | |
| Cine y valores.jpg | 2026-01-31 22:29 | 5.8K | |
| Clase Espejo 14.10.2..> | 2026-01-31 22:29 | 3.4K | |
| Cómo-funciona-Inst..> | 2026-01-31 22:29 | 8.7K | |
| Cobertura universal ..> | 2026-01-31 22:29 | 3.8K | |
| Codajic 10 años_1.jpg | 2026-01-31 22:29 | 4.7K | |
| Codajic 10 años_1_0..> | 2026-01-31 22:29 | 4.6K | |
| Codajic 10 años_2.jpg | 2026-01-31 22:29 | 4.7K | |
| Codajic 10 años_3.jpg | 2026-01-31 22:29 | 4.7K | |
| Codajic 10 años_4.jpg | 2026-01-31 22:29 | 4.7K | |
| Codajic Augurios 20..> | 2026-01-31 22:29 | 5.3K | |
| Codajic Felicidades.jpg | 2026-01-31 22:29 | 5.3K | |
| Colombia 1.jpg | 2026-01-31 22:29 | 3.5K | |
| Colombia 2.jpg | 2026-01-31 22:29 | 4.7K | |
| Colombia 3.jpg | 2026-01-31 22:29 | 5.0K | |
| Comic Pepita y Papa.jpg | 2026-01-31 22:29 | 5.4K | |
| Como-ganar-el-debate..> | 2026-01-31 22:29 | 5.9K | |
| Compostela.png | 2026-01-31 22:29 | 17K | |
| Comprender la Salud ..> | 2026-01-31 22:29 | 3.2K | |
| Comunicación, infan..> | 2026-01-31 22:29 | 3.3K | |
| Conclusiones de la R..> | 2026-01-31 22:29 | 3.6K | |
| Concurso - copia.jpg | 2026-01-31 22:29 | 6.2K | |
| Concurso - copia_0.jpg | 2026-01-31 22:29 | 6.2K | |
| Concurso Buenas prá..> | 2026-01-31 22:29 | 3.8K | |
| Concurso fotografico..> | 2026-01-31 22:29 | 4.6K | |
| Concurso fotografico..> | 2026-01-31 22:29 | 5.2K | |
| Concurso fotografico..> | 2026-01-31 22:29 | 5.2K | |
| Concurso video.png | 2026-01-31 22:29 | 14K | |
| Conducción y Drogas..> | 2026-01-31 22:29 | 4.2K | |
| Conflictos entre pad..> | 2026-01-31 22:29 | 2.8K | |
| Cong-ABCF-SP-2015-21..> | 2026-01-31 22:29 | 5.9K | |
| Cong ABCF-SP 2015.jpg | 2026-01-31 22:29 | 5.8K | |
| Congreso-Cartagena-4..> | 2026-01-31 22:29 | 5.3K | |
| Congreso Adolescenci..> | 2026-01-31 22:29 | 4.7K | |
| Congreso Integrado.jpg | 2026-01-31 22:29 | 4.7K | |
| Congreso Integrado_0..> | 2026-01-31 22:29 | 4.7K | |
| Congreso Integrado_1..> | 2026-01-31 22:29 | 5.4K | |
| Congreso Integrado_2..> | 2026-01-31 22:29 | 5.4K | |
| Congreso Integrado d..> | 2026-01-31 22:29 | 4.7K | |
| Congreso Medicina Ge..> | 2026-01-31 22:29 | 4.9K | |
| Congreso Mercosul.png | 2026-01-31 22:29 | 3.6K | |
| Congreso SPAJ 2013.jpg | 2026-01-31 22:29 | 5.2K | |
| Congreso de Medicina..> | 2026-01-31 22:29 | 18K | |
| Con mi hijo no. Manu..> | 2026-01-31 22:29 | 4.7K | |
| Consecuencias socioe..> | 2026-01-31 22:29 | 12K | |
| Consejería en Salud..> | 2026-01-31 22:29 | 4.2K | |
| Consejería para pad..> | 2026-01-31 22:29 | 4.0K | |
| Consejo Consultivo ..> | 2026-01-31 22:29 | 4.6K | |
| Consejo consultivo.png | 2026-01-31 22:29 | 17K | |
| Consejos sobre activ..> | 2026-01-31 22:29 | 4.0K | |
| Consulta regional en..> | 2026-01-31 22:29 | 3.5K | |
| Consumo de alcohol y..> | 2026-01-31 22:29 | 3.1K | |
| Consumo de cannabis ..> | 2026-01-31 22:29 | 3.7K | |
| Consumo de sustancia..> | 2026-01-31 22:29 | 3.0K | |
| Consumo de tabaco y ..> | 2026-01-31 22:29 | 4.8K | |
| Consumo de tabaco y ..> | 2026-01-31 22:29 | 4.8K | |
| Conversatorio.jpg | 2026-01-31 22:29 | 4.4K | |
| Conversatorio 06.06...> | 2026-01-31 22:29 | 5.7K | |
| Convocatoria.jpg | 2026-01-31 22:29 | 4.2K | |
| Copertina.jpg | 2026-01-31 22:29 | 4.3K | |
| Copertina_0.jpg | 2026-01-31 22:29 | 4.3K | |
| Copertina web.jpg | 2026-01-31 22:29 | 4.2K | |
| Copia de DSC02683.JPG | 2026-01-31 22:29 | 5.2K | |
| CoreIndicators2018_e..> | 2026-01-31 22:29 | 3.0K | |
| Corona.jpg | 2026-01-31 22:29 | 3.9K | |
| Costa-Rica.jpg | 2026-01-31 22:29 | 3.0K | |
| Costa Rica.jpg | 2026-01-31 22:29 | 5.1K | |
| Costo Violencia.png | 2026-01-31 22:29 | 21K | |
| Covid-193.png | 2026-01-31 22:29 | 26K | |
| Crecer en un entorno..> | 2026-01-31 22:29 | 4.4K | |
| Cuídate, mujer.png | 2026-01-31 22:29 | 15K | |
| Cuadro de Procedimie..> | 2026-01-31 22:29 | 4.1K | |
| Cuba.jpg | 2026-01-31 22:29 | 4.3K | |
| Cuba 2.jpg | 2026-01-31 22:29 | 3.8K | |
| Cuba 18.png | 2026-01-31 22:29 | 13K | |
| Cuba Bandera.jpg | 2026-01-31 22:29 | 3.0K | |
| Cuba Psi_0.jpg | 2026-01-31 22:29 | 4.4K | |
| Cuba_0.jpg | 2026-01-31 22:29 | 4.3K | |
| Cuentos para preveni..> | 2026-01-31 22:29 | 4.6K | |
| Cuentos para preveni..> | 2026-01-31 22:29 | 3.9K | |
| Curso online gratuit..> | 2026-01-31 22:29 | 3.6K | |
| Dónde está mi ESI ..> | 2026-01-31 22:29 | 4.4K | |
| D2BxQ4mUYAABucQ.jpg | 2026-01-31 22:29 | 3.2K | |
| DAFO Cannabis.jpg | 2026-01-31 22:29 | 3.4K | |
| DEcalogo.png | 2026-01-31 22:29 | 24K | |
| DEmus.jpg | 2026-01-31 22:29 | 4.1K | |
| DIVERSIDAD SEXUAL, S..> | 2026-01-31 22:29 | 4.4K | |
| DOC2-limites1200x315..> | 2026-01-31 22:29 | 20K | |
| DOC2-proyecto-Mindfu..> | 2026-01-31 22:29 | 22K | |
| DSCN0250.JPG | 2026-01-31 22:29 | 5.0K | |
| DSCN0421.JPG | 2026-01-31 22:29 | 3.3K | |
| DSCN0517.JPG | 2026-01-31 22:29 | 5.0K | |
| DSCN0534.JPG | 2026-01-31 22:29 | 4.4K | |
| DSCN0631.JPG | 2026-01-31 22:29 | 3.9K | |
| DSCN0697.JPG | 2026-01-31 22:29 | 5.0K | |
| DSCN7439.JPG | 2026-01-31 22:29 | 5.8K | |
| DSCN7714.JPG | 2026-01-31 22:29 | 3.9K | |
| DSCN8144.JPG | 2026-01-31 22:29 | 4.6K | |
| DSCN8611.JPG | 2026-01-31 22:29 | 4.6K | |
| DSCN8651.JPG | 2026-01-31 22:29 | 4.9K | |
| DSCN8748.JPG | 2026-01-31 22:29 | 5.1K | |
| DSCN9136.JPG | 2026-01-31 22:29 | 3.8K | |
| DSCN9577_0.JPG | 2026-01-31 22:29 | 4.0K | |
| DSCN9749.JPG | 2026-01-31 22:29 | 4.8K | |
| DSC_0030.JPG | 2026-01-31 22:29 | 5.1K | |
| DSC_0103.JPG | 2026-01-31 22:29 | 4.7K | |
| DSC_0382.JPG | 2026-01-31 22:29 | 4.5K | |
| DSC_0405.JPG | 2026-01-31 22:29 | 5.2K | |
| DSC_0407_0.JPG | 2026-01-31 22:29 | 5.3K | |
| DSC_0578.JPG | 2026-01-31 22:29 | 4.5K | |
| DSC_0627.JPG | 2026-01-31 22:29 | 5.3K | |
| DSC_0701.jpg | 2026-01-31 22:29 | 5.4K | |
| DSC_0701_0.jpg | 2026-01-31 22:29 | 5.4K | |
| DSC_1008.JPG | 2026-01-31 22:29 | 5.5K | |
| DSC_1008_0.JPG | 2026-01-31 22:29 | 5.5K | |
| DSC_1406.JPG | 2026-01-31 22:29 | 5.0K | |
| DSM5.jpg | 2026-01-31 22:29 | 4.3K | |
| DUELO COVID NIÑOS...> | 2026-01-31 22:29 | 4.6K | |
| David-Finkelhor-en-A..> | 2026-01-31 22:29 | 4.2K | |
| Declaración de TUNE..> | 2026-01-31 22:29 | 6.1K | |
| De infundir miedo a ..> | 2026-01-31 22:29 | 2.6K | |
| De la retórica a la..> | 2026-01-31 22:29 | 4.2K | |
| Dengue.jpg | 2026-01-31 22:29 | 4.8K | |
| Depresión y suicidi..> | 2026-01-31 22:29 | 2.8K | |
| Depresion.JPG | 2026-01-31 22:29 | 3.6K | |
| Depresion.png | 2026-01-31 22:29 | 12K | |
| Depresion_0.png | 2026-01-31 22:29 | 12K | |
| Derecho.jpg | 2026-01-31 22:29 | 4.3K | |
| Derechos.jpg | 2026-01-31 22:29 | 5.2K | |
| Derechos Sexuales y ..> | 2026-01-31 22:29 | 3.6K | |
| Derechos_0.jpg | 2026-01-31 22:29 | 4.7K | |
| Derechos sexuales y ..> | 2026-01-31 22:29 | 4.6K | |
| Desarrollo Positivo ..> | 2026-01-31 22:29 | 4.0K | |
| Desarrollo de conduc..> | 2026-01-31 22:29 | 2.4K | |
| Desempolvando_Cabeza..> | 2026-01-31 22:29 | 22K | |
| Desigualdades socioe..> | 2026-01-31 22:29 | 2.5K | |
| Desmitificando datos..> | 2026-01-31 22:29 | 4.5K | |
| Detección temprana ..> | 2026-01-31 22:29 | 2.9K | |
| Determinantes Social..> | 2026-01-31 22:29 | 5.7K | |
| Diálogo con Darío ..> | 2026-01-31 22:29 | 3.2K | |
| Dia-Padre_LPRIMA2016..> | 2026-01-31 22:29 | 4.5K | |
| Dia_Juventud_GobBlog..> | 2026-01-31 22:29 | 17K | |
| Dia_Juventud_GobBlog..> | 2026-01-31 22:29 | 17K | |
| Diagnostico y Tratam..> | 2026-01-31 22:29 | 14K | |
| Dialogo de saberes.jpg | 2026-01-31 22:29 | 3.6K | |
| Dibujando la sexuali..> | 2026-01-31 22:29 | 3.6K | |
| Diferencias de géne..> | 2026-01-31 22:29 | 6.2K | |
| Diferentes.jpg | 2026-01-31 22:29 | 5.1K | |
| Diplomado.jpg | 2026-01-31 22:29 | 3.2K | |
| Directrices.png | 2026-01-31 22:29 | 17K | |
| Distintas miradas y ..> | 2026-01-31 22:29 | 4.6K | |
| Diversidad.jpg | 2026-01-31 22:29 | 4.2K | |
| Diversidad sexual y ..> | 2026-01-31 22:29 | 2.9K | |
| DkFwP8KV4AEtauH.jpg | 2026-01-31 22:29 | 4.5K | |
| Doble Protección.jpg | 2026-01-31 22:29 | 5.1K | |
| Documento de informa..> | 2026-01-31 22:29 | 3.9K | |
| Dogitales.jpg | 2026-01-31 22:29 | 3.8K | |
| Dogitales_0.jpg | 2026-01-31 22:29 | 3.8K | |
| Dosier-Lectura-digit..> | 2026-01-31 22:29 | 23K | |
| Drogas.jpg | 2026-01-31 22:29 | 4.9K | |
| DrogasDerribemos los..> | 2026-01-31 22:29 | 5.0K | |
| Drogas_0.jpg | 2026-01-31 22:29 | 4.3K | |
| Drogas ilegales, eco..> | 2026-01-31 22:29 | 2.3K | |
| Drogas laboral.jpg | 2026-01-31 22:29 | 3.4K | |
| Duelo .jpg | 2026-01-31 22:29 | 3.7K | |
| E4GC65OXEAEjNu9.jpg | 2026-01-31 22:29 | 4.1K | |
| EDADES 2015.jpg | 2026-01-31 22:29 | 4.1K | |
| EDUCACIÓN EMOCIONAL..> | 2026-01-31 22:29 | 3.6K | |
| EFECTOS Cover_0.jpg | 2026-01-31 22:29 | 5.3K | |
| EK85f7AXYAE4RKG.jpg | 2026-01-31 22:29 | 4.7K | |
| EL MALTRATO ENTRE ES..> | 2026-01-31 22:29 | 8.3K | |
| EME - Fundación Cul..> | 2026-01-31 22:29 | 4.2K | |
| EMERGENCIA DE CULTUR..> | 2026-01-31 22:29 | 3.0K | |
| EPDrBKGXUAA97lK-1-10..> | 2026-01-31 22:29 | 3.7K | |
| ES-Engaging-Men-in-P..> | 2026-01-31 22:29 | 4.6K | |
| ESI.jpg | 2026-01-31 22:29 | 2.7K | |
| ESI.png | 2026-01-31 22:29 | 21K | |
| ESI_0.jpg | 2026-01-31 22:29 | 5.1K | |
| ESKUA1.jpg | 2026-01-31 22:29 | 3.5K | |
| EStadisticas.jpg | 2026-01-31 22:29 | 2.3K | |
| EUSES.jpg | 2026-01-31 22:29 | 3.5K | |
| EWEC LAC.png | 2026-01-31 22:29 | 17K | |
| EWmKI3vXQAA3X_Q.jpg | 2026-01-31 22:29 | 4.1K | |
| EbpG7sdX0AEt0VX.jpg | 2026-01-31 22:29 | 4.8K | |
| Ecuador Protocolo-fr..> | 2026-01-31 22:29 | 9.0K | |
| Eduard Punset.jpg | 2026-01-31 22:29 | 4.0K | |
| Educa, no pegues..jpg | 2026-01-31 22:29 | 3.1K | |
| Educación-Sexual-Ne..> | 2026-01-31 22:29 | 22K | |
| Educación Permanent..> | 2026-01-31 22:29 | 21K | |
| Educación en sexual..> | 2026-01-31 22:29 | 5.2K | |
| Educación sexual y ..> | 2026-01-31 22:29 | 2.4K | |
| EducacionSexual Disc..> | 2026-01-31 22:29 | 4.7K | |
| Educacion_integral-2..> | 2026-01-31 22:29 | 3.1K | |
| EeMW9QJXsAAHX_s.png | 2026-01-31 22:29 | 30K | |
| El-paco-bajo-lupa-30..> | 2026-01-31 22:29 | 3.4K | |
| El Enfoque de Salud ..> | 2026-01-31 22:29 | 2.8K | |
| El Maitén 001.jpg | 2026-01-31 22:29 | 4.6K | |
| ElNovioDeMiHija_150.png | 2026-01-31 22:29 | 20K | |
| El Salvador.jpg | 2026-01-31 22:29 | 5.2K | |
| El Salvador Embarazo..> | 2026-01-31 22:29 | 3.6K | |
| El abordaje de la ep..> | 2026-01-31 22:29 | 2.2K | |
| El abuso sexual infa..> | 2026-01-31 22:29 | 4.3K | |
| El acoso escolar y l..> | 2026-01-31 22:29 | 4.5K | |
| El consumo de alcoho..> | 2026-01-31 22:29 | 3.6K | |
| El cuidado de sí en..> | 2026-01-31 22:29 | 5.5K | |
| El derecho al cuidad..> | 2026-01-31 22:29 | 3.0K | |
| El embarazo en adole..> | 2026-01-31 22:29 | 3.8K | |
| El fenómeno de las ..> | 2026-01-31 22:29 | 3.9K | |
| Elige-no-fumar-mapa.jpg | 2026-01-31 22:29 | 4.7K | |
| El nuevo paradigma d..> | 2026-01-31 22:29 | 3.7K | |
| El placer de romper ..> | 2026-01-31 22:29 | 2.9K | |
| El salvador.png | 2026-01-31 22:29 | 19K | |
| El suicidio en la ad..> | 2026-01-31 22:29 | 9.1K | |
| Embarazo-adolescente..> | 2026-01-31 22:29 | 3.3K | |
| Embarazo.jpg | 2026-01-31 22:29 | 2.5K | |
| Embarazo Adolescente..> | 2026-01-31 22:29 | 5.2K | |
| Embarazo_0.jpg | 2026-01-31 22:29 | 6.5K | |
| Embarazo adolescente..> | 2026-01-31 22:29 | 3.8K | |
| Embarazos no intenci..> | 2026-01-31 22:29 | 16K | |
| Emponderamiento de l..> | 2026-01-31 22:29 | 8.7K | |
| Empower women facing..> | 2026-01-31 22:29 | 4.5K | |
| En busca de las cond..> | 2026-01-31 22:29 | 2.2K | |
| Encuentro Meeting ..> | 2026-01-31 22:29 | 5.1K | |
| Encuesta .jpg | 2026-01-31 22:29 | 3.3K | |
| Encuesta CODAJIC .jpg | 2026-01-31 22:29 | 2.8K | |
| Encuesta a profesore..> | 2026-01-31 22:29 | 2.8K | |
| Encuesta sobre Alcoh..> | 2026-01-31 22:29 | 3.8K | |
| Encuesta sobre adicc..> | 2026-01-31 22:29 | 2.3K | |
| En el límite. Histo..> | 2026-01-31 22:29 | 2.5K | |
| En el laberinto... n..> | 2026-01-31 22:29 | 2.3K | |
| Enojo.png | 2026-01-31 22:29 | 15K | |
| Ensuring the sexual ..> | 2026-01-31 22:29 | 5.4K | |
| Entrá y divertite.jpg | 2026-01-31 22:29 | 3.7K | |
| Entre Pares.jpg | 2026-01-31 22:29 | 4.3K | |
| Entre la educación ..> | 2026-01-31 22:29 | 3.3K | |
| Equidad.jpg | 2026-01-31 22:29 | 4.8K | |
| Equidad_0.jpg | 2026-01-31 22:29 | 3.9K | |
| España.jpg | 2026-01-31 22:29 | 5.1K | |
| Espacio de escucha y..> | 2026-01-31 22:29 | 4.1K | |
| Espacios-Amigables-V..> | 2026-01-31 22:29 | 5.4K | |
| Espacios Amigables S..> | 2026-01-31 22:29 | 4.8K | |
| Es parte de la vida...> | 2026-01-31 22:29 | 3.4K | |
| EsquivaTG.JPG | 2026-01-31 22:29 | 4.8K | |
| Estándares de calid..> | 2026-01-31 22:29 | 3.4K | |
| Esta bueno Conversar..> | 2026-01-31 22:29 | 6.1K | |
| Estadísticas Sanita..> | 2026-01-31 22:29 | 4.5K | |
| Estadísticas de la ..> | 2026-01-31 22:29 | 10K | |
| Estado de la Poblaci..> | 2026-01-31 22:29 | 4.9K | |
| Estado de la Poblaci..> | 2026-01-31 22:29 | 29K | |
| Estado de la poblaci..> | 2026-01-31 22:29 | 5.9K | |
| Estado de situación..> | 2026-01-31 22:29 | 3.9K | |
| Estiron.jpg | 2026-01-31 22:29 | 3.0K | |
| Estrategia conjunta ..> | 2026-01-31 22:29 | 31K | |
| Estrategia de la UNE..> | 2026-01-31 22:29 | 26K | |
| Estrategia metodoló..> | 2026-01-31 22:29 | 19K | |
| Estrategias exitosas..> | 2026-01-31 22:29 | 4.0K | |
| Estrategia y Plan de..> | 2026-01-31 22:29 | 4.7K | |
| Estudiantes universi..> | 2026-01-31 22:29 | 3.4K | |
| Estudio Cualitativo ..> | 2026-01-31 22:29 | 14K | |
| Estudio Experiencias..> | 2026-01-31 22:29 | 3.6K | |
| Estudio Exploratorio..> | 2026-01-31 22:29 | 2.9K | |
| Estudio comparativo ..> | 2026-01-31 22:29 | 9.8K | |
| Estudio de seguimien..> | 2026-01-31 22:29 | 4.3K | |
| Estudios acerca del ..> | 2026-01-31 22:29 | 2.3K | |
| Etica.jpg | 2026-01-31 22:29 | 3.8K | |
| European Drug Report..> | 2026-01-31 22:29 | 3.4K | |
| Evaluación del Prog..> | 2026-01-31 22:29 | 5.1K | |
| Evento DT-785138.jpg | 2026-01-31 22:29 | 4.0K | |
| Eventos que generan ..> | 2026-01-31 22:29 | 5.8K | |
| Evict.jpg | 2026-01-31 22:29 | 3.8K | |
| Evidencias diagnóst..> | 2026-01-31 22:29 | 3.2K | |
| Evolución del consu..> | 2026-01-31 22:29 | 2.8K | |
| Experiencias para ar..> | 2026-01-31 22:29 | 4.3K | |
| Explicame.jpg | 2026-01-31 22:29 | 2.8K | |
| Explotacion ssexual.jpg | 2026-01-31 22:29 | 3.5K | |
| FAMILIAS-FUERTES-1.jpg | 2026-01-31 22:29 | 5.6K | |
| FB_IMG_1496933114501..> | 2026-01-31 22:29 | 4.5K | |
| Face.jpg | 2026-01-31 22:29 | 3.2K | |
| Factores de riesgo d..> | 2026-01-31 22:29 | 1.9K | |
| Factores individuale..> | 2026-01-31 22:29 | 5.1K | |
| Factores individuale..> | 2026-01-31 22:29 | 5.1K | |
| Familia.s. Del model..> | 2026-01-31 22:29 | 4.6K | |
| Fecundidad.jpg | 2026-01-31 22:29 | 4.0K | |
| Fecundidad no desead..> | 2026-01-31 22:29 | 2.6K | |
| Fecundidad y Materni..> | 2026-01-31 22:29 | 32K | |
| Felices Fiestas CODA..> | 2026-01-31 22:29 | 5.9K | |
| Felices Fiestas CODA..> | 2026-01-31 22:29 | 6.2K | |
| Felices Fiestas CODA..> | 2026-01-31 22:29 | 4.7K | |
| Felices Fiestas CODA..> | 2026-01-31 22:29 | 5.8K | |
| Felicidades Pascuas ..> | 2026-01-31 22:29 | 4.7K | |
| Feliz día Trabajado..> | 2026-01-31 22:29 | 3.7K | |
| Feminismo y Estudios..> | 2026-01-31 22:29 | 13K | |
| Feria.jpg | 2026-01-31 22:29 | 4.0K | |
| Flacso.jpg | 2026-01-31 22:29 | 3.6K | |
| Flier Taller SEP.jpg | 2026-01-31 22:29 | 4.2K | |
| Florianópolis.jpg | 2026-01-31 22:29 | 2.8K | |
| Flyer_Jornada_Inaugu..> | 2026-01-31 22:29 | 3.2K | |
| Forjando la Paz.jpg | 2026-01-31 22:29 | 4.2K | |
| Forjando liderazgo.jpg | 2026-01-31 22:29 | 3.6K | |
| Formador de Formador..> | 2026-01-31 22:29 | 3.9K | |
| Foro.jpg | 2026-01-31 22:29 | 3.4K | |
| Foro.png | 2026-01-31 22:29 | 11K | |
| Foro Regional de Juv..> | 2026-01-31 22:29 | 25K | |
| Foro de Juventudes .jpg | 2026-01-31 22:29 | 5.7K | |
| Foro del sector soci..> | 2026-01-31 22:29 | 17K | |
| Fortaleciendo Famili..> | 2026-01-31 22:29 | 3.2K | |
| Fortaleciendo Famili..> | 2026-01-31 22:29 | 4.6K | |
| Fortaleciendo Famili..> | 2026-01-31 22:29 | 4.6K | |
| Fortaleciendo Famili..> | 2026-01-31 22:29 | 4.6K | |
| Fortaleciendo Famili..> | 2026-01-31 22:29 | 4.6K | |
| Frame-Alape-WEB - co..> | 2026-01-31 22:29 | 3.4K | |
| Frecuencia de juego ..> | 2026-01-31 22:29 | 4.1K | |
| Fundación Konrad Ad..> | 2026-01-31 22:29 | 4.1K | |
| Fundamentos epistemo..> | 2026-01-31 22:29 | 5.6K | |
| GBV_PocketGuide02171..> | 2026-01-31 22:29 | 4.9K | |
| GSIA-cabecera-blog-9..> | 2026-01-31 22:29 | 3.7K | |
| GTR.jpg | 2026-01-31 22:29 | 5.2K | |
| Ganadores.jpg | 2026-01-31 22:29 | 4.7K | |
| Gaza.jpg | 2026-01-31 22:29 | 4.3K | |
| Gaza_0.jpg | 2026-01-31 22:29 | 4.3K | |
| Generación móvil, ..> | 2026-01-31 22:29 | 4.5K | |
| Genero.jpg | 2026-01-31 22:29 | 4.7K | |
| Genero Adolescencia.jpg | 2026-01-31 22:29 | 4.7K | |
| Global-Leaders-Counc..> | 2026-01-31 22:29 | 4.0K | |
| Greene, Margaret E.R..> | 2026-01-31 22:29 | 6.2K | |
| Gripe española .jpg | 2026-01-31 22:29 | 4.9K | |
| Grooming.jpg | 2026-01-31 22:29 | 4.7K | |
| Grupo de Trabajo de ..> | 2026-01-31 22:29 | 2.3K | |
| Guía-Niñez.jpg | 2026-01-31 22:29 | 5.7K | |
| Guía-atención-pers..> | 2026-01-31 22:29 | 4.8K | |
| Guía-conversación-..> | 2026-01-31 22:29 | 29K | |
| Guía-de-apoyo-psico..> | 2026-01-31 22:29 | 3.5K | |
| Guía-metodológica-..> | 2026-01-31 22:29 | 3.9K | |
| Guía Egreso en la r..> | 2026-01-31 22:29 | 34K | |
| Guía Estimulación ..> | 2026-01-31 22:29 | 4.5K | |
| Guía Periodismo de ..> | 2026-01-31 22:29 | 2.8K | |
| Guía Práctica para..> | 2026-01-31 22:29 | 4.9K | |
| Guía Práctica para..> | 2026-01-31 22:29 | 11K | |
| Guía_Federal_de_Ori..> | 2026-01-31 22:29 | 5.2K | |
| Guía de Entornos Sa..> | 2026-01-31 22:29 | 4.0K | |
| Guía de Entrevista ..> | 2026-01-31 22:29 | 17K | |
| Guía de Indicadores..> | 2026-01-31 22:29 | 6.2K | |
| Guía de Orientació..> | 2026-01-31 22:29 | 4.3K | |
| Guía de Recomendaci..> | 2026-01-31 22:29 | 4.7K | |
| Guía de Recursos on..> | 2026-01-31 22:29 | 4.2K | |
| Guía de actuación ..> | 2026-01-31 22:29 | 19K | |
| Guía de actuación ..> | 2026-01-31 22:29 | 3.5K | |
| Guía de adicciones ..> | 2026-01-31 22:29 | 4.0K | |
| Guía de apoyo psico..> | 2026-01-31 22:29 | 9.3K | |
| Guía de intervenci..> | 2026-01-31 22:29 | 2.9K | |
| Guía de intervenci..> | 2026-01-31 22:29 | 3.4K | |
| Guía de los buenos ..> | 2026-01-31 22:29 | 6.0K | |
| Guía de los derecho..> | 2026-01-31 22:29 | 4.4K | |
| Guía de orientacion..> | 2026-01-31 22:29 | 14K | |
| Guía de prevención..> | 2026-01-31 22:29 | 4.0K | |
| Guía de recomendaci..> | 2026-01-31 22:29 | 3.4K | |
| Guía de recursos y ..> | 2026-01-31 22:29 | 11K | |
| Guía informativa pa..> | 2026-01-31 22:29 | 3.7K | |
| Guía para Prestador..> | 2026-01-31 22:29 | 4.4K | |
| Guía para el embara..> | 2026-01-31 22:29 | 3.2K | |
| Guía para el uso de..> | 2026-01-31 22:29 | 4.0K | |
| Guía para la preven..> | 2026-01-31 22:29 | 3.8K | |
| Guía para padres y ..> | 2026-01-31 22:29 | 2.0K | |
| Guía para una inter..> | 2026-01-31 22:29 | 2.4K | |
| Guía sobre el duelo..> | 2026-01-31 22:29 | 3.4K | |
| Guía sobre mediaci..> | 2026-01-31 22:29 | 4.7K | |
| Guía sobre polític..> | 2026-01-31 22:29 | 3.3K | |
| Guía sobre violenci..> | 2026-01-31 22:29 | 4.5K | |
| Guia-buen-trato-y-vi..> | 2026-01-31 22:29 | 4.4K | |
| Guia-para-profesiona..> | 2026-01-31 22:29 | 5.1K | |
| Guia.jpg | 2026-01-31 22:29 | 3.1K | |
| Guia Comedores.jpg | 2026-01-31 22:29 | 4.1K | |
| GuiaInfantilGeneroAs..> | 2026-01-31 22:29 | 28K | |
| Guia Paternidad Acti..> | 2026-01-31 22:29 | 4.7K | |
| GuiaPortada.jpg | 2026-01-31 22:29 | 3.1K | |
| Guia Unicef.jpg | 2026-01-31 22:29 | 3.9K | |
| Guia_0.jpg | 2026-01-31 22:29 | 4.3K | |
| Guia_1.jpg | 2026-01-31 22:29 | 2.5K | |
| Guia abuso.jpg | 2026-01-31 22:29 | 3.8K | |
| Guia de atención in..> | 2026-01-31 22:29 | 15K | |
| Guia monstruosa.jpg | 2026-01-31 22:29 | 3.6K | |
| Hábitos, actividade..> | 2026-01-31 22:29 | 27K | |
| HIV.jpg | 2026-01-31 22:29 | 3.2K | |
| HNRGcolor.JPG | 2026-01-31 22:29 | 3.3K | |
| HPV I.jpg | 2026-01-31 22:29 | 3.5K | |
| Habilidades sociales..> | 2026-01-31 22:29 | 5.8K | |
| Hablemos de Drogas.jpg | 2026-01-31 22:29 | 2.5K | |
| Hablemos de Duelo. ..> | 2026-01-31 22:29 | 22K | |
| Hablemos de drogas U..> | 2026-01-31 22:29 | 11K | |
| Hacia la incorporaci..> | 2026-01-31 22:29 | 22K | |
| Hallazgos.jpg | 2026-01-31 22:29 | 3.8K | |
| Herramientas-pedagog..> | 2026-01-31 22:29 | 4.7K | |
| Hoja.jpg | 2026-01-31 22:29 | 3.0K | |
| Hoja de Ruta para el..> | 2026-01-31 22:29 | 3.6K | |
| Hoja mural FINAL-1.jpg | 2026-01-31 22:29 | 4.5K | |
| Hombres que se engen..> | 2026-01-31 22:29 | 29K | |
| Home-560x292-GuiasPe..> | 2026-01-31 22:29 | 4.9K | |
| Homofobia Acoso esco..> | 2026-01-31 22:29 | 3.1K | |
| Homoparentalidad.jpg | 2026-01-31 22:29 | 3.2K | |
| Hospital General de ..> | 2026-01-31 22:29 | 4.6K | |
| Hospital Gineco obst..> | 2026-01-31 22:29 | 13K | |
| Hospital Soler - Cop..> | 2026-01-31 22:29 | 2.9K | |
| Hy6HumOWQ_640x361__1..> | 2026-01-31 22:29 | 2.7K | |
| HzKKlyD5_400x400.jpg | 2026-01-31 22:29 | 2.8K | |
| HzKKlyD5_400x400_0.jpg | 2026-01-31 22:29 | 2.8K | |
| IAAH.jpg | 2026-01-31 22:29 | 3.4K | |
| IAAH 2013 Flyer Topk..> | 2026-01-31 22:29 | 3.6K | |
| I Coloquio Internaci..> | 2026-01-31 22:29 | 6.0K | |
| I Congresso Gaúcho ..> | 2026-01-31 22:29 | 16K | |
| I Estudio Piloto sob..> | 2026-01-31 22:29 | 33K | |
| II-Simposio-Nacional..> | 2026-01-31 22:29 | 23K | |
| II-Simposio-Nacional..> | 2026-01-31 22:29 | 23K | |
| IIBienal.jpg | 2026-01-31 22:29 | 4.0K | |
| II Congreso Internac..> | 2026-01-31 22:29 | 3.3K | |
| III Curso SEMA.jpg | 2026-01-31 22:29 | 3.9K | |
| III Curso SEMA_0.jpg | 2026-01-31 22:29 | 3.9K | |
| III Jornadas Patagon..> | 2026-01-31 22:29 | 5.4K | |
| III Reunión Naciona..> | 2026-01-31 22:29 | 3.8K | |
| II JORNADAS.jpg | 2026-01-31 22:29 | 5.0K | |
| II Jornadas_0.jpg | 2026-01-31 22:29 | 5.0K | |
| IM19434.jpg | 2026-01-31 22:29 | 4.5K | |
| IMG-20170815-WA0007.jpg | 2026-01-31 22:29 | 4.8K | |
| IMG-20180226-WA0048.jpg | 2026-01-31 22:29 | 5.3K | |
| IMG-20190531-WA0008.jpg | 2026-01-31 22:29 | 5.9K | |
| IMG-ADOLESCENCIA-02.jpg | 2026-01-31 22:29 | 5.9K | |
| INFOGRAFIA Deventaj..> | 2026-01-31 22:29 | 19K | |
| INSPIRE-7-estrategia..> | 2026-01-31 22:29 | 3.8K | |
| INT_cajaherramientas..> | 2026-01-31 22:29 | 4.3K | |
| INT_cajaherramientas..> | 2026-01-31 22:29 | 4.3K | |
| IPPFRHO.jpg | 2026-01-31 22:29 | 3.2K | |
| IPPF_MoneyMatters_LO..> | 2026-01-31 22:29 | 4.2K | |
| IV CORSO NAZIONALE S..> | 2026-01-31 22:29 | 4.8K | |
| IV CORSO NAZIONALE S..> | 2026-01-31 22:29 | 4.8K | |
| IV Congreso Mexicano..> | 2026-01-31 22:29 | 6.0K | |
| IYD_PAHOACCOUNTS_esp..> | 2026-01-31 22:29 | 5.4K | |
| Iber jovenes.jpg | 2026-01-31 22:29 | 4.3K | |
| Igualdade Parental.png | 2026-01-31 22:29 | 17K | |
| Imagen-Curso-V-SEMA.jpg | 2026-01-31 22:29 | 4.1K | |
| Imagen-Curso-V-SEMA_..> | 2026-01-31 22:29 | 4.1K | |
| Imagen2.jpg | 2026-01-31 22:29 | 3.3K | |
| Imagen Lesiones Muer..> | 2026-01-31 22:29 | 3.5K | |
| Impacto Emocional 6-..> | 2026-01-31 22:29 | 3.5K | |
| Impacto por violenci..> | 2026-01-31 22:29 | 13K | |
| Impacto social y eco..> | 2026-01-31 22:29 | 2.2K | |
| Inactividad física ..> | 2026-01-31 22:29 | 4.2K | |
| Incorporación de la..> | 2026-01-31 22:29 | 9.3K | |
| Infâncias escoadas ..> | 2026-01-31 22:29 | 6.7K | |
| Infancia-ciencia-y-t..> | 2026-01-31 22:29 | 12K | |
| Infografía-Español..> | 2026-01-31 22:29 | 19K | |
| Informe (Des)informa..> | 2026-01-31 22:29 | 6.0K | |
| Informe 2016. Alcoho..> | 2026-01-31 22:29 | 3.3K | |
| Informe 2017.png | 2026-01-31 22:29 | 15K | |
| Informe Consumo Drog..> | 2026-01-31 22:29 | 16K | |
| Informe Epidemiológ..> | 2026-01-31 22:29 | 1.9K | |
| Informe de Estado de..> | 2026-01-31 22:29 | 5.3K | |
| Informe del Estado d..> | 2026-01-31 22:29 | 29K | |
| Informe mundial sobr..> | 2026-01-31 22:29 | 2.9K | |
| Informe sobre la sit..> | 2026-01-31 22:29 | 5.1K | |
| Informe sobre los me..> | 2026-01-31 22:29 | 4.0K | |
| Informe sobre pobrez..> | 2026-01-31 22:29 | 3.2K | |
| Iniciativa de la OPS..> | 2026-01-31 22:29 | 20K | |
| Insomnio en niños y..> | 2026-01-31 22:29 | 4.4K | |
| Inspirational-Quotes..> | 2026-01-31 22:29 | 4.0K | |
| Instituto Andaluz de..> | 2026-01-31 22:29 | 2.6K | |
| Inteligencias múlti..> | 2026-01-31 22:29 | 3.3K | |
| IntercambiEIS.jpg | 2026-01-31 22:29 | 4.0K | |
| International Confer..> | 2026-01-31 22:29 | 4.0K | |
| International Confer..> | 2026-01-31 22:29 | 4.0K | |
| Internet Segura Red..> | 2026-01-31 22:29 | 4.6K | |
| Internet y psicolog..> | 2026-01-31 22:29 | 3.7K | |
| Intervención breve ..> | 2026-01-31 22:29 | 3.0K | |
| Introducción a la p..> | 2026-01-31 22:29 | 4.4K | |
| Invertir en Juventud..> | 2026-01-31 22:29 | 4.1K | |
| Investigación, gest..> | 2026-01-31 22:29 | 4.6K | |
| Invitación.jpg | 2026-01-31 22:29 | 4.7K | |
| Invitación.png | 2026-01-31 22:29 | 26K | |
| Invitación Clase Es..> | 2026-01-31 22:29 | 4.6K | |
| Invitación worksho..> | 2026-01-31 22:29 | 3.5K | |
| Invitation-1.jpg | 2026-01-31 22:29 | 4.8K | |
| Invitation-1_0.jpg | 2026-01-31 22:29 | 4.8K | |
| Italiano.jpg | 2026-01-31 22:29 | 3.9K | |
| Iudicium prevención..> | 2026-01-31 22:29 | 2.4K | |
| Jóvenes, publicida..> | 2026-01-31 22:29 | 3.3K | |
| JORNADAS DE ACTUALIZ..> | 2026-01-31 22:29 | 5.0K | |
| Jóvenes, polític..> | 2026-01-31 22:29 | 13K | |
| Jornada Internaciona..> | 2026-01-31 22:29 | 6.0K | |
| Jornada_Conjuntab.jpg | 2026-01-31 22:29 | 3.9K | |
| Jornada de Actualiza..> | 2026-01-31 22:29 | 4.2K | |
| Jornada para Educado..> | 2026-01-31 22:29 | 5.3K | |
| Jornadas Diciembre_1..> | 2026-01-31 22:29 | 3.6K | |
| Jornadas ISALUD SIMA..> | 2026-01-31 22:29 | 5.0K | |
| Jornadas Patagónica..> | 2026-01-31 22:29 | 4.8K | |
| Juego.jpg | 2026-01-31 22:29 | 3.5K | |
| Jugando Juntos.png | 2026-01-31 22:29 | 32K | |
| Junta Internacional.JPG | 2026-01-31 22:29 | 3.3K | |
| Juntando adolescenci..> | 2026-01-31 22:29 | 5.2K | |
| Justicia.jpg | 2026-01-31 22:29 | 5.2K | |
| Justicia Juvenil.jpg | 2026-01-31 22:29 | 4.0K | |
| Justicia Juvenil y D..> | 2026-01-31 22:29 | 5.4K | |
| Justicia Juvenil y R..> | 2026-01-31 22:29 | 3.9K | |
| Justicia restaurador..> | 2026-01-31 22:29 | 4.1K | |
| Juventud en riesgo a..> | 2026-01-31 22:29 | 19K | |
| Juventudes, Violenci..> | 2026-01-31 22:29 | 11K | |
| Juventudes e infanci..> | 2026-01-31 22:29 | 18K | |
| K me cuentas_0.jpg | 2026-01-31 22:29 | 5.2K | |
| LGTBI (1).jpg | 2026-01-31 22:29 | 5.3K | |
| LGTBI .jpg | 2026-01-31 22:29 | 3.3K | |
| La Prematuridad en l..> | 2026-01-31 22:29 | 3.7K | |
| La Primera Infancia ..> | 2026-01-31 22:29 | 30K | |
| La Promoción del De..> | 2026-01-31 22:29 | 3.4K | |
| La adolescencia fren..> | 2026-01-31 22:29 | 4.4K | |
| La casa .jpg | 2026-01-31 22:29 | 4.3K | |
| La ciberviolencia ha..> | 2026-01-31 22:29 | 13K | |
| La cruel pedagogía ..> | 2026-01-31 22:29 | 2.9K | |
| La dimensión person..> | 2026-01-31 22:29 | 3.8K | |
| La educación técni..> | 2026-01-31 22:29 | 3.1K | |
| La era de la perplej..> | 2026-01-31 22:29 | 4.4K | |
| La evidencia cientí..> | 2026-01-31 22:29 | 2.9K | |
| La gestión ética d..> | 2026-01-31 22:29 | 23K | |
| La guía básica sob..> | 2026-01-31 22:29 | 4.2K | |
| La hora del cuco.jpg | 2026-01-31 22:29 | 3.1K | |
| La influencia de las..> | 2026-01-31 22:29 | 3.8K | |
| La juventud universi..> | 2026-01-31 22:29 | 3.0K | |
| La legislación fren..> | 2026-01-31 22:29 | 4.3K | |
| La marcha nocturna.jpg | 2026-01-31 22:29 | 3.0K | |
| La matriz de la desi..> | 2026-01-31 22:29 | 3.1K | |
| Lancet.adolescente.jpg | 2026-01-31 22:29 | 4.6K | |
| La pobreza monetaria..> | 2026-01-31 22:29 | 14K | |
| La prevención de la..> | 2026-01-31 22:29 | 4.1K | |
| La reducción de da..> | 2026-01-31 22:29 | 4.6K | |
| La regulación del c..> | 2026-01-31 22:29 | 4.6K | |
| La revolución del g..> | 2026-01-31 22:29 | 3.7K | |
| Las TIC y su influen..> | 2026-01-31 22:29 | 4.4K | |
| La salud de los adol..> | 2026-01-31 22:29 | 4.6K | |
| La salud y sus deter..> | 2026-01-31 22:29 | 6.3K | |
| Las brechas de géne..> | 2026-01-31 22:29 | 21K | |
| Las drogas, el cereb..> | 2026-01-31 22:29 | 4.5K | |
| Las familias disfunc..> | 2026-01-31 22:29 | 4.4K | |
| Las juventudes centr..> | 2026-01-31 22:29 | 2.6K | |
| Las voces de los y l..> | 2026-01-31 22:29 | 5.1K | |
| Legado Familiar.jpg | 2026-01-31 22:29 | 3.3K | |
| Le iniziative di buo..> | 2026-01-31 22:29 | 3.3K | |
| Lengua-de-Senas_0.jpg | 2026-01-31 22:29 | 4.4K | |
| Libreta MUJER.jpg | 2026-01-31 22:29 | 4.9K | |
| Libro-Todo-Bien.jpg | 2026-01-31 22:29 | 3.6K | |
| Libro.jpg | 2026-01-31 22:29 | 5.9K | |
| Libro CDN 30 Años ..> | 2026-01-31 22:29 | 4.9K | |
| LibroVivenciasRepFAb..> | 2026-01-31 22:29 | 4.2K | |
| Lineamiento sobre pr..> | 2026-01-31 22:29 | 5.0K | |
| Lineamientos sobre D..> | 2026-01-31 22:29 | 3.5K | |
| Lineamientos sobre D..> | 2026-01-31 22:29 | 3.4K | |
| Lineamientos sobre D..> | 2026-01-31 22:29 | 3.4K | |
| Lo-esencial-no-puede..> | 2026-01-31 22:29 | 4.4K | |
| Lo-que-hay-que-saber..> | 2026-01-31 22:29 | 3.5K | |
| Logo-INADI-horizonta..> | 2026-01-31 22:29 | 8.9K | |
| Logo-SAGIJch.png | 2026-01-31 22:29 | 10K | |
| Logo-SAGIJch1.png | 2026-01-31 22:29 | 10K | |
| Logo-SUP.jpg | 2026-01-31 22:29 | 2.5K | |
| Logo-final [Reducido..> | 2026-01-31 22:29 | 4.2K | |
| Logo.jpg | 2026-01-31 22:29 | 4.4K | |
| LogoOPS-OMS.gif | 2026-01-31 22:29 | 10K | |
| Logo SASIA - copia.JPG | 2026-01-31 22:29 | 2.9K | |
| Logo_Con_Nombre_Medi..> | 2026-01-31 22:29 | 10K | |
| Logo_Gobierno.png | 2026-01-31 22:29 | 8.1K | |
| Logos-RCPUJ_0001_Uni..> | 2026-01-31 22:29 | 3.0K | |
| Logos.png | 2026-01-31 22:29 | 10K | |
| Logos_0.jpg | 2026-01-31 22:29 | 1.8K | |
| Los Niños, las Niñ..> | 2026-01-31 22:29 | 4.9K | |
| Los adolescentes que..> | 2026-01-31 22:29 | 3.5K | |
| Los héroes del pati..> | 2026-01-31 22:29 | 4.7K | |
| Los niños, las Niñ..> | 2026-01-31 22:29 | 4.5K | |
| L sS Pedamber ..> | 2026-01-31 22:29 | 3.9K | |
| Márianna Csóti.jpg | 2026-01-31 22:29 | 3.6K | |
| Médicos.jpg | 2026-01-31 22:29 | 3.2K | |
| MétodosAnticoncepti..> | 2026-01-31 22:29 | 4.6K | |
| Módulos formativos ..> | 2026-01-31 22:29 | 2.7K | |
| Móvil en tránsito.png | 2026-01-31 22:29 | 6.9K | |
| MEDINA ACOSTA, Marí..> | 2026-01-31 22:29 | 2.0K | |
| MINISTERIO DE LA MUJ..> | 2026-01-31 22:29 | 14K | |
| MINSAL.jpg | 2026-01-31 22:29 | 2.8K | |
| MOV052.jpg | 2026-01-31 22:29 | 2.8K | |
| Mamá, Papá Qué es..> | 2026-01-31 22:29 | 4.3K | |
| Manejo ético del ad..> | 2026-01-31 22:29 | 3.8K | |
| Manual-de-consenso-s..> | 2026-01-31 22:29 | 3.2K | |
| Manual-de-desarrollo..> | 2026-01-31 22:29 | 18K | |
| Manual.jpg | 2026-01-31 22:29 | 3.3K | |
| Manual de Normas 201..> | 2026-01-31 22:29 | 3.4K | |
| Manual de Psicologí..> | 2026-01-31 22:29 | 3.1K | |
| Manual de capacitaci..> | 2026-01-31 22:29 | 5.0K | |
| Manual de legislaci..> | 2026-01-31 22:29 | 2.9K | |
| Manual de tratamient..> | 2026-01-31 22:29 | 4.4K | |
| Manual para combatir..> | 2026-01-31 22:29 | 4.5K | |
| Manual para el Forta..> | 2026-01-31 22:29 | 4.1K | |
| Manual para el cuida..> | 2026-01-31 22:29 | 3.9K | |
| Mapa causal de situa..> | 2026-01-31 22:29 | 3.4K | |
| Marco de Implementac..> | 2026-01-31 22:29 | 2.8K | |
| MariCarmen.jpg | 2026-01-31 22:29 | 3.7K | |
| MariCarmen_0.jpg | 2026-01-31 22:29 | 3.7K | |
| Marihuana y adolesce..> | 2026-01-31 22:29 | 2.5K | |
| Mas allá de la anor..> | 2026-01-31 22:29 | 3.5K | |
| Masculinidades.jpg | 2026-01-31 22:29 | 4.7K | |
| Masculinidades y Pol..> | 2026-01-31 22:29 | 18K | |
| Masculinidades y pol..> | 2026-01-31 22:29 | 3.0K | |
| Maternidad.jpg | 2026-01-31 22:29 | 5.0K | |
| Maternidad Segura y ..> | 2026-01-31 22:29 | 4.0K | |
| Maternidad en la Ni..> | 2026-01-31 22:29 | 4.4K | |
| Maternidad temprana ..> | 2026-01-31 22:29 | 3.4K | |
| Maternidad y Paterni..> | 2026-01-31 22:29 | 4.1K | |
| Me cambió la vida.jpg | 2026-01-31 22:29 | 4.9K | |
| Medios.jpg | 2026-01-31 22:29 | 5.3K | |
| Mejorar la equidad e..> | 2026-01-31 22:29 | 5.1K | |
| Memorias_Seminario_O..> | 2026-01-31 22:29 | 3.8K | |
| Menores vulnerables ..> | 2026-01-31 22:29 | 4.8K | |
| Mesa1.jpg | 2026-01-31 22:29 | 3.6K | |
| Metodología del mar..> | 2026-01-31 22:29 | 2.5K | |
| Mexico.jpg | 2026-01-31 22:29 | 5.3K | |
| Migración Sudameric..> | 2026-01-31 22:29 | 2.7K | |
| Migrantes.jpg | 2026-01-31 22:29 | 4.0K | |
| Milano.jpg | 2026-01-31 22:29 | 5.0K | |
| Mil colores.jpg | 2026-01-31 22:29 | 3.6K | |
| Mindfulness (1).jpg | 2026-01-31 22:29 | 4.4K | |
| Ministerio d salud.png | 2026-01-31 22:29 | 14K | |
| Mi papá me cuida - ..> | 2026-01-31 22:29 | 5.2K | |
| Mira-que-te-Miroplac..> | 2026-01-31 22:29 | 3.3K | |
| Mitos Marihuana.jpg | 2026-01-31 22:29 | 3.7K | |
| Modelo Metodológico..> | 2026-01-31 22:29 | 4.8K | |
| Modelo de contrato p..> | 2026-01-31 22:29 | 3.4K | |
| Modelo de vigilancia..> | 2026-01-31 22:29 | 3.7K | |
| Modelos de Familia. ..> | 2026-01-31 22:29 | 3.6K | |
| Momento decisivo.La ..> | 2026-01-31 22:29 | 5.3K | |
| Muertes.jpg | 2026-01-31 22:29 | 2.0K | |
| Mujeres-y-Drogas-en-..> | 2026-01-31 22:29 | 4.8K | |
| Mujeres.jpg | 2026-01-31 22:29 | 5.4K | |
| Mujeres_0.jpg | 2026-01-31 22:29 | 4.7K | |
| Mujeres afrodescendi..> | 2026-01-31 22:29 | 5.0K | |
| NEUTRA1.jpg | 2026-01-31 22:29 | 3.6K | |
| NO NACEMOS MACHOS. C..> | 2026-01-31 22:29 | 9.7K | |
| Naciones Unidas.jpg | 2026-01-31 22:29 | 4.5K | |
| Necesidades de atenc..> | 2026-01-31 22:29 | 5.1K | |
| Niñas y Adolescente..> | 2026-01-31 22:29 | 4.8K | |
| Niñas y adolescente..> | 2026-01-31 22:29 | 5.1K | |
| Niñez y Violencias...> | 2026-01-31 22:29 | 4.5K | |
| Niños con Trastorno..> | 2026-01-31 22:29 | 24K | |
| Niños y niñas fren..> | 2026-01-31 22:29 | 3.9K | |
| No-Bullying.png | 2026-01-31 22:29 | 15K | |
| No_Bullying_circle.gif | 2026-01-31 22:29 | 6.4K | |
| No_violencia.jpg | 2026-01-31 22:29 | 4.4K | |
| No te enredes .jpg | 2026-01-31 22:29 | 3.6K | |
| Nuestros_Derechos_.jpg | 2026-01-31 22:29 | 4.3K | |
| Nueva imagen.JPG | 2026-01-31 22:29 | 5.3K | |
| NuevoProtocolo para ..> | 2026-01-31 22:29 | 4.9K | |
| Nuevos desafíos en ..> | 2026-01-31 22:29 | 2.9K | |
| Nutrición y aliment..> | 2026-01-31 22:29 | 4.1K | |
| ODSostenible.jpg | 2026-01-31 22:29 | 5.0K | |
| OEDA-Informe2020.jpg | 2026-01-31 22:29 | 2.3K | |
| OIJ.gif | 2026-01-31 22:29 | 3.8K | |
| OPS-20160218-Modelo-..> | 2026-01-31 22:29 | 2.3K | |
| OPS.jpg | 2026-01-31 22:29 | 4.7K | |
| OPS.png | 2026-01-31 22:29 | 15K | |
| OPSFGL16016-spa.pdf.jpg | 2026-01-31 22:29 | 2.2K | |
| OPSNMH19016_spa.pdf.jpg | 2026-01-31 22:29 | 3.0K | |
| OPS WHO.png | 2026-01-31 22:29 | 20K | |
| OPS_0.jpg | 2026-01-31 22:29 | 4.7K | |
| OPS_0.png | 2026-01-31 22:29 | 15K | |
| OPS_1.jpg | 2026-01-31 22:29 | 4.7K | |
| OPS_2.jpg | 2026-01-31 22:29 | 4.7K | |
| OPS_KV_Educacion-Sex..> | 2026-01-31 22:29 | 23K | |
| OPS_OMS horizontal.png | 2026-01-31 22:29 | 15K | |
| OPS_OMS horizontal_0..> | 2026-01-31 22:29 | 15K | |
| Obesidad, una cuesti..> | 2026-01-31 22:29 | 5.0K | |
| Obesidad.jpg | 2026-01-31 22:29 | 4.3K | |
| Obesidad Evolución.jpg | 2026-01-31 22:29 | 4.1K | |
| Objecion de Concienc..> | 2026-01-31 22:29 | 4.0K | |
| Objecion de Concienc..> | 2026-01-31 22:29 | 4.0K | |
| Observatorio-de-la-D..> | 2026-01-31 22:29 | 4.6K | |
| Observatorio de Psic..> | 2026-01-31 22:29 | 11K | |
| Ocio saludable, func..> | 2026-01-31 22:29 | 4.0K | |
| Octubre Las Grutas.jpg | 2026-01-31 22:29 | 4.2K | |
| Ojos verdes.Cuento s..> | 2026-01-31 22:29 | 2.7K | |
| Opinión de adolesce..> | 2026-01-31 22:29 | 3.6K | |
| Opiniones de los y l..> | 2026-01-31 22:29 | 3.9K | |
| Organización Iberoa..> | 2026-01-31 22:29 | 4.3K | |
| Organización Paname..> | 2026-01-31 22:29 | 28K | |
| Organización Paname..> | 2026-01-31 22:29 | 34K | |
| Orientaciones sexual..> | 2026-01-31 22:29 | 5.2K | |
| Orientaciones técni..> | 2026-01-31 22:29 | 29K | |
| Páginas desdeCuader..> | 2026-01-31 22:29 | 22K | |
| PAHO.jpg | 2026-01-31 22:29 | 4.3K | |
| PAPI-ACCA_0.jpg | 2026-01-31 22:29 | 2.9K | |
| PATERNIDAD ACTIVA.jpg | 2026-01-31 22:29 | 3.2K | |
| PNSIA.jpg | 2026-01-31 22:29 | 2.1K | |
| PNSIA 1.jpg | 2026-01-31 22:29 | 2.1K | |
| PODES y Envión.png | 2026-01-31 22:29 | 13K | |
| PORTADA MÁS ALLÁ D..> | 2026-01-31 22:29 | 2.6K | |
| PORTADA_Adolescere-w..> | 2026-01-31 22:29 | 3.7K | |
| PORTADA_Cannabis_0.jpg | 2026-01-31 22:29 | 6.2K | |
| PRIDENA_0.jpg | 2026-01-31 22:29 | 4.8K | |
| PROHIBICIONISMO Y DR..> | 2026-01-31 22:29 | 5.1K | |
| PROYECTO HOMBRE EL M..> | 2026-01-31 22:29 | 4.2K | |
| PS_Banner_750x160_Su..> | 2026-01-31 22:29 | 3.2K | |
| Palermo-dic.jpg | 2026-01-31 22:29 | 4.8K | |
| Panama.jpg | 2026-01-31 22:29 | 2.5K | |
| Panama_0.jpg | 2026-01-31 22:29 | 2.5K | |
| Panama_1.jpg | 2026-01-31 22:29 | 3.0K | |
| Panama_2.jpg | 2026-01-31 22:29 | 2.5K | |
| Panorama 17.jpg | 2026-01-31 22:29 | 2.0K | |
| Panorama Social de A..> | 2026-01-31 22:29 | 2.8K | |
| Panorama Social de A..> | 2026-01-31 22:29 | 12K | |
| Panorama Social de A..> | 2026-01-31 22:29 | 2.1K | |
| Panorama Social de A..> | 2026-01-31 22:29 | 2.5K | |
| Panorama da Contrace..> | 2026-01-31 22:29 | 4.1K | |
| Panorama de la Segur..> | 2026-01-31 22:29 | 29K | |
| Panorama de la Situa..> | 2026-01-31 22:29 | 30K | |
| Panorama de la migra..> | 2026-01-31 22:29 | 2.8K | |
| Panorama de la migra..> | 2026-01-31 22:29 | 2.7K | |
| Panorama del estado ..> | 2026-01-31 22:29 | 4.1K | |
| Para Cada Adolescent..> | 2026-01-31 22:29 | 3.3K | |
| Paraguay.jpg | 2026-01-31 22:29 | 4.4K | |
| Paraguay Jornadas.jpg | 2026-01-31 22:29 | 5.1K | |
| Parentalidad-word-2-..> | 2026-01-31 22:29 | 3.0K | |
| Parentalidad-word-2-..> | 2026-01-31 22:29 | 3.0K | |
| Participación socia..> | 2026-01-31 22:29 | 4.6K | |
| Participar para Prev..> | 2026-01-31 22:29 | 4.3K | |
| Paso 2.jpg | 2026-01-31 22:29 | 3.4K | |
| Pasos para evitar la..> | 2026-01-31 22:29 | 3.3K | |
| Paternidad III.jpg | 2026-01-31 22:29 | 3.4K | |
| Patología dual prot..> | 2026-01-31 22:29 | 16K | |
| Pautas para evitar e..> | 2026-01-31 22:29 | 3.3K | |
| Pautas para la reali..> | 2026-01-31 22:29 | 5.5K | |
| Pawel-Kuczynski-cart..> | 2026-01-31 22:29 | 2.9K | |
| Pediatria e Adolesce..> | 2026-01-31 22:29 | 3.3K | |
| Pensamiento saludabl..> | 2026-01-31 22:29 | 2.9K | |
| Pensando en las adol..> | 2026-01-31 22:29 | 5.4K | |
| Pensar fuera del esp..> | 2026-01-31 22:29 | 3.5K | |
| Pensar la educación..> | 2026-01-31 22:29 | 3.6K | |
| Perú.jpg | 2026-01-31 22:29 | 3.3K | |
| Perú I Encuesta de ..> | 2026-01-31 22:29 | 4.2K | |
| Perú Por una salud ..> | 2026-01-31 22:29 | 4.0K | |
| Perú UNFPA-Ampliand..> | 2026-01-31 22:29 | 31K | |
| Perú_0.jpg | 2026-01-31 22:29 | 2.7K | |
| Perfil Epidemiológi..> | 2026-01-31 22:29 | 2.4K | |
| Periódico Plan ENIA..> | 2026-01-31 22:29 | 4.4K | |
| Periodico Adolescenc..> | 2026-01-31 22:29 | 7.3K | |
| Periodico Adolescenc..> | 2026-01-31 22:29 | 7.3K | |
| Personajes malos Cue..> | 2026-01-31 22:29 | 22K | |
| Personas, drogas y c..> | 2026-01-31 22:29 | 4.7K | |
| Personas, emociones ..> | 2026-01-31 22:29 | 29K | |
| Perspectiva-de-Géne..> | 2026-01-31 22:29 | 2.9K | |
| Perspectiva de géne..> | 2026-01-31 22:29 | 3.2K | |
| Perspectiva de géne..> | 2026-01-31 22:29 | 2.5K | |
| Peru.jpg | 2026-01-31 22:29 | 4.3K | |
| Peru.png | 2026-01-31 22:29 | 29K | |
| Peru Embarazo.jpg | 2026-01-31 22:29 | 5.4K | |
| Plan B.jpg | 2026-01-31 22:29 | 4.5K | |
| Plan Nacional de Pre..> | 2026-01-31 22:29 | 14K | |
| Plan de Adicciones d..> | 2026-01-31 22:29 | 4.0K | |
| Plan de Adicciones d..> | 2026-01-31 22:29 | 2.9K | |
| Plan de Transferenci..> | 2026-01-31 22:29 | 2.7K | |
| Plan del Sida e Infe..> | 2026-01-31 22:29 | 4.1K | |
| Plan prevención adi..> | 2026-01-31 22:29 | 2.8K | |
| Población, Salud Se..> | 2026-01-31 22:29 | 5.0K | |
| Politica Andina SSR ..> | 2026-01-31 22:29 | 3.1K | |
| Porno Familia.jpg | 2026-01-31 22:29 | 2.6K | |
| Porque soy hombre.jpg | 2026-01-31 22:29 | 2.9K | |
| Portada-Adolescere-2..> | 2026-01-31 22:29 | 4.1K | |
| Portada-Guía-Práct..> | 2026-01-31 22:29 | 2.3K | |
| Portada-Guia-Apoyo-A..> | 2026-01-31 22:29 | 14K | |
| Portada-Informe-conc..> | 2026-01-31 22:29 | 4.2K | |
| Portada-guia-genero-..> | 2026-01-31 22:29 | 4.2K | |
| Portada .jpg | 2026-01-31 22:29 | 3.2K | |
| Portada.jpg | 2026-01-31 22:29 | 3.6K | |
| Portada Novedades .jpg | 2026-01-31 22:29 | 6.0K | |
| Portada SEMA_opt_0.jpg | 2026-01-31 22:29 | 3.8K | |
| Portugal.jpg | 2026-01-31 22:29 | 2.9K | |
| Portugal_0.jpg | 2026-01-31 22:29 | 5.0K | |
| PosUNGASS 2016 Amér..> | 2026-01-31 22:29 | 3.8K | |
| Prácticas óptimas ..> | 2026-01-31 22:29 | 3.3K | |
| Prácticas inclusiva..> | 2026-01-31 22:29 | 5.2K | |
| PreCongreso.jpg | 2026-01-31 22:29 | 3.9K | |
| Precongreso.jpg | 2026-01-31 22:29 | 3.9K | |
| Precongreso_0.jpg | 2026-01-31 22:29 | 5.5K | |
| Presentación.jpg | 2026-01-31 22:29 | 3.5K | |
| Presentación1.jpg | 2026-01-31 22:29 | 4.9K | |
| Presentación1_0.jpg | 2026-01-31 22:29 | 2.6K | |
| Presentación1_1.jpg | 2026-01-31 22:29 | 5.3K | |
| Presentación1_2.jpg | 2026-01-31 22:29 | 5.2K | |
| Presentación1_3.jpg | 2026-01-31 22:29 | 5.0K | |
| Presentación1_4.jpg | 2026-01-31 22:29 | 4.5K | |
| Presentación1_5.jpg | 2026-01-31 22:29 | 3.6K | |
| Presentación1_6.jpg | 2026-01-31 22:29 | 3.6K | |
| Presentación1_7.jpg | 2026-01-31 22:29 | 2.9K | |
| Presentación1_8.jpg | 2026-01-31 22:29 | 3.3K | |
| Presentación1_9.jpg | 2026-01-31 22:29 | 3.3K | |
| Presentación1_10.jpg | 2026-01-31 22:29 | 5.3K | |
| Presentación ADOLEC..> | 2026-01-31 22:29 | 4.7K | |
| Presentación II Con..> | 2026-01-31 22:29 | 3.8K | |
| Presentación II Con..> | 2026-01-31 22:29 | 3.8K | |
| Presentación II Con..> | 2026-01-31 22:29 | 3.8K | |
| Presentación II Con..> | 2026-01-31 22:29 | 3.8K | |
| Presentación II Con..> | 2026-01-31 22:29 | 3.8K | |
| PresentaciónPrecong..> | 2026-01-31 22:29 | 3.0K | |
| Presentación Semina..> | 2026-01-31 22:29 | 4.2K | |
| Presentación Semina..> | 2026-01-31 22:29 | 4.2K | |
| PresentaciónUCundin..> | 2026-01-31 22:29 | 3.7K | |
| Presentación web_0.jpg | 2026-01-31 22:29 | 1.6K | |
| Presentacion III Jor..> | 2026-01-31 22:29 | 5.6K | |
| Presentacion III Jor..> | 2026-01-31 22:29 | 5.4K | |
| Presentacion III Jor..> | 2026-01-31 22:29 | 5.4K | |
| Presentacion Program..> | 2026-01-31 22:29 | 3.8K | |
| Presentazione standa..> | 2026-01-31 22:29 | 5.1K | |
| Presentazione standa..> | 2026-01-31 22:29 | 5.1K | |
| Presión-de-grupo.jpg | 2026-01-31 22:29 | 4.8K | |
| Prevención del Emba..> | 2026-01-31 22:29 | 4.7K | |
| Prevención del abus..> | 2026-01-31 22:29 | 2.0K | |
| Prevención de la co..> | 2026-01-31 22:29 | 2.2K | |
| Prevención del suic..> | 2026-01-31 22:29 | 3.9K | |
| Prevención y reducc..> | 2026-01-31 22:29 | 6.8K | |
| Prevención y reducc..> | 2026-01-31 22:29 | 12K | |
| Prevencion suicidio.jpg | 2026-01-31 22:29 | 3.4K | |
| Prevenir el consumo ..> | 2026-01-31 22:29 | 4.5K | |
| Prevention of harm c..> | 2026-01-31 22:29 | 2.6K | |
| Primera.jpg | 2026-01-31 22:29 | 3.7K | |
| Primera infancia.jpg | 2026-01-31 22:29 | 4.8K | |
| Primera reunión de ..> | 2026-01-31 22:29 | 4.1K | |
| Primeras Jornadas so..> | 2026-01-31 22:29 | 5.3K | |
| Procesosde_T_EP.JPG | 2026-01-31 22:29 | 4.7K | |
| Programa-VI-Curso-po..> | 2026-01-31 22:29 | 5.2K | |
| Programa Fortalecien..> | 2026-01-31 22:29 | 5.1K | |
| Programa Fortalecien..> | 2026-01-31 22:29 | 4.6K | |
| Programa Seminario.jpg | 2026-01-31 22:29 | 2.3K | |
| Programa_0.jpg | 2026-01-31 22:29 | 3.4K | |
| Programa de Estudio ..> | 2026-01-31 22:29 | 13K | |
| Programa de atenció..> | 2026-01-31 22:29 | 3.4K | |
| Programa de prevenci..> | 2026-01-31 22:29 | 12K | |
| Programa de prevenci..> | 2026-01-31 22:29 | 3.3K | |
| Programa de sensibil..> | 2026-01-31 22:29 | 13K | |
| Progress for Childre..> | 2026-01-31 22:29 | 3.8K | |
| Promoción Encuentro..> | 2026-01-31 22:29 | 4.0K | |
| Promotores.jpg | 2026-01-31 22:29 | 4.3K | |
| Promover la incorpor..> | 2026-01-31 22:29 | 3.2K | |
| Promoviendo procesos..> | 2026-01-31 22:29 | 4.6K | |
| Propuesta de regulac..> | 2026-01-31 22:29 | 3.3K | |
| Propuesta didáctica..> | 2026-01-31 22:29 | 5.9K | |
| Propuestas participa..> | 2026-01-31 22:29 | 4.1K | |
| Protección de la sa..> | 2026-01-31 22:29 | 5.8K | |
| Protección social e..> | 2026-01-31 22:29 | 4.7K | |
| Protocolo.jpg | 2026-01-31 22:29 | 3.6K | |
| Protocolo común par..> | 2026-01-31 22:29 | 2.3K | |
| Protocolo de actuaci..> | 2026-01-31 22:29 | 4.1K | |
| Protocolo de atenci..> | 2026-01-31 22:29 | 4.3K | |
| Protocolo de interve..> | 2026-01-31 22:29 | 3.0K | |
| Proyecto de ley para..> | 2026-01-31 22:29 | 3.5K | |
| Proyecto de primer ..> | 2026-01-31 22:29 | 3.0K | |
| Psi.jpg | 2026-01-31 22:29 | 4.4K | |
| Psi_0.jpg | 2026-01-31 22:29 | 2.6K | |
| Psicopedagogía.jpg | 2026-01-31 22:29 | 3.3K | |
| Pu.jpg | 2026-01-31 22:29 | 4.9K | |
| Public attitudes tow..> | 2026-01-31 22:29 | 2.7K | |
| Puericultura.jpg | 2026-01-31 22:29 | 4.1K | |
| Qué hacer si mi hij..> | 2026-01-31 22:29 | 21K | |
| QueHacer-Trama-tapa.jpg | 2026-01-31 22:29 | 5.7K | |
| Que los Derechos no ..> | 2026-01-31 22:29 | 2.8K | |
| Queriendo se entiend..> | 2026-01-31 22:29 | 3.4K | |
| REvista Sugia.jpg | 2026-01-31 22:29 | 4.5K | |
| RITALIN.jpg | 2026-01-31 22:29 | 2.9K | |
| Recife.jpg | 2026-01-31 22:29 | 4.6K | |
| Recomend-Dieteticout..> | 2026-01-31 22:29 | 2.4K | |
| Recomendaciones-emer..> | 2026-01-31 22:29 | 24K | |
| Recomendaciones de a..> | 2026-01-31 22:29 | 29K | |
| Recomendaciones para..> | 2026-01-31 22:29 | 3.0K | |
| Recomendaciones sobr..> | 2026-01-31 22:29 | 4.2K | |
| Red Argentina de Jó..> | 2026-01-31 22:29 | 4.2K | |
| Red Joven.jpg | 2026-01-31 22:29 | 5.9K | |
| Red Joven_0.jpg | 2026-01-31 22:29 | 5.9K | |
| Red Joven_4.jpg | 2026-01-31 22:29 | 5.9K | |
| Reflexiones.jpg | 2026-01-31 22:29 | 3.5K | |
| Reflexiones en tiemp..> | 2026-01-31 22:29 | 4.4K | |
| Reflexiones sobre el..> | 2026-01-31 22:29 | 3.2K | |
| RegionalReportAlcoho..> | 2026-01-31 22:29 | 29K | |
| Relaciones de apego...> | 2026-01-31 22:29 | 4.2K | |
| Rendimiento académi..> | 2026-01-31 22:29 | 4.9K | |
| Republica Dominicana..> | 2026-01-31 22:29 | 2.8K | |
| Republica Dominicana..> | 2026-01-31 22:29 | 4.4K | |
| Resiliencia.jpg | 2026-01-31 22:29 | 4.3K | |
| Resolución positiva..> | 2026-01-31 22:29 | 4.4K | |
| Respeten mi cuerpo.jpg | 2026-01-31 22:29 | 3.9K | |
| ResumenEjecutivoTICp..> | 2026-01-31 22:29 | 5.0K | |
| Retos para la Educac..> | 2026-01-31 22:29 | 4.0K | |
| Reunion Comite Adole..> | 2026-01-31 22:29 | 4.6K | |
| Reunion Paraguay 201..> | 2026-01-31 22:29 | 5.4K | |
| Reunion Punta Cana .jpg | 2026-01-31 22:29 | 4.8K | |
| Reunion Sociedades_1..> | 2026-01-31 22:29 | 5.0K | |
| Reunion Virtual.jpg | 2026-01-31 22:29 | 5.2K | |
| Revista-PH_93_portad..> | 2026-01-31 22:29 | 5.4K | |
| Revista.gif | 2026-01-31 22:29 | 14K | |
| Revista Adolescere V..> | 2026-01-31 22:29 | 4.6K | |
| Revista INFONOVA.jpg | 2026-01-31 22:29 | 5.0K | |
| Revista ISALUD Mayo ..> | 2026-01-31 22:29 | 4.0K | |
| Revista National Geo..> | 2026-01-31 22:29 | 3.8K | |
| Revista Psicologia d..> | 2026-01-31 22:29 | 1.6K | |
| Revista Salud Colect..> | 2026-01-31 22:29 | 4.0K | |
| Revista de Estudios ..> | 2026-01-31 22:29 | 2.9K | |
| Riesgo.jpg | 2026-01-31 22:29 | 4.6K | |
| Rivista Italiana di ..> | 2026-01-31 22:29 | 4.1K | |
| Rivista Italiana di ..> | 2026-01-31 22:29 | 4.1K | |
| Rompe Topicos.jpg | 2026-01-31 22:29 | 5.2K | |
| Rompiendo Tabues 06..> | 2026-01-31 22:29 | 5.1K | |
| Rondas de Dialogo.jpg | 2026-01-31 22:29 | 4.8K | |
| Run4Fun-EPF-300x300.jpg | 2026-01-31 22:29 | 4.8K | |
| Rutas de acción ant..> | 2026-01-31 22:29 | 5.1K | |
| S1500718_es.pdf.jpg | 2026-01-31 22:29 | 5.2K | |
| S1800662_es.pdf.jpg | 2026-01-31 22:29 | 3.6K | |
| S1800977_es.pdf.jpg | 2026-01-31 22:29 | 4.2K | |
| S2000307_es.pdf.jpg | 2026-01-31 22:29 | 2.2K | |
| SADI.jpg | 2026-01-31 22:29 | 3.9K | |
| SAHM-18-header.png | 2026-01-31 22:29 | 18K | |
| SAHM-19-header.jpg | 2026-01-31 22:29 | 4.9K | |
| SAP.png | 2026-01-31 22:29 | 11K | |
| SAP 2.jpg | 2026-01-31 22:29 | 3.1K | |
| SAP 2_0.jpg | 2026-01-31 22:29 | 3.1K | |
| SAP 2_1.jpg | 2026-01-31 22:29 | 3.1K | |
| SAP 2_2.jpg | 2026-01-31 22:29 | 3.1K | |
| SAP 2_3.jpg | 2026-01-31 22:29 | 3.1K | |
| SAP CONARPE.jpg | 2026-01-31 22:29 | 4.9K | |
| SAPI.jpg | 2026-01-31 22:29 | 4.8K | |
| SASIA.jpg | 2026-01-31 22:29 | 5.7K | |
| SASIA_0.jpg | 2026-01-31 22:29 | 3.0K | |
| SAVE-THE-DATE-Milano..> | 2026-01-31 22:29 | 5.1K | |
| SCP.jpg | 2026-01-31 22:29 | 4.3K | |
| SEDRONAR.png | 2026-01-31 22:29 | 15K | |
| SEDRONAR_0.png | 2026-01-31 22:29 | 10K | |
| SEMA_0.jpg | 2026-01-31 22:29 | 3.6K | |
| SEP_0.png | 2026-01-31 22:29 | 23K | |
| SEXSALUD´-2014.jpg | 2026-01-31 22:29 | 4.3K | |
| SEma Logo.jpg | 2026-01-31 22:29 | 2.8K | |
| SGA-ER.jpg | 2026-01-31 22:29 | 3.7K | |
| SIA.jpg | 2026-01-31 22:29 | 3.5K | |
| SIA_0.jpg | 2026-01-31 22:29 | 3.6K | |
| SIDA III.jpg | 2026-01-31 22:29 | 4.5K | |
| SIMA.jpg | 2026-01-31 22:29 | 3.4K | |
| SIMA2015sito1.jpg | 2026-01-31 22:29 | 4.2K | |
| SIMA I.jpg | 2026-01-31 22:29 | 4.0K | |
| SIMA_0.jpg | 2026-01-31 22:29 | 2.4K | |
| SM-Protocolo-atencio..> | 2026-01-31 22:29 | 3.7K | |
| SOCHIPE.jpg | 2026-01-31 22:29 | 5.1K | |
| SOCIAL_MEDIA-IDVW201..> | 2026-01-31 22:29 | 4.9K | |
| SOGIA.jpg | 2026-01-31 22:29 | 4.1K | |
| SOGIA.png | 2026-01-31 22:29 | 19K | |
| SPAJ.jpg | 2026-01-31 22:29 | 3.9K | |
| SPAJ2011 - copia.jpg | 2026-01-31 22:29 | 4.4K | |
| SUGIA.jpg | 2026-01-31 22:29 | 5.2K | |
| SUICIDIO ADOLESCENTE..> | 2026-01-31 22:29 | 4.8K | |
| SUP.gif | 2026-01-31 22:29 | 2.7K | |
| SUP.png | 2026-01-31 22:29 | 5.6K | |
| SUP_0.png | 2026-01-31 22:29 | 5.6K | |
| SUP_1.png | 2026-01-31 22:29 | 5.6K | |
| SUP_2.png | 2026-01-31 22:29 | 5.6K | |
| Sagij Sugia.jpg | 2026-01-31 22:29 | 3.0K | |
| Salud-Adolescente.jpg | 2026-01-31 22:29 | 3.4K | |
| Salud Adolescente.jpg | 2026-01-31 22:29 | 4.5K | |
| Salud Argentina.png | 2026-01-31 22:29 | 2.2K | |
| Salud Mental Comunit..> | 2026-01-31 22:29 | 4.1K | |
| Salud Mental Infanto..> | 2026-01-31 22:29 | 3.4K | |
| Salud materno-infant..> | 2026-01-31 22:29 | 4.2K | |
| Salud y comunidad .jpg | 2026-01-31 22:29 | 5.9K | |
| Salute-bambini.jpg | 2026-01-31 22:29 | 4.6K | |
| Sap.gif | 2026-01-31 22:29 | 3.5K | |
| Sap_0.gif | 2026-01-31 22:29 | 2.5K | |
| Sasia .png | 2026-01-31 22:29 | 14K | |
| Satellite.gif | 2026-01-31 22:29 | 2.9K | |
| Satellite.jpg | 2026-01-31 22:29 | 5.7K | |
| Schermata-2014-03-12..> | 2026-01-31 22:29 | 37K | |
| Screen Shot 2018-12-..> | 2026-01-31 22:29 | 30K | |
| Screen Shot 2019-06-..> | 2026-01-31 22:29 | 21K | |
| Screenshot_4-2.png | 2026-01-31 22:29 | 27K | |
| Screenshot_4-2_0.png | 2026-01-31 22:29 | 27K | |
| Screenshot_20180905-..> | 2026-01-31 22:29 | 27K | |
| Segundas Jornadas Pa..> | 2026-01-31 22:29 | 3.5K | |
| Segundo Aviso.jpg | 2026-01-31 22:29 | 4.5K | |
| Se incrementará el ..> | 2026-01-31 22:29 | 2.8K | |
| Semana Joven.jpg | 2026-01-31 22:29 | 5.5K | |
| Semana Joven afiche.jpg | 2026-01-31 22:29 | 4.2K | |
| Seminario .jpg | 2026-01-31 22:29 | 4.6K | |
| Seminario.png | 2026-01-31 22:29 | 13K | |
| Seminario Nutricion ..> | 2026-01-31 22:29 | 4.5K | |
| Seminario internacio..> | 2026-01-31 22:29 | 2.4K | |
| Seminaro web.jpg | 2026-01-31 22:29 | 5.0K | |
| Seminaro web_0.jpg | 2026-01-31 22:29 | 5.0K | |
| Sentidos y Contextos..> | 2026-01-31 22:29 | 4.4K | |
| Sex.jpg | 2026-01-31 22:29 | 5.3K | |
| Sexo y amor cuando l..> | 2026-01-31 22:29 | 2.0K | |
| Sexto estudio Nacion..> | 2026-01-31 22:29 | 3.4K | |
| Sexualidades adolesc..> | 2026-01-31 22:29 | 9.2K | |
| Sexualidades mediati..> | 2026-01-31 22:29 | 2.8K | |
| Show (1).jpg | 2026-01-31 22:29 | 3.2K | |
| Show (1)_0.jpg | 2026-01-31 22:29 | 4.5K | |
| Show (1)_1.jpg | 2026-01-31 22:29 | 2.8K | |
| Show (1)_2.jpg | 2026-01-31 22:29 | 3.4K | |
| Show (1)_3.jpg | 2026-01-31 22:29 | 3.7K | |
| Show (1)_4.jpg | 2026-01-31 22:29 | 4.3K | |
| Show (1)_5.jpg | 2026-01-31 22:29 | 3.3K | |
| Show (1)_6.jpg | 2026-01-31 22:29 | 2.9K | |
| Show (2).jpg | 2026-01-31 22:29 | 2.2K | |
| Show (2)_0.jpg | 2026-01-31 22:29 | 2.2K | |
| Show (2)_1.jpg | 2026-01-31 22:29 | 2.2K | |
| Show (3).jpg | 2026-01-31 22:29 | 2.8K | |
| Show (3)_0.jpg | 2026-01-31 22:29 | 4.3K | |
| Show (3)_1.jpg | 2026-01-31 22:29 | 3.1K | |
| Show (4).jpg | 2026-01-31 22:29 | 4.2K | |
| Show (4)_0.jpg | 2026-01-31 22:29 | 4.7K | |
| Show (5).jpg | 2026-01-31 22:29 | 3.8K | |
| Show (5)_0.jpg | 2026-01-31 22:29 | 3.0K | |
| Show.jpg | 2026-01-31 22:29 | 3.2K | |
| Show_0.jpg | 2026-01-31 22:29 | 5.0K | |
| Show_1.jpg | 2026-01-31 22:29 | 4.4K | |
| Show_2.jpg | 2026-01-31 22:29 | 4.3K | |
| Show_3.jpg | 2026-01-31 22:29 | 3.6K | |
| Show_4.jpg | 2026-01-31 22:29 | 4.1K | |
| Show_5.jpg | 2026-01-31 22:29 | 4.2K | |
| Show_6.jpg | 2026-01-31 22:29 | 3.7K | |
| Show_7.jpg | 2026-01-31 22:29 | 3.1K | |
| Show_8.jpg | 2026-01-31 22:29 | 5.3K | |
| Show_9.jpg | 2026-01-31 22:29 | 3.9K | |
| Show_10.jpg | 2026-01-31 22:29 | 3.4K | |
| Show_11.jpg | 2026-01-31 22:29 | 3.8K | |
| Show_12.jpg | 2026-01-31 22:29 | 2.8K | |
| Show_13.jpg | 2026-01-31 22:29 | 3.4K | |
| Show_14.jpg | 2026-01-31 22:29 | 4.7K | |
| Show_15.jpg | 2026-01-31 22:29 | 3.2K | |
| Show_16.jpg | 2026-01-31 22:29 | 4.4K | |
| Show_17.jpg | 2026-01-31 22:29 | 4.9K | |
| Si lo vives.jpg | 2026-01-31 22:29 | 4.7K | |
| Simposio.jpg | 2026-01-31 22:29 | 4.8K | |
| Simposio Comunicador..> | 2026-01-31 22:29 | 3.8K | |
| Simposio Masculinidd..> | 2026-01-31 22:29 | 4.8K | |
| Simposio Puerto Rico..> | 2026-01-31 22:29 | 4.8K | |
| Simposio_0.jpg | 2026-01-31 22:29 | 5.2K | |
| Simposio cannabis.jpg | 2026-01-31 22:29 | 3.8K | |
| Sin-postureos-en-el-..> | 2026-01-31 22:29 | 4.9K | |
| Sin opciones muertes..> | 2026-01-31 22:29 | 4.3K | |
| Sistemas de la Infor..> | 2026-01-31 22:29 | 3.0K | |
| Sistematización exp..> | 2026-01-31 22:29 | 3.4K | |
| Sistematización par..> | 2026-01-31 22:29 | 3.3K | |
| Sistematizacion de e..> | 2026-01-31 22:29 | 3.5K | |
| Situación de salud ..> | 2026-01-31 22:29 | 27K | |
| Situaciones de Viole..> | 2026-01-31 22:29 | 4.8K | |
| Sobrepeso.jpg | 2026-01-31 22:29 | 2.8K | |
| Sobrepeso y obesidad..> | 2026-01-31 22:29 | 3.5K | |
| Socialización de g..> | 2026-01-31 22:29 | 4.4K | |
| Sociedad Chilena de ..> | 2026-01-31 22:29 | 4.0K | |
| Sociedad Colombiana ..> | 2026-01-31 22:29 | 3.8K | |
| Sogia Brasil.jpg | 2026-01-31 22:29 | 4.2K | |
| Somos Familia.jpg | 2026-01-31 22:29 | 4.1K | |
| Somos diversidad.jpg | 2026-01-31 22:29 | 5.4K | |
| Spanish Webinar (Apr..> | 2026-01-31 22:29 | 23K | |
| Spanish Webinar (Apr..> | 2026-01-31 22:29 | 23K | |
| Sudar material..jpg | 2026-01-31 22:29 | 3.5K | |
| Sugia.jpg | 2026-01-31 22:29 | 5.6K | |
| Suicidio .jpg | 2026-01-31 22:29 | 3.6K | |
| Suicidio.jpg | 2026-01-31 22:29 | 3.1K | |
| Suicidio_0.jpg | 2026-01-31 22:29 | 2.2K | |
| Suicidio_1.jpg | 2026-01-31 22:29 | 4.0K | |
| Super Char.jpg | 2026-01-31 22:29 | 4.6K | |
| TAPA_serieViolencias..> | 2026-01-31 22:29 | 3.2K | |
| TDAH aspectos ético..> | 2026-01-31 22:29 | 3.3K | |
| TIC.jpg | 2026-01-31 22:29 | 4.4K | |
| TOMO Y OBLIGO.jpg | 2026-01-31 22:29 | 4.7K | |
| TRASTORNO POR DESORD..> | 2026-01-31 22:29 | 7.2K | |
| TRabajo en Red Alamp..> | 2026-01-31 22:29 | 4.4K | |
| Tabaco.jpg | 2026-01-31 22:29 | 2.8K | |
| Tablas de mortalidad..> | 2026-01-31 22:29 | 3.4K | |
| Talleres de Capacita..> | 2026-01-31 22:29 | 5.2K | |
| Tapa-GuiaTICSsensibi..> | 2026-01-31 22:29 | 4.8K | |
| Tapa-INADI.jpg | 2026-01-31 22:29 | 3.6K | |
| Tapa.jpg | 2026-01-31 22:29 | 3.4K | |
| Tapa_adolescenciatam..> | 2026-01-31 22:29 | 14K | |
| Tapa_psicojuridico.png | 2026-01-31 22:29 | 5.6K | |
| Te-suena-familiar (2..> | 2026-01-31 22:29 | 3.9K | |
| Tecno.jpg | 2026-01-31 22:29 | 2.0K | |
| Tecno_0.jpg | 2026-01-31 22:29 | 4.0K | |
| Tecnolkogia II.jpg | 2026-01-31 22:29 | 3.7K | |
| Tecnologia.jpg | 2026-01-31 22:29 | 4.7K | |
| Tele salud.JPG | 2026-01-31 22:29 | 3.4K | |
| Tendencias en consum..> | 2026-01-31 22:29 | 3.4K | |
| Tendencias y novedad..> | 2026-01-31 22:29 | 11K | |
| Teorías dominantes ..> | 2026-01-31 22:29 | 3.5K | |
| Tercer Conversatorio..> | 2026-01-31 22:29 | 4.7K | |
| Teruel .jpg | 2026-01-31 22:29 | 4.3K | |
| Tiempo-de-crecer-150..> | 2026-01-31 22:29 | 3.3K | |
| Todos a comer.png | 2026-01-31 22:29 | 17K | |
| Todos los niños y n..> | 2026-01-31 22:29 | 5.5K | |
| Transicion.jpg | 2026-01-31 22:29 | 3.3K | |
| Trastornos Conducta ..> | 2026-01-31 22:29 | 4.5K | |
| Tres enfoques que ha..> | 2026-01-31 22:29 | 4.1K | |
| Twitter Codajic.jpg | 2026-01-31 22:29 | 3.5K | |
| UDC_0.jpg | 2026-01-31 22:29 | 5.3K | |
| UN0199074_0.jpg | 2026-01-31 22:29 | 3.6K | |
| UNDFPA-20140603-PART..> | 2026-01-31 22:29 | 4.9K | |
| UNDP_RBLAC_IDH2016Fi..> | 2026-01-31 22:29 | 15K | |
| UNFPA.png | 2026-01-31 22:29 | 29K | |
| UNFPA PERú.png | 2026-01-31 22:29 | 13K | |
| UNFPA PERú_0.png | 2026-01-31 22:29 | 13K | |
| UNFPA_0.jpg | 2026-01-31 22:29 | 5.9K | |
| UNICEF .jpg | 2026-01-31 22:29 | 4.7K | |
| UNICEF.jpg | 2026-01-31 22:29 | 5.0K | |
| UNICEF TODOS LOS NI..> | 2026-01-31 22:29 | 4.6K | |
| UNICEF_0.jpg | 2026-01-31 22:29 | 4.5K | |
| UNICEF_DOMINIO_BAJAD..> | 2026-01-31 22:29 | 4.0K | |
| USO MEDICINAL DE CAN..> | 2026-01-31 22:29 | 3.5K | |
| Ultima decada Portad..> | 2026-01-31 22:29 | 3.5K | |
| Una guía de desarro..> | 2026-01-31 22:29 | 3.7K | |
| Una guía de desarro..> | 2026-01-31 22:29 | 4.2K | |
| Unidade de Atenção..> | 2026-01-31 22:29 | 2.5K | |
| Unillanos.png | 2026-01-31 22:29 | 17K | |
| Universidad Chile.jpg | 2026-01-31 22:29 | 2.7K | |
| Universidades 2019 P..> | 2026-01-31 22:29 | 6.2K | |
| Universidadinductria..> | 2026-01-31 22:29 | 7.6K | |
| Un nuevo enfoque par..> | 2026-01-31 22:29 | 2.1K | |
| Untitled_4.png | 2026-01-31 22:29 | 17K | |
| Uru.jpg | 2026-01-31 22:29 | 3.7K | |
| Uruguay.JPG | 2026-01-31 22:29 | 4.5K | |
| Uruguay.png | 2026-01-31 22:29 | 20K | |
| Uruguay I.jpg | 2026-01-31 22:29 | 3.4K | |
| Uruguay Jovenes en r..> | 2026-01-31 22:29 | 4.2K | |
| Uruguay PROBÁ JUGAR..> | 2026-01-31 22:29 | 6.7K | |
| Uruguay Protocolo De..> | 2026-01-31 22:29 | 3.7K | |
| Uso-de-Estdísticas.jpg | 2026-01-31 22:29 | 5.4K | |
| Uso.jpg | 2026-01-31 22:29 | 3.8K | |
| Uso y abuso de las T..> | 2026-01-31 22:29 | 3.9K | |
| Uso y riesgo de adic..> | 2026-01-31 22:29 | 1.8K | |
| V Corso di Formazion..> | 2026-01-31 22:29 | 13K | |
| V Encuesta Nacional ..> | 2026-01-31 22:29 | 4.2K | |
| VI-Congreso-Adiccion..> | 2026-01-31 22:29 | 33K | |
| VI CONGRESO.jpg | 2026-01-31 22:29 | 4.5K | |
| VI Congreso.jpg | 2026-01-31 22:29 | 5.3K | |
| VIH, discriminación..> | 2026-01-31 22:29 | 3.8K | |
| VIH SIDA Mujeres Arg..> | 2026-01-31 22:29 | 2.3K | |
| VIH mujeres.jpg | 2026-01-31 22:29 | 4.3K | |
| VIII Gineco_0.jpg | 2026-01-31 22:29 | 3.1K | |
| VII Plan de Adiccion..> | 2026-01-31 22:29 | 2.7K | |
| VI jornada.jpg | 2026-01-31 22:29 | 4.8K | |
| VPH.jpg | 2026-01-31 22:29 | 6.5K | |
| V Reunión de invest..> | 2026-01-31 22:29 | 4.7K | |
| Vacunas.gif | 2026-01-31 22:29 | 5.8K | |
| Vanguardia Latina 20..> | 2026-01-31 22:29 | 3.1K | |
| Varones.jpg | 2026-01-31 22:29 | 4.1K | |
| Victimas_Invisibles.jpg | 2026-01-31 22:29 | 2.5K | |
| Vidas-robadas-01.png | 2026-01-31 22:29 | 15K | |
| Violence.jpg | 2026-01-31 22:29 | 3.7K | |
| Violencia.jpg | 2026-01-31 22:29 | 4.8K | |
| Violencia 1.jpg | 2026-01-31 22:29 | 5.1K | |
| Violencia Chile.jpg | 2026-01-31 22:29 | 4.7K | |
| Violencia Comisión ..> | 2026-01-31 22:29 | 3.9K | |
| Violencia Guia Pract..> | 2026-01-31 22:29 | 4.7K | |
| Violencia Noviazgo.png | 2026-01-31 22:29 | 24K | |
| ViolenciaU.jpg | 2026-01-31 22:29 | 4.0K | |
| Violencia de géner..> | 2026-01-31 22:29 | 5.0K | |
| Violencia ragón.jpg | 2026-01-31 22:29 | 3.1K | |
| Vive yo te ayudo - M..> | 2026-01-31 22:29 | 2.2K | |
| Vivir Juntos en las ..> | 2026-01-31 22:29 | 7.3K | |
| Vivir en positivo Gu..> | 2026-01-31 22:29 | 4.2K | |
| V jornadas.jpg | 2026-01-31 22:29 | 5.1K | |
| Voces.jpg | 2026-01-31 22:29 | 2.6K | |
| WHO.jpg | 2026-01-31 22:29 | 5.7K | |
| Webinar.png | 2026-01-31 22:29 | 17K | |
| WhatsApp-Image-2018-..> | 2026-01-31 22:29 | 5.7K | |
| WhatsApp Image 2016-..> | 2026-01-31 22:29 | 5.6K | |
| WhatsApp Image 2017-..> | 2026-01-31 22:29 | 3.9K | |
| WhatsApp Image 2017-..> | 2026-01-31 22:29 | 4.9K | |
| WhatsApp Image 2017-..> | 2026-01-31 22:29 | 4.9K | |
| WhatsApp Image 2018-..> | 2026-01-31 22:29 | 3.2K | |
| WhatsApp Image 2018-..> | 2026-01-31 22:29 | 3.2K | |
| WhatsApp Image 2018-..> | 2026-01-31 22:29 | 4.8K | |
| WhatsApp Image 2018-..> | 2026-01-31 22:29 | 4.7K | |
| WhatsApp Image 2018-..> | 2026-01-31 22:29 | 5.6K | |
| WhatsApp Image 2018-..> | 2026-01-31 22:29 | 4.2K | |
| WhatsApp Image 2019-..> | 2026-01-31 22:29 | 3.6K | |
| WhatsApp Image 2019-..> | 2026-01-31 22:29 | 4.7K | |
| WhatsApp Image 2019-..> | 2026-01-31 22:29 | 4.4K | |
| WhatsApp Image 2020-..> | 2026-01-31 22:29 | 3.6K | |
| Whatsapp.png | 2026-01-31 22:29 | 9.0K | |
| Workshop na Sociedad..> | 2026-01-31 22:29 | 4.8K | |
| X Congresso Mondiale..> | 2026-01-31 22:29 | 4.6K | |
| X Encuentro Internac..> | 2026-01-31 22:29 | 2.7K | |
| XII CONGRESSO BRASIL..> | 2026-01-31 22:29 | 19K | |
| XIII-Foro-1080x675.jpg | 2026-01-31 22:29 | 3.0K | |
| XIX Curso abordajes ..> | 2026-01-31 22:29 | 4.7K | |
| XVI.jpg | 2026-01-31 22:29 | 5.8K | |
| XVI Congreso Latinoa..> | 2026-01-31 22:29 | 5.3K | |
| XVI Congreso Naciona..> | 2026-01-31 22:29 | 4.5K | |
| XVII CONGRESSO NAZIO..> | 2026-01-31 22:29 | 3.9K | |
| XVII CONGRESSO NAZIO..> | 2026-01-31 22:29 | 3.9K | |
| XXIII CONGRESO Socie..> | 2026-01-31 22:29 | 4.3K | |
| Ya nada será lo mis..> | 2026-01-31 22:29 | 3.7K | |
| Y tu que sabes de es..> | 2026-01-31 22:29 | 4.7K | |
| Zhk3jeB4_400x400.jpg | 2026-01-31 22:29 | 3.2K | |
| Zygmunt Bauman Moder..> | 2026-01-31 22:29 | 3.9K | |
| aa462a7f-367d-4241-8..> | 2026-01-31 22:29 | 5.8K | |
| abordaje_chemsex.jpg | 2026-01-31 22:29 | 1.6K | |
| abordaje de derechos..> | 2026-01-31 22:29 | 4.7K | |
| aborto.jpg | 2026-01-31 22:29 | 4.2K | |
| aborto_0.jpg | 2026-01-31 22:29 | 4.2K | |
| abre-tu-mente-en-mod..> | 2026-01-31 22:29 | 3.7K | |
| abril_congresoCostar..> | 2026-01-31 22:29 | 4.6K | |
| abuso-tic-adolescent..> | 2026-01-31 22:29 | 4.4K | |
| abuso_sexual_infanti..> | 2026-01-31 22:29 | 2.6K | |
| adicciones-cerebro.jpg | 2026-01-31 22:29 | 4.2K | |
| adicciones.jpg | 2026-01-31 22:29 | 3.7K | |
| adicciones_0.jpg | 2026-01-31 22:29 | 3.1K | |
| adicciones_comportam..> | 2026-01-31 22:29 | 3.3K | |
| adolescencia Sochipe..> | 2026-01-31 22:29 | 4.3K | |
| adolescencia stress.jpg | 2026-01-31 22:29 | 2.7K | |
| adolescent-aa-ha.jpg | 2026-01-31 22:29 | 4.9K | |
| adolescent_friendly_..> | 2026-01-31 22:29 | 4.9K | |
| adolescente22.jpg | 2026-01-31 22:29 | 4.4K | |
| adolescente caricatu..> | 2026-01-31 22:29 | 4.7K | |
| adolescentem-embaraz..> | 2026-01-31 22:29 | 2.9K | |
| adolescentem-embaraz..> | 2026-01-31 22:29 | 2.9K | |
| adolescentem-embaraz..> | 2026-01-31 22:29 | 2.9K | |
| adolescentem-embaraz..> | 2026-01-31 22:29 | 2.9K | |
| adolescentes_1.jpg | 2026-01-31 22:29 | 4.3K | |
| adolescentes_pandemi..> | 2026-01-31 22:29 | 17K | |
| adolescentes sin mas..> | 2026-01-31 22:29 | 3.4K | |
| adolescere-V-2-2017_..> | 2026-01-31 22:29 | 3.7K | |
| adolescere-vol-3-1-p..> | 2026-01-31 22:29 | 4.0K | |
| adolescere 3.jpg | 2026-01-31 22:29 | 3.5K | |
| adolescere_n1.jpg | 2026-01-31 22:29 | 3.5K | |
| aed-13-informz-ca.jpg | 2026-01-31 22:29 | 2.3K | |
| aep2014banner.jpg | 2026-01-31 22:29 | 4.1K | |
| aep25018.jpg | 2026-01-31 22:29 | 3.4K | |
| afiche-400x518.jpg | 2026-01-31 22:29 | 5.1K | |
| afiche-ALAPE.jpg | 2026-01-31 22:29 | 4.7K | |
| afiche-clioa17.jpg | 2026-01-31 22:29 | 5.1K | |
| afiche-congreso-web-..> | 2026-01-31 22:29 | 4.8K | |
| afiche-congreso.jpg | 2026-01-31 22:29 | 3.8K | |
| afiche-gine-23022017..> | 2026-01-31 22:29 | 5.0K | |
| afiche.jpg | 2026-01-31 22:29 | 6.0K | |
| afiche 3 congreso.jpg | 2026-01-31 22:29 | 5.1K | |
| afiche 20jun (mail).jpg | 2026-01-31 22:29 | 6.3K | |
| afiche_header-1024x9..> | 2026-01-31 22:29 | 5.2K | |
| afiche_tn.jpg | 2026-01-31 22:29 | 4.9K | |
| afiches_servicios.gif | 2026-01-31 22:29 | 8.3K | |
| ag00.jpg | 2026-01-31 22:29 | 3.6K | |
| alamfpyonaf.jpg | 2026-01-31 22:29 | 4.2K | |
| alamfpyonaf_0.jpg | 2026-01-31 22:29 | 4.2K | |
| alamfpyonaf_1.jpg | 2026-01-31 22:29 | 4.2K | |
| alamfpyonaf_2.jpg | 2026-01-31 22:29 | 4.2K | |
| alamfpyonaf_3.jpg | 2026-01-31 22:29 | 4.2K | |
| alcohol.jpg | 2026-01-31 22:29 | 4.1K | |
| alcohol 1.jpg | 2026-01-31 22:29 | 3.9K | |
| alcohol 2.jpg | 2026-01-31 22:29 | 4.8K | |
| alcohol_0.jpg | 2026-01-31 22:29 | 2.4K | |
| alcoholismo.jpg | 2026-01-31 22:29 | 4.6K | |
| alcoholpolicies.jpg | 2026-01-31 22:29 | 2.4K | |
| alcohol y jovenes.jpg | 2026-01-31 22:29 | 4.2K | |
| alienacion.jpg | 2026-01-31 22:29 | 5.7K | |
| alienacion_0.jpg | 2026-01-31 22:29 | 5.7K | |
| alienacion_1.jpg | 2026-01-31 22:29 | 5.7K | |
| alimentacion.jpg | 2026-01-31 22:29 | 5.2K | |
| alimentacion_Page_01..> | 2026-01-31 22:29 | 2.8K | |
| almaata40years.png | 2026-01-31 22:29 | 20K | |
| amegh_cartel2015-cro..> | 2026-01-31 22:29 | 3.8K | |
| amor.jpg | 2026-01-31 22:29 | 5.6K | |
| analisis-legislacion..> | 2026-01-31 22:29 | 23K | |
| antes de la colonia.jpg | 2026-01-31 22:29 | 4.0K | |
| anticoncepcao.jpg | 2026-01-31 22:29 | 3.8K | |
| anticonceptivas.jpg | 2026-01-31 22:29 | 2.8K | |
| anticonceptivos.jpg | 2026-01-31 22:29 | 4.4K | |
| anticonceptivos.png | 2026-01-31 22:29 | 25K | |
| antojitos.jpg | 2026-01-31 22:29 | 5.4K | |
| anuncio-congreso con..> | 2026-01-31 22:29 | 22K | |
| anuncio_seminario_sa..> | 2026-01-31 22:29 | 16K | |
| apoyando a los niño..> | 2026-01-31 22:29 | 29K | |
| aprende.jpg | 2026-01-31 22:29 | 4.3K | |
| aproximacion-al-trat..> | 2026-01-31 22:29 | 2.9K | |
| aps.jpg | 2026-01-31 22:29 | 2.7K | |
| arton355870.png | 2026-01-31 22:29 | 30K | |
| ascolto.jpg | 2026-01-31 22:29 | 2.9K | |
| as desigualdades en ..> | 2026-01-31 22:29 | 3.9K | |
| atomo.gif | 2026-01-31 22:29 | 4.6K | |
| avances OPS.jpg | 2026-01-31 22:29 | 5.1K | |
| b5c98d_c1863f73b0b24..> | 2026-01-31 22:29 | 5.1K | |
| baja.jpg | 2026-01-31 22:29 | 4.1K | |
| bajo-presion.jpg | 2026-01-31 22:29 | 5.0K | |
| ballena azul.jpg | 2026-01-31 22:29 | 4.4K | |
| bandera-cuba-6.jpg | 2026-01-31 22:29 | 3.0K | |
| banner-16anos-es-726..> | 2026-01-31 22:29 | 4.7K | |
| banner-460x250_0.png | 2026-01-31 22:29 | 30K | |
| banner-980x411_0.jpg | 2026-01-31 22:29 | 3.4K | |
| banner-etiquetado-de..> | 2026-01-31 22:29 | 26K | |
| banner-rpsp.png | 2026-01-31 22:29 | 11K | |
| banner-sexologia-201..> | 2026-01-31 22:29 | 9.8K | |
| banner_6_cipca.jpg | 2026-01-31 22:29 | 3.5K | |
| banner_2016-es.png | 2026-01-31 22:29 | 19K | |
| banner_congresso_ali..> | 2026-01-31 22:29 | 4.7K | |
| banner_esp_hd.jpg | 2026-01-31 22:29 | 4.4K | |
| bannerjornadaHPV.jpg | 2026-01-31 22:29 | 3.7K | |
| basicpsychosocialski..> | 2026-01-31 22:29 | 4.4K | |
| basicpsychosocialski..> | 2026-01-31 22:29 | 4.4K | |
| bebes-obesos_0.jpg | 2026-01-31 22:29 | 5.2K | |
| bg-slider-01.png | 2026-01-31 22:29 | 21K | |
| bg-slider-01_0.png | 2026-01-31 22:29 | 21K | |
| bg-slider-01_1.png | 2026-01-31 22:29 | 21K | |
| blog_Gabriela_abril3..> | 2026-01-31 22:29 | 5.0K | |
| bnr.png | 2026-01-31 22:29 | 38K | |
| bola.jpg | 2026-01-31 22:29 | 3.8K | |
| borrachera.jpg | 2026-01-31 22:29 | 3.8K | |
| buenas-practicas-300..> | 2026-01-31 22:29 | 39K | |
| buenas-practicas-de-..> | 2026-01-31 22:29 | 6.0K | |
| bullying-blando-bull..> | 2026-01-31 22:29 | 2.5K | |
| bullying. cABA_0.jpg | 2026-01-31 22:29 | 3.0K | |
| bullying.gif | 2026-01-31 22:29 | 4.7K | |
| bullying y consumo d..> | 2026-01-31 22:29 | 4.1K | |
| burundanga1.jpg | 2026-01-31 22:29 | 5.3K | |
| cabecera-informe-euk..> | 2026-01-31 22:29 | 3.2K | |
| cabecera_foto1.jpg | 2026-01-31 22:29 | 3.8K | |
| cabeceraok.jpg | 2026-01-31 22:29 | 4.9K | |
| cabeza_mail.png | 2026-01-31 22:29 | 13K | |
| campaniaSida2008.jpg | 2026-01-31 22:29 | 5.7K | |
| cannabis.jpg | 2026-01-31 22:29 | 5.4K | |
| canvas.png | 2026-01-31 22:29 | 9.4K | |
| capaz.jpg | 2026-01-31 22:29 | 5.9K | |
| cara.jpg | 2026-01-31 22:29 | 4.7K | |
| card2.png | 2026-01-31 22:29 | 24K | |
| card2_0.png | 2026-01-31 22:29 | 24K | |
| cartaz_5_cipca_515.jpg | 2026-01-31 22:29 | 3.4K | |
| cartoon1.jpg | 2026-01-31 22:29 | 5.6K | |
| cdn1.uvnimg.com_.jpg | 2026-01-31 22:29 | 5.1K | |
| cepa.jpg | 2026-01-31 22:29 | 4.4K | |
| cerebro_0.jpg | 2026-01-31 22:29 | 6.4K | |
| cervical_cancer_virt..> | 2026-01-31 22:29 | 21K | |
| chemsex-y-hepatitis-..> | 2026-01-31 22:29 | 3.2K | |
| childhood_obesity_re..> | 2026-01-31 22:29 | 4.6K | |
| clap 2.jpg | 2026-01-31 22:29 | 3.8K | |
| clasificacion-sustan..> | 2026-01-31 22:29 | 2.6K | |
| clinica alemana.jpg | 2026-01-31 22:29 | 4.4K | |
| coloquio-480x330.jpg | 2026-01-31 22:29 | 4.9K | |
| coloquio-480x330_0.jpg | 2026-01-31 22:29 | 4.9K | |
| coloquio internacion..> | 2026-01-31 22:29 | 4.8K | |
| como-afectan-conduct..> | 2026-01-31 22:29 | 4.9K | |
| como-fomentar-el-aut..> | 2026-01-31 22:29 | 3.8K | |
| como-prevenir-.jpg | 2026-01-31 22:29 | 4.4K | |
| como_tratar_a_mi_hij..> | 2026-01-31 22:29 | 4.8K | |
| como_tratar_a_mi_hij..> | 2026-01-31 22:29 | 5.0K | |
| conSOSEPE.jpg | 2026-01-31 22:29 | 4.7K | |
| conace2.jpg | 2026-01-31 22:29 | 5.3K | |
| conectado.jpg | 2026-01-31 22:29 | 4.4K | |
| conf_saude_comportam..> | 2026-01-31 22:29 | 4.3K | |
| conferencia-ninez-qu..> | 2026-01-31 22:29 | 4.9K | |
| congreso.jpg | 2026-01-31 22:29 | 4.1K | |
| congreso _0.jpg | 2026-01-31 22:29 | 6.9K | |
| congreso _0_0.jpg | 2026-01-31 22:29 | 6.7K | |
| congresofot2.jpg | 2026-01-31 22:29 | 4.8K | |
| congresso2015.png | 2026-01-31 22:29 | 27K | |
| consejos-para-la-pob..> | 2026-01-31 22:29 | 4.5K | |
| consejos-para-la-pob..> | 2026-01-31 22:29 | 4.5K | |
| consejos-para-la-pob..> | 2026-01-31 22:29 | 4.5K | |
| consumo-intensivo-al..> | 2026-01-31 22:29 | 3.7K | |
| consumo.jpg | 2026-01-31 22:29 | 4.3K | |
| convivencia_escolar-..> | 2026-01-31 22:29 | 6.0K | |
| copacaida.jpg | 2026-01-31 22:29 | 2.7K | |
| coronavirus_popup_18..> | 2026-01-31 22:29 | 4.3K | |
| coronavirus_popup_18..> | 2026-01-31 22:29 | 4.3K | |
| cover.png | 2026-01-31 22:29 | 9.1K | |
| cover_issue_12_es_ES..> | 2026-01-31 22:29 | 4.7K | |
| cover_issue_50_es_ES..> | 2026-01-31 22:29 | 4.9K | |
| cover_issue_684_es_E..> | 2026-01-31 22:29 | 14K | |
| covid-19-thumbnail-7..> | 2026-01-31 22:29 | 4.5K | |
| cq5dam.web_.221.289...> | 2026-01-31 22:29 | 4.4K | |
| crecerNota.jpg | 2026-01-31 22:29 | 3.6K | |
| criancas-e-adolescen..> | 2026-01-31 22:29 | 4.5K | |
| crianza Humanizada.jpg | 2026-01-31 22:29 | 3.5K | |
| cronograma_4_0.png | 2026-01-31 22:29 | 12K | |
| cropped-logo-cab-3_0..> | 2026-01-31 22:29 | 13K | |
| cropped-logo-cab-3_1..> | 2026-01-31 22:29 | 13K | |
| csm_adolescencia-pag..> | 2026-01-31 22:29 | 18K | |
| csm_logo_641107700b.png | 2026-01-31 22:29 | 6.0K | |
| cuadernillo-9-17-3.png | 2026-01-31 22:29 | 12K | |
| cuba.jpg | 2026-01-31 22:29 | 5.3K | |
| cuento-en-el-bosillo..> | 2026-01-31 22:29 | 2.7K | |
| cuentos 1.jpg | 2026-01-31 22:29 | 5.1K | |
| curso-de-vida-portad..> | 2026-01-31 22:29 | 3.6K | |
| curso-medicos-aps.jpg | 2026-01-31 22:29 | 5.7K | |
| curso2015.jpg | 2026-01-31 22:29 | 4.4K | |
| curso_suicidio_cover..> | 2026-01-31 22:29 | 3.6K | |
| curso_suicidio_cover..> | 2026-01-31 22:29 | 3.6K | |
| curso_tic_ok.jpg | 2026-01-31 22:29 | 5.1K | |
| cvp20-xxi-texto.png | 2026-01-31 22:29 | 9.4K | |
| día de la mujer mai..> | 2026-01-31 22:29 | 4.5K | |
| d0c5f0cf-07c9-48d1-9..> | 2026-01-31 22:29 | 4.5K | |
| dErecho a la salud.jpg | 2026-01-31 22:29 | 5.0K | |
| day-girl-child-2013.jpg | 2026-01-31 22:29 | 4.9K | |
| dbba28_ad33e96db56f4..> | 2026-01-31 22:29 | 5.3K | |
| dc3ada-de-los-derech..> | 2026-01-31 22:29 | 3.9K | |
| de-la-mesa-al.jpg | 2026-01-31 22:29 | 4.0K | |
| de o a 6.jpg | 2026-01-31 22:29 | 3.3K | |
| depositphotos_682502..> | 2026-01-31 22:29 | 4.5K | |
| depositphotos_111567..> | 2026-01-31 22:29 | 2.6K | |
| derecho_privacidad_e..> | 2026-01-31 22:29 | 8.2K | |
| derechos.jpg | 2026-01-31 22:29 | 5.6K | |
| derechos_0.jpg | 2026-01-31 22:29 | 5.5K | |
| derechos_sexuales.jpg | 2026-01-31 22:29 | 4.9K | |
| descarga (1).jpg | 2026-01-31 22:29 | 5.4K | |
| descarga (1)_0.jpg | 2026-01-31 22:29 | 4.0K | |
| descarga (1)_1.jpg | 2026-01-31 22:29 | 6.8K | |
| descarga (1)_2.jpg | 2026-01-31 22:29 | 2.7K | |
| descarga (1)_3.jpg | 2026-01-31 22:29 | 3.4K | |
| descarga (1)_4.jpg | 2026-01-31 22:29 | 3.5K | |
| descarga (1)_5.jpg | 2026-01-31 22:29 | 4.7K | |
| descarga (1)_6.jpg | 2026-01-31 22:29 | 6.8K | |
| descarga (1)_7.jpg | 2026-01-31 22:29 | 4.9K | |
| descarga (1)_8.jpg | 2026-01-31 22:29 | 3.3K | |
| descarga (1)_9.jpg | 2026-01-31 22:29 | 3.9K | |
| descarga (1)_10.jpg | 2026-01-31 22:29 | 4.6K | |
| descarga (3).jpg | 2026-01-31 22:29 | 4.3K | |
| descarga (3)_0.jpg | 2026-01-31 22:29 | 4.5K | |
| descarga.jpg | 2026-01-31 22:29 | 5.4K | |
| descarga.png | 2026-01-31 22:29 | 23K | |
| descarga_0.jpg | 2026-01-31 22:29 | 3.4K | |
| descarga_0.png | 2026-01-31 22:29 | 18K | |
| descarga_1.jpg | 2026-01-31 22:29 | 4.2K | |
| descarga_1.png | 2026-01-31 22:29 | 14K | |
| descarga_2.jpg | 2026-01-31 22:29 | 3.9K | |
| descarga_2.png | 2026-01-31 22:29 | 7.7K | |
| descarga_3.jpg | 2026-01-31 22:29 | 5.8K | |
| descarga_3.png | 2026-01-31 22:29 | 15K | |
| descarga_4.jpg | 2026-01-31 22:29 | 4.8K | |
| descarga_4.png | 2026-01-31 22:29 | 15K | |
| descarga_5.jpg | 2026-01-31 22:29 | 3.1K | |
| descarga_5.png | 2026-01-31 22:29 | 18K | |
| descarga_6.jpg | 2026-01-31 22:29 | 5.5K | |
| descarga_7.jpg | 2026-01-31 22:29 | 3.7K | |
| descarga_8.jpg | 2026-01-31 22:29 | 3.2K | |
| descarga_9.jpg | 2026-01-31 22:29 | 4.0K | |
| descarga_10.jpg | 2026-01-31 22:29 | 3.5K | |
| descarga_11.jpg | 2026-01-31 22:29 | 3.5K | |
| descarga_12.jpg | 2026-01-31 22:29 | 3.6K | |
| descarga_13.jpg | 2026-01-31 22:29 | 3.7K | |
| descarga_14.jpg | 2026-01-31 22:29 | 2.9K | |
| descarga_15.jpg | 2026-01-31 22:29 | 3.8K | |
| descarga_16.jpg | 2026-01-31 22:29 | 4.0K | |
| descarga_17.jpg | 2026-01-31 22:29 | 3.7K | |
| destacadoHome2014.jpg | 2026-01-31 22:29 | 4.1K | |
| diferente10.jpg | 2026-01-31 22:29 | 3.5K | |
| diles-que-quieres-ap..> | 2026-01-31 22:29 | 17K | |
| dip_adolesc2019_port..> | 2026-01-31 22:29 | 5.3K | |
| distanciamiento.jpg | 2026-01-31 22:29 | 3.1K | |
| divresidad-a-coruna3..> | 2026-01-31 22:29 | 5.2K | |
| download.jpg | 2026-01-31 22:29 | 3.2K | |
| drogas.jpg | 2026-01-31 22:29 | 3.8K | |
| drogasygenero_guia-1..> | 2026-01-31 22:29 | 5.7K | |
| duelo-en-tiempo-de-c..> | 2026-01-31 22:29 | 26K | |
| eSI.jpg | 2026-01-31 22:29 | 5.1K | |
| ecuador03.jpg | 2026-01-31 22:29 | 4.7K | |
| educacion-sexual-int..> | 2026-01-31 22:29 | 23K | |
| educacionSexualDerec..> | 2026-01-31 22:29 | 4.2K | |
| educar-para-proteger..> | 2026-01-31 22:29 | 13K | |
| el-cerebro-adicto.jpg | 2026-01-31 22:29 | 2.6K | |
| el-talento-de-los-ad..> | 2026-01-31 22:29 | 4.1K | |
| el_futuro_despues_de..> | 2026-01-31 22:29 | 14K | |
| embarazo-adolescente..> | 2026-01-31 22:29 | 4.2K | |
| embarazo-adolescente..> | 2026-01-31 22:29 | 3.2K | |
| embarazo-cuba-yaciel..> | 2026-01-31 22:29 | 5.0K | |
| embarazo.jpg | 2026-01-31 22:29 | 3.5K | |
| embarazoadolescente1..> | 2026-01-31 22:29 | 3.8K | |
| embarazo día 3.png | 2026-01-31 22:29 | 11K | |
| embarazo día 5.png | 2026-01-31 22:29 | 12K | |
| embarazo dia 2.png | 2026-01-31 22:29 | 11K | |
| embarazo dia 3.png | 2026-01-31 22:29 | 11K | |
| emoticones.jpg | 2026-01-31 22:29 | 4.8K | |
| encabezado-eme.png | 2026-01-31 22:29 | 2.4K | |
| encabezado.jpg | 2026-01-31 22:29 | 3.1K | |
| enia-2.jpg | 2026-01-31 22:29 | 5.7K | |
| epilepsia.jpg | 2026-01-31 22:29 | 4.5K | |
| escoliosis_paciente_..> | 2026-01-31 22:29 | 2.4K | |
| esicuadernillo.png | 2026-01-31 22:29 | 11K | |
| espana-mitad-jovenes..> | 2026-01-31 22:29 | 4.7K | |
| esquel-aulas-1.jpg | 2026-01-31 22:29 | 3.4K | |
| estandardes_minimos.png | 2026-01-31 22:29 | 16K | |
| estigma.jpg | 2026-01-31 22:29 | 3.1K | |
| estrategia-yplandeac..> | 2026-01-31 22:29 | 5.0K | |
| estrategia-yplandeac..> | 2026-01-31 22:29 | 5.0K | |
| estrategia-yplandeac..> | 2026-01-31 22:29 | 4.9K | |
| estres-que-pasa-si-e..> | 2026-01-31 22:29 | 3.6K | |
| estudio-cualitativo-..> | 2026-01-31 22:29 | 3.4K | |
| eu-drug-markets-repo..> | 2026-01-31 22:29 | 3.3K | |
| euromelanoma.jpg | 2026-01-31 22:29 | 4.2K | |
| evento-principal2.jpg | 2026-01-31 22:29 | 5.0K | |
| facebook-41.jpg | 2026-01-31 22:29 | 6.5K | |
| familia-01.jpg | 2026-01-31 22:29 | 3.9K | |
| familia-02.jpg | 2026-01-31 22:29 | 3.2K | |
| familia-03.jpg | 2026-01-31 22:29 | 5.2K | |
| familia y discapacid..> | 2026-01-31 22:29 | 12K | |
| familydating2.jpg | 2026-01-31 22:29 | 3.5K | |
| fb-up-logo.png | 2026-01-31 22:29 | 11K | |
| flapia-cabezal-congr..> | 2026-01-31 22:29 | 4.0K | |
| fondo.jpg | 2026-01-31 22:29 | 5.4K | |
| foto-31.jpg | 2026-01-31 22:29 | 5.1K | |
| fotonoticia_20141118..> | 2026-01-31 22:29 | 5.1K | |
| fotonoticia_20150119..> | 2026-01-31 22:29 | 4.4K | |
| fotonoticia_20170118..> | 2026-01-31 22:29 | 3.4K | |
| fracaso-escolar-eso1..> | 2026-01-31 22:29 | 4.6K | |
| gamer_adicto.jpg | 2026-01-31 22:29 | 3.1K | |
| gedis-2016-pasacalle..> | 2026-01-31 22:29 | 4.3K | |
| gender-social-moveme..> | 2026-01-31 22:29 | 4.7K | |
| genero-masculino-y-f..> | 2026-01-31 22:29 | 3.0K | |
| gente.jpg | 2026-01-31 22:29 | 3.4K | |
| google_garage_digita..> | 2026-01-31 22:29 | 4.3K | |
| grupo415.png | 2026-01-31 22:29 | 35K | |
| guía de prevención..> | 2026-01-31 22:29 | 5.2K | |
| gua-para-padres-y-ma..> | 2026-01-31 22:29 | 3.9K | |
| guate1.jpg | 2026-01-31 22:29 | 4.6K | |
| guia-OMS-2017-hepati..> | 2026-01-31 22:29 | 4.3K | |
| guia-basica-para-pre..> | 2026-01-31 22:29 | 2.7K | |
| guia-clinica-para-la..> | 2026-01-31 22:29 | 3.4K | |
| guia-clinica.png | 2026-01-31 22:29 | 9.3K | |
| guia-genero-identida..> | 2026-01-31 22:29 | 3.2K | |
| guia-genero-y-drogas..> | 2026-01-31 22:29 | 4.2K | |
| guia-para-periodista..> | 2026-01-31 22:29 | 2.3K | |
| guia-practica-para-r..> | 2026-01-31 22:29 | 2.3K | |
| guia-practica-proced..> | 2026-01-31 22:29 | 3.6K | |
| guia-rec.jpg | 2026-01-31 22:29 | 2.8K | |
| guia-requala-300x300..> | 2026-01-31 22:29 | 2.1K | |
| guia-salud-jovenes-p..> | 2026-01-31 22:29 | 8.9K | |
| guia-salud-y-diversi..> | 2026-01-31 22:29 | 3.3K | |
| guia-sexting-adolesc..> | 2026-01-31 22:29 | 12K | |
| guia-trasnornos-niñ..> | 2026-01-31 22:29 | 3.7K | |
| guia-tratamiento-vio..> | 2026-01-31 22:29 | 3.3K | |
| guia_aduelo_adulto.jpg | 2026-01-31 22:29 | 3.5K | |
| guia_crianza.jpg | 2026-01-31 22:29 | 6.1K | |
| guia_operacional1_0.jpg | 2026-01-31 22:29 | 2.9K | |
| guia_salud.jpg | 2026-01-31 22:29 | 3.3K | |
| guia_violencia_sexua..> | 2026-01-31 22:29 | 8.5K | |
| guiafamiliasintro-im..> | 2026-01-31 22:29 | 3.5K | |
| habiaunavez_final-09..> | 2026-01-31 22:29 | 17K | |
| haschisch-walter-ben..> | 2026-01-31 22:29 | 3.6K | |
| header-sexologia-cub..> | 2026-01-31 22:29 | 4.7K | |
| header.gif | 2026-01-31 22:29 | 10K | |
| header.png | 2026-01-31 22:29 | 6.1K | |
| header_0.gif | 2026-01-31 22:29 | 11K | |
| header_es_logo.png | 2026-01-31 22:29 | 4.2K | |
| header_logo - copia.png | 2026-01-31 22:29 | 7.6K | |
| header_logo.png | 2026-01-31 22:29 | 7.6K | |
| henri-rousseau-bambi..> | 2026-01-31 22:29 | 3.4K | |
| hepatitis-infogr-es-..> | 2026-01-31 22:29 | 5.0K | |
| hombres-que-compran-..> | 2026-01-31 22:29 | 3.8K | |
| hormone_therapy_810_..> | 2026-01-31 22:29 | 4.6K | |
| hospital Rivadavia.jpg | 2026-01-31 22:29 | 5.4K | |
| hqdefault.jpg | 2026-01-31 22:29 | 4.0K | |
| hqdefault_0.jpg | 2026-01-31 22:29 | 3.8K | |
| hqdefault_1.jpg | 2026-01-31 22:29 | 4.2K | |
| huespedplacasesi-02.png | 2026-01-31 22:29 | 6.0K | |
| i_encuentro_metropol..> | 2026-01-31 22:29 | 26K | |
| identidades-de-gener..> | 2026-01-31 22:29 | 3.5K | |
| image-23-devices.png | 2026-01-31 22:29 | 13K | |
| image.png | 2026-01-31 22:29 | 20K | |
| image001.jpg | 2026-01-31 22:29 | 3.1K | |
| image002.jpg | 2026-01-31 22:29 | 3.1K | |
| image002.png | 2026-01-31 22:29 | 20K | |
| image005.jpg | 2026-01-31 22:29 | 4.7K | |
| image1170x530cropped..> | 2026-01-31 22:29 | 2.7K | |
| image_1165_1_258523.jpg | 2026-01-31 22:29 | 4.0K | |
| imagen-15.png | 2026-01-31 22:29 | 10K | |
| imagen-mama.jpg | 2026-01-31 22:29 | 5.0K | |
| imagen.png | 2026-01-31 22:29 | 11K | |
| imagen act fisica.png | 2026-01-31 22:29 | 17K | |
| imagen niños.jpg | 2026-01-31 22:29 | 4.4K | |
| images (1).jpg | 2026-01-31 22:29 | 2.5K | |
| images (1)_0.jpg | 2026-01-31 22:29 | 2.5K | |
| images (1)_1.jpg | 2026-01-31 22:29 | 3.4K | |
| images.jpg | 2026-01-31 22:29 | 3.3K | |
| images.png | 2026-01-31 22:29 | 19K | |
| imagesInfancias Ence..> | 2026-01-31 22:29 | 3.3K | |
| images_0.jpg | 2026-01-31 22:29 | 3.3K | |
| images_0.png | 2026-01-31 22:29 | 13K | |
| images_1.jpg | 2026-01-31 22:29 | 4.3K | |
| images_1.png | 2026-01-31 22:29 | 5.2K | |
| images_2.jpg | 2026-01-31 22:29 | 4.3K | |
| images_3.jpg | 2026-01-31 22:29 | 4.6K | |
| images_4.jpg | 2026-01-31 22:29 | 4.3K | |
| images_5.jpg | 2026-01-31 22:29 | 3.2K | |
| images_6.jpg | 2026-01-31 22:29 | 3.0K | |
| images_7.jpg | 2026-01-31 22:29 | 4.3K | |
| images_8.jpg | 2026-01-31 22:29 | 4.3K | |
| images_9.jpg | 2026-01-31 22:29 | 4.3K | |
| images_10.jpg | 2026-01-31 22:29 | 4.0K | |
| images_11.jpg | 2026-01-31 22:29 | 3.1K | |
| images_12.jpg | 2026-01-31 22:29 | 3.9K | |
| images_13.jpg | 2026-01-31 22:29 | 3.1K | |
| images_14.jpg | 2026-01-31 22:29 | 4.9K | |
| images_15.jpg | 2026-01-31 22:29 | 4.3K | |
| images_16.jpg | 2026-01-31 22:29 | 7.1K | |
| images_17.jpg | 2026-01-31 22:29 | 4.3K | |
| images_18.jpg | 2026-01-31 22:29 | 3.2K | |
| images_19.jpg | 2026-01-31 22:29 | 4.0K | |
| images_20.jpg | 2026-01-31 22:29 | 2.7K | |
| images_21.jpg | 2026-01-31 22:29 | 3.4K | |
| images_22.jpg | 2026-01-31 22:29 | 4.3K | |
| images_23.jpg | 2026-01-31 22:29 | 2.8K | |
| images_24.jpg | 2026-01-31 22:29 | 3.9K | |
| images_25.jpg | 2026-01-31 22:29 | 6.7K | |
| images_26.jpg | 2026-01-31 22:29 | 3.3K | |
| images_27.jpg | 2026-01-31 22:29 | 3.1K | |
| img-triplefrontera.jpg | 2026-01-31 22:29 | 5.5K | |
| img_aphillips_201901..> | 2026-01-31 22:29 | 2.8K | |
| img_como_prevenir_la..> | 2026-01-31 22:29 | 3.7K | |
| img_por_que_me_da_ve..> | 2026-01-31 22:29 | 2.7K | |
| impacto-tic-720x462_..> | 2026-01-31 22:29 | 4.5K | |
| importancia-del-dia-..> | 2026-01-31 22:29 | 14K | |
| incongruencia-obesid..> | 2026-01-31 22:29 | 4.4K | |
| index.jpg | 2026-01-31 22:29 | 4.2K | |
| index.png | 2026-01-31 22:29 | 15K | |
| indexPlan de Salud A..> | 2026-01-31 22:29 | 5.1K | |
| index_0.jpg | 2026-01-31 22:29 | 4.2K | |
| index_0.png | 2026-01-31 22:29 | 15K | |
| index_1.jpg | 2026-01-31 22:29 | 4.8K | |
| index_1.png | 2026-01-31 22:29 | 13K | |
| index_2.jpg | 2026-01-31 22:29 | 4.8K | |
| index_2.png | 2026-01-31 22:29 | 24K | |
| index_3.jpg | 2026-01-31 22:29 | 5.1K | |
| index_3.png | 2026-01-31 22:29 | 13K | |
| index_4.jpg | 2026-01-31 22:29 | 4.0K | |
| index_4.png | 2026-01-31 22:29 | 11K | |
| index_5.jpg | 2026-01-31 22:29 | 4.2K | |
| index_5.png | 2026-01-31 22:29 | 23K | |
| index_6.jpg | 2026-01-31 22:29 | 4.3K | |
| index_6.png | 2026-01-31 22:29 | 12K | |
| index_7.jpg | 2026-01-31 22:29 | 4.8K | |
| index_7.png | 2026-01-31 22:29 | 8.5K | |
| index_8.jpg | 2026-01-31 22:29 | 2.7K | |
| index_8.png | 2026-01-31 22:29 | 26K | |
| index_9.jpg | 2026-01-31 22:29 | 4.4K | |
| index_10.jpg | 2026-01-31 22:29 | 3.3K | |
| index_11.jpg | 2026-01-31 22:29 | 3.5K | |
| index_12.jpg | 2026-01-31 22:29 | 3.2K | |
| index_13.jpg | 2026-01-31 22:29 | 3.7K | |
| index_14.jpg | 2026-01-31 22:29 | 3.8K | |
| index_15.jpg | 2026-01-31 22:29 | 6.5K | |
| index_16.jpg | 2026-01-31 22:29 | 3.8K | |
| index_17.jpg | 2026-01-31 22:29 | 5.4K | |
| index_18.jpg | 2026-01-31 22:29 | 4.6K | |
| index_19.jpg | 2026-01-31 22:29 | 4.6K | |
| index_20.jpg | 2026-01-31 22:29 | 4.6K | |
| index_21.jpg | 2026-01-31 22:29 | 4.3K | |
| index_22.jpg | 2026-01-31 22:29 | 5.8K | |
| index_23.jpg | 2026-01-31 22:29 | 4.2K | |
| index_24.jpg | 2026-01-31 22:29 | 5.3K | |
| index_25.jpg | 2026-01-31 22:29 | 3.4K | |
| index_26.jpg | 2026-01-31 22:29 | 4.7K | |
| index_27.jpg | 2026-01-31 22:29 | 3.0K | |
| indigena.gif | 2026-01-31 22:29 | 13K | |
| informe-2017-300x300..> | 2026-01-31 22:29 | 9.3K | |
| informe-europeo-sobr..> | 2026-01-31 22:29 | 2.6K | |
| informe-europeo-sobr..> | 2026-01-31 22:29 | 2.8K | |
| informe-oms-consumo-..> | 2026-01-31 22:29 | 3.3K | |
| informe-tabaco-2013.jpg | 2026-01-31 22:29 | 3.8K | |
| informe-violencia-vi..> | 2026-01-31 22:29 | 4.6K | |
| informe_europeu_sobr..> | 2026-01-31 22:29 | 11K | |
| informe_ods_portaInf..> | 2026-01-31 22:29 | 5.4K | |
| informe ejecutivo de..> | 2026-01-31 22:29 | 3.1K | |
| infrome impacto soci..> | 2026-01-31 22:29 | 2.8K | |
| instituto.png | 2026-01-31 22:29 | 15K | |
| integraciontecnologi..> | 2026-01-31 22:29 | 4.3K | |
| internet, psicopatol..> | 2026-01-31 22:29 | 5.4K | |
| investigacion-en-sal..> | 2026-01-31 22:29 | 2.2K | |
| invitacion_familias_..> | 2026-01-31 22:29 | 6.4K | |
| invitacionforohablem..> | 2026-01-31 22:29 | 4.6K | |
| isalud-40-32.jpg | 2026-01-31 22:29 | 3.7K | |
| jdxmiunnuohfeke3inzw..> | 2026-01-31 22:29 | 3.7K | |
| jovenes-910x640 (1).jpg | 2026-01-31 22:29 | 6.3K | |
| jovenes-en-el-mundo-..> | 2026-01-31 22:29 | 4.0K | |
| jovenes-en-la-red-se..> | 2026-01-31 22:29 | 3.4K | |
| jovenes-internet-int..> | 2026-01-31 22:29 | 4.2K | |
| jovenes Perú.jpg | 2026-01-31 22:29 | 5.4K | |
| jovenes Perú_0.jpg | 2026-01-31 22:29 | 5.4K | |
| jovenes_covid19_coro..> | 2026-01-31 22:29 | 3.0K | |
| jovenes_papa_brasil_..> | 2026-01-31 22:29 | 11K | |
| jovenes_papa_brasil_..> | 2026-01-31 22:29 | 11K | |
| jovenesc1.jpg | 2026-01-31 22:29 | 4.7K | |
| jovenesyalcohol.jpg | 2026-01-31 22:29 | 4.4K | |
| jovenes y tiempo lib..> | 2026-01-31 22:29 | 5.2K | |
| juego-de-apuestas-en..> | 2026-01-31 22:29 | 2.7K | |
| juego patológico en..> | 2026-01-31 22:29 | 3.6K | |
| juventud.jpg | 2026-01-31 22:29 | 3.4K | |
| kids_grass_web.jpg | 2026-01-31 22:29 | 5.5K | |
| kiko-.jpg | 2026-01-31 22:29 | 2.2K | |
| kiosco1salud-570x418..> | 2026-01-31 22:29 | 4.8K | |
| kit1_623_620.png | 2026-01-31 22:29 | 7.0K | |
| krb_61925c5dd2d2319b..> | 2026-01-31 22:29 | 3.7K | |
| l Seminario Internac..> | 2026-01-31 22:29 | 4.9K | |
| la-causa-de-los-adol..> | 2026-01-31 22:29 | 4.8K | |
| la-habana.jpg | 2026-01-31 22:29 | 3.2K | |
| la-lucha-por-el-dere..> | 2026-01-31 22:29 | 4.6K | |
| labimg_700_1_homenaj..> | 2026-01-31 22:29 | 6.0K | |
| la caja de la mascul..> | 2026-01-31 22:29 | 4.5K | |
| la ley.jpg | 2026-01-31 22:29 | 2.9K | |
| lancet-Un-futuro-par..> | 2026-01-31 22:29 | 3.6K | |
| largepreview.png | 2026-01-31 22:29 | 6.8K | |
| las-nuevas-sustancia..> | 2026-01-31 22:29 | 3.0K | |
| las_familias_migrant..> | 2026-01-31 22:29 | 5.1K | |
| las brechas sociales..> | 2026-01-31 22:29 | 12K | |
| legalizacion-marihua..> | 2026-01-31 22:29 | 16K | |
| lesbianas_0.jpg | 2026-01-31 22:29 | 2.8K | |
| libroblanco.jpg | 2026-01-31 22:29 | 4.1K | |
| lihp-plsi_1web2.jpg | 2026-01-31 22:29 | 4.8K | |
| logo-aba.png | 2026-01-31 22:29 | 22K | |
| logo-bkkbn_0.jpeg | 2026-01-31 22:29 | 5.2K | |
| logo-cab-5-SPP.png | 2026-01-31 22:29 | 17K | |
| logo-concausa-solo-7..> | 2026-01-31 22:29 | 24K | |
| logo-es.png | 2026-01-31 22:29 | 23K | |
| logo-euspr.png | 2026-01-31 22:29 | 12K | |
| logo-sap.gif | 2026-01-31 22:29 | 1.2K | |
| logo-sogia-270x230.png | 2026-01-31 22:29 | 22K | |
| logo.png | 2026-01-31 22:29 | 16K | |
| logoGobiernoEspana.gif | 2026-01-31 22:29 | 3.4K | |
| logoGurises_0.png | 2026-01-31 22:29 | 13K | |
| logo_0.jpg | 2026-01-31 22:29 | 4.7K | |
| logo_0.png | 2026-01-31 22:29 | 17K | |
| logo_1.png | 2026-01-31 22:29 | 33K | |
| logo_2.png | 2026-01-31 22:29 | 4.8K | |
| logo_2018.png.jpg | 2026-01-31 22:29 | 4.8K | |
| logo_2018.png_0.jpg | 2026-01-31 22:29 | 4.8K | |
| logo_2018.png_1.jpg | 2026-01-31 22:29 | 4.8K | |
| logo_big.png | 2026-01-31 22:29 | 7.6K | |
| logo_es.png | 2026-01-31 22:29 | 9.8K | |
| logo_facime.png | 2026-01-31 22:29 | 2.0K | |
| logo_facime_0.png | 2026-01-31 22:29 | 2.0K | |
| logo_header.png | 2026-01-31 22:29 | 15K | |
| logo_lasdrogas.png | 2026-01-31 22:29 | 4.0K | |
| logo_mensajeinaugura..> | 2026-01-31 22:29 | 6.0K | |
| logo_mspbs_py.jpg | 2026-01-31 22:29 | 3.2K | |
| logo_sbp.jpg | 2026-01-31 22:29 | 4.9K | |
| logoclap-opsazul.jpg | 2026-01-31 22:29 | 3.2K | |
| logoconcurso.png | 2026-01-31 22:29 | 10K | |
| logomsal.png | 2026-01-31 22:29 | 6.8K | |
| los-adolescentes-y-e..> | 2026-01-31 22:29 | 4.2K | |
| madre-hija-mano2.jpg | 2026-01-31 22:29 | 6.1K | |
| mafalda-leyendo.gif | 2026-01-31 22:29 | 8.3K | |
| mailing_2015__3B[4].jpg | 2026-01-31 22:29 | 5.0K | |
| mal-de-escuela-1-728..> | 2026-01-31 22:29 | 4.9K | |
| mamadown-300x247.jpg | 2026-01-31 22:29 | 4.6K | |
| mano.jpg | 2026-01-31 22:29 | 3.1K | |
| manos.jpg | 2026-01-31 22:29 | 4.4K | |
| manual-profesores-ap..> | 2026-01-31 22:29 | 3.4K | |
| mapa-acceso.png | 2026-01-31 22:29 | 11K | |
| marca_unifesp_pb_m_0..> | 2026-01-31 22:29 | 5.2K | |
| marco legal.jpg | 2026-01-31 22:29 | 4.4K | |
| marihuana-el-80-del-..> | 2026-01-31 22:29 | 4.4K | |
| masculinidad.jpg | 2026-01-31 22:29 | 3.5K | |
| masculinidades b.jpg | 2026-01-31 22:29 | 3.6K | |
| maternidad-posivita.png | 2026-01-31 22:29 | 9.6K | |
| maternidad 2.jpg | 2026-01-31 22:29 | 3.3K | |
| maxresdefault.jpg | 2026-01-31 22:29 | 4.0K | |
| maxresdefault_0.jpg | 2026-01-31 22:29 | 4.5K | |
| mayo_sagij.jpg | 2026-01-31 22:29 | 4.6K | |
| mcdonalds-mangel.png | 2026-01-31 22:29 | 27K | |
| memoria-salud-mental..> | 2026-01-31 22:29 | 8.2K | |
| mendoza.jpg | 2026-01-31 22:29 | 3.2K | |
| mental2.jpg | 2026-01-31 22:29 | 4.2K | |
| mercado-emergente-su..> | 2026-01-31 22:29 | 5.3K | |
| mexico.jpg | 2026-01-31 22:29 | 3.8K | |
| mi-plan-adolescente-..> | 2026-01-31 22:29 | 3.9K | |
| mindulness-nens-tdah..> | 2026-01-31 22:29 | 2.9K | |
| ministerio.jpg | 2026-01-31 22:29 | 3.5K | |
| monitor_0.jpg | 2026-01-31 22:29 | 3.9K | |
| mortalidad-materna-r..> | 2026-01-31 22:29 | 4.7K | |
| mortalidad_suicidio_..> | 2026-01-31 22:29 | 5.1K | |
| namro.jpg | 2026-01-31 22:29 | 3.8K | |
| ndice.jpg | 2026-01-31 22:29 | 4.0K | |
| ndice.jpg 1.jpg | 2026-01-31 22:29 | 4.1K | |
| ndice.png | 2026-01-31 22:29 | 10K | |
| ndice_0.jpg | 2026-01-31 22:29 | 4.9K | |
| ndice_1.jpg | 2026-01-31 22:29 | 3.3K | |
| ndice_2.jpg | 2026-01-31 22:29 | 4.0K | |
| ndice_3.jpg | 2026-01-31 22:29 | 2.3K | |
| ndice_4.jpg | 2026-01-31 22:29 | 4.5K | |
| ndice_5.jpg | 2026-01-31 22:29 | 3.7K | |
| ndice_6.jpg | 2026-01-31 22:29 | 3.3K | |
| ndice_7.jpg | 2026-01-31 22:29 | 6.0K | |
| ndice_8.jpg | 2026-01-31 22:29 | 4.4K | |
| ndice_9.jpg | 2026-01-31 22:29 | 2.8K | |
| ndice_10.jpg | 2026-01-31 22:29 | 4.9K | |
| ndice_11.jpg | 2026-01-31 22:29 | 3.8K | |
| ndice_12.jpg | 2026-01-31 22:29 | 4.6K | |
| ndice de vulnerabili..> | 2026-01-31 22:29 | 3.6K | |
| nemo.jpg | 2026-01-31 22:29 | 4.5K | |
| nino-tablet--620x349..> | 2026-01-31 22:29 | 4.9K | |
| nino2_0.jpg | 2026-01-31 22:29 | 4.6K | |
| nios-en-la-era-de-lo..> | 2026-01-31 22:29 | 2.8K | |
| noctambulos-5-inform..> | 2026-01-31 22:29 | 2.1K | |
| nolecuentescuentos-c..> | 2026-01-31 22:29 | 9.2K | |
| norma-tecnica-salud-..> | 2026-01-31 22:29 | 18K | |
| not_8f2cb1a97c36c5ba..> | 2026-01-31 22:29 | 6.1K | |
| noticieros 2012.jpg | 2026-01-31 22:29 | 31K | |
| nuevo cintillo blog5..> | 2026-01-31 22:29 | 4.5K | |
| obesidad-infantil.jpg | 2026-01-31 22:29 | 3.7K | |
| obesidad.jpg | 2026-01-31 22:29 | 4.8K | |
| oij.png | 2026-01-31 22:29 | 7.6K | |
| ojojoven.jpg | 2026-01-31 22:29 | 4.6K | |
| opsecg1901-spa.pdf.jpg | 2026-01-31 22:29 | 4.1K | |
| p1.jpg | 2026-01-31 22:29 | 4.3K | |
| pageHeaderTitleImage..> | 2026-01-31 22:29 | 1.4K | |
| page_1.jpg | 2026-01-31 22:29 | 4.2K | |
| page_1_thumb_large.jpg | 2026-01-31 22:29 | 2.0K | |
| page_4.jpg | 2026-01-31 22:29 | 6.2K | |
| paginas_desderevista..> | 2026-01-31 22:29 | 4.2K | |
| paho-pahef-awards-sp..> | 2026-01-31 22:29 | 3.9K | |
| pan.jpg | 2026-01-31 22:29 | 4.0K | |
| pantalla.jpg | 2026-01-31 22:29 | 4.1K | |
| papa.jpg | 2026-01-31 22:29 | 5.8K | |
| paradigma-182x300.png | 2026-01-31 22:29 | 27K | |
| parejadown.JPG | 2026-01-31 22:29 | 4.4K | |
| parto respetado.jpg | 2026-01-31 22:29 | 4.1K | |
| pastilla-anticoncept..> | 2026-01-31 22:29 | 2.9K | |
| pedagogía.jpg | 2026-01-31 22:29 | 3.7K | |
| penna.jpg | 2026-01-31 22:29 | 4.6K | |
| pexels-andrea-piacqu..> | 2026-01-31 22:29 | 3.9K | |
| pl_banner-226-2777.jpg | 2026-01-31 22:29 | 4.5K | |
| plan atencion victim..> | 2026-01-31 22:29 | 8.6K | |
| planes_de_igualdad_d..> | 2026-01-31 22:29 | 4.0K | |
| planestrategicoporta..> | 2026-01-31 22:29 | 5.2K | |
| planet-youth.png | 2026-01-31 22:29 | 15K | |
| port_lareproduccion.jpg | 2026-01-31 22:29 | 4.1K | |
| port_panoramasocial.jpg | 2026-01-31 22:29 | 2.9K | |
| portada-Mi-héroe-er..> | 2026-01-31 22:29 | 21K | |
| portada-cannabis-con..> | 2026-01-31 22:29 | 17K | |
| portada-costo-econom..> | 2026-01-31 22:29 | 4.1K | |
| portada-emociones4ok..> | 2026-01-31 22:29 | 4.2K | |
| portada-guia-respues..> | 2026-01-31 22:29 | 20K | |
| portada-herramienta-..> | 2026-01-31 22:29 | 2.9K | |
| portada-revista.jpg | 2026-01-31 22:29 | 3.1K | |
| portada.1.jpg | 2026-01-31 22:29 | 5.3K | |
| portada2.jpg | 2026-01-31 22:29 | 3.9K | |
| portadaLOGOSok-toweb..> | 2026-01-31 22:29 | 2.8K | |
| portadaMAPA2017_3.png | 2026-01-31 22:29 | 20K | |
| portada_70_guia.jpg | 2026-01-31 22:29 | 2.5K | |
| portada_estratpreven..> | 2026-01-31 22:29 | 35K | |
| portada_libro-SRMS-2..> | 2026-01-31 22:29 | 3.9K | |
| portada_revista_94_0..> | 2026-01-31 22:29 | 4.1K | |
| portadilla-web-obser..> | 2026-01-31 22:29 | 5.3K | |
| post-millennials.jpg | 2026-01-31 22:29 | 4.0K | |
| precoloquio.jpg | 2026-01-31 22:29 | 4.1K | |
| pregunta-13914280_0.jpg | 2026-01-31 22:29 | 2.2K | |
| presentacin-informe-..> | 2026-01-31 22:29 | 4.3K | |
| presentacion.jpg | 2026-01-31 22:29 | 4.1K | |
| prevenção_do_suic..> | 2026-01-31 22:29 | 21K | |
| prevenir-adiccion-in..> | 2026-01-31 22:29 | 3.9K | |
| primer-webinar-defin..> | 2026-01-31 22:29 | 6.9K | |
| problem-drugs-world.jpg | 2026-01-31 22:29 | 2.1K | |
| problemas-adolescent..> | 2026-01-31 22:29 | 4.6K | |
| promundo.png | 2026-01-31 22:29 | 19K | |
| propertynames-3191_l..> | 2026-01-31 22:29 | 14K | |
| protocolo-de-actuaci..> | 2026-01-31 22:29 | 4.3K | |
| proyecto-evict-canna..> | 2026-01-31 22:29 | 3.3K | |
| psicologia-clinica-s..> | 2026-01-31 22:29 | 7.0K | |
| publicidad_evento_no..> | 2026-01-31 22:29 | 21K | |
| que-es-el-coronaviru..> | 2026-01-31 22:29 | 4.9K | |
| quisisana_coloriamol..> | 2026-01-31 22:29 | 13K | |
| rase una vez los Der..> | 2026-01-31 22:29 | 3.9K | |
| rase una vez los val..> | 2026-01-31 22:29 | 5.4K | |
| raydel aaa_0.jpg | 2026-01-31 22:29 | 4.7K | |
| recomendado-cmo-afro..> | 2026-01-31 22:29 | 2.8K | |
| regional_magdalena.jpg | 2026-01-31 22:29 | 2.8K | |
| resiliencia.jpg | 2026-01-31 22:29 | 4.2K | |
| reunion_viedma.png | 2026-01-31 22:29 | 15K | |
| revista-esi_0.jpg | 2026-01-31 22:29 | 4.6K | |
| rs-estrategia-comuni..> | 2026-01-31 22:29 | 4.9K | |
| rs-estrategia-comuni..> | 2026-01-31 22:29 | 4.9K | |
| rs-estrategia-comuni..> | 2026-01-31 22:29 | 4.9K | |
| rs-estrategia-comuni..> | 2026-01-31 22:29 | 4.9K | |
| rueda.jpg | 2026-01-31 22:29 | 4.5K | |
| sASIA.jpg | 2026-01-31 22:29 | 3.8K | |
| sIMA.png | 2026-01-31 22:29 | 18K | |
| safe_image.php_.jpg | 2026-01-31 22:29 | 5.1K | |
| safe_image.php_.png | 2026-01-31 22:29 | 35K | |
| salud-adolescentes_0..> | 2026-01-31 22:29 | 4.4K | |
| salud.jpg | 2026-01-31 22:29 | 3.0K | |
| salud_sexual.png | 2026-01-31 22:29 | 24K | |
| saludsexual.png | 2026-01-31 22:29 | 35K | |
| sap.jpg | 2026-01-31 22:29 | 3.1K | |
| sap.png | 2026-01-31 22:29 | 5.9K | |
| sap 17.jpg | 2026-01-31 22:29 | 5.0K | |
| sap17 2.jpg | 2026-01-31 22:29 | 4.3K | |
| saporange.jpg | 2026-01-31 22:29 | 3.9K | |
| sedronar.jpg | 2026-01-31 22:29 | 3.5K | |
| seminario adoleca.jpg | 2026-01-31 22:29 | 5.4K | |
| serviciossalud_princ..> | 2026-01-31 22:29 | 4.5K | |
| sex.jpg | 2026-01-31 22:29 | 5.1K | |
| sexualidad-y-drogas-..> | 2026-01-31 22:29 | 5.2K | |
| share-default.jpg | 2026-01-31 22:29 | 4.0K | |
| shutterstock_5588433..> | 2026-01-31 22:29 | 2.1K | |
| silencio-2.jpg | 2026-01-31 22:29 | 3.9K | |
| sima_0.jpg | 2026-01-31 22:29 | 2.5K | |
| sistematizacion_adol..> | 2026-01-31 22:29 | 11K | |
| slide-1-638.jpg | 2026-01-31 22:29 | 3.8K | |
| slider-1.jpg | 2026-01-31 22:29 | 3.9K | |
| slider-1_0.jpg | 2026-01-31 22:29 | 3.9K | |
| slider-1_1.jpg | 2026-01-31 22:29 | 3.9K | |
| slider2.jpg | 2026-01-31 22:29 | 3.7K | |
| slider2_0.jpg | 2026-01-31 22:29 | 3.4K | |
| slider4.jpg | 2026-01-31 22:29 | 3.3K | |
| soledad.jpg | 2026-01-31 22:29 | 3.9K | |
| solum093.jpg | 2026-01-31 22:29 | 3.7K | |
| sordena-adolescentes..> | 2026-01-31 22:29 | 4.2K | |
| standard_8c583fbd-c9..> | 2026-01-31 22:29 | 2.6K | |
| state of world popul..> | 2026-01-31 22:29 | 5.4K | |
| sueño_0.jpg | 2026-01-31 22:29 | 3.4K | |
| suicide-infographic-..> | 2026-01-31 22:29 | 21K | |
| suicidio-causas-tris..> | 2026-01-31 22:29 | 3.7K | |
| suicidio.jpg | 2026-01-31 22:29 | 3.7K | |
| suicidio3.jpg | 2026-01-31 22:29 | 4.0K | |
| suicidio11.jpg | 2026-01-31 22:29 | 3.1K | |
| suicidio_0.jpg | 2026-01-31 22:29 | 4.2K | |
| tabaco.JPG | 2026-01-31 22:29 | 4.1K | |
| taller_acoso_6-12-1.jpg | 2026-01-31 22:29 | 5.1K | |
| taller_acoso_12-16-1..> | 2026-01-31 22:29 | 5.0K | |
| taller_participacion..> | 2026-01-31 22:29 | 5.2K | |
| taller_participacion..> | 2026-01-31 22:29 | 4.8K | |
| tapa-PP.jpg | 2026-01-31 22:29 | 3.7K | |
| tapa-abril-2013.jpg | 2026-01-31 22:29 | 6.5K | |
| tapa-estudio-suicidi..> | 2026-01-31 22:29 | 3.8K | |
| tapa-guia-vph-118x16..> | 2026-01-31 22:29 | 4.7K | |
| tapaMILENAparaweb.jpg | 2026-01-31 22:29 | 3.1K | |
| tapa_ESI_2018.jpg | 2026-01-31 22:29 | 3.8K | |
| tapa_jueguemos.jpg | 2026-01-31 22:29 | 4.5K | |
| tapa desplegable.png | 2026-01-31 22:29 | 16K | |
| tapaguiacyberbullyin..> | 2026-01-31 22:29 | 4.4K | |
| tapa resumen ejecuti..> | 2026-01-31 22:29 | 4.2K | |
| tapatemaslibres1.png | 2026-01-31 22:29 | 25K | |
| tapav.png | 2026-01-31 22:29 | 15K | |
| tbp2b_590.jpg | 2026-01-31 22:29 | 4.9K | |
| te-ayudamos-a-dejar-..> | 2026-01-31 22:29 | 4.3K | |
| teaser cazando rumor..> | 2026-01-31 22:29 | 3.4K | |
| tecno 1.jpg | 2026-01-31 22:29 | 5.2K | |
| tecnoadicciones-gua-..> | 2026-01-31 22:29 | 4.0K | |
| tecnologias.jpg | 2026-01-31 22:29 | 2.7K | |
| tejiendo_estrategias..> | 2026-01-31 22:29 | 17K | |
| thum-cartilla.png | 2026-01-31 22:29 | 25K | |
| thumb_2257_640_360_0..> | 2026-01-31 22:29 | 4.2K | |
| tic-salud-cuadernos-..> | 2026-01-31 22:29 | 4.8K | |
| timthumb.php_.jpg | 2026-01-31 22:29 | 3.7K | |
| tobacco-report-480x6..> | 2026-01-31 22:29 | 3.1K | |
| todos1.jpg | 2026-01-31 22:29 | 4.4K | |
| trabajo-en-equipo2.jpg | 2026-01-31 22:29 | 4.0K | |
| trastornos-alimentic..> | 2026-01-31 22:29 | 2.8K | |
| trauma.png | 2026-01-31 22:29 | 16K | |
| tumblr_m78hvqPyPB1rz..> | 2026-01-31 22:29 | 3.3K | |
| una-encuesta-en-favo..> | 2026-01-31 22:29 | 4.5K | |
| unco.jpg | 2026-01-31 22:29 | 4.4K | |
| unicef_manual_adoles..> | 2026-01-31 22:29 | 4.9K | |
| unillanos.jpg | 2026-01-31 22:29 | 4.4K | |
| unillanos_sede_san_a..> | 2026-01-31 22:29 | 5.0K | |
| universidad de los a..> | 2026-01-31 22:29 | 11K | |
| unnamed (1).png | 2026-01-31 22:29 | 12K | |
| unnamed (1)_0.png | 2026-01-31 22:29 | 14K | |
| unnamed-2.png | 2026-01-31 22:29 | 15K | |
| unnamed-575x1024.jpg | 2026-01-31 22:29 | 3.1K | |
| unnamed.gif | 2026-01-31 22:29 | 3.8K | |
| unnamed.jpg | 2026-01-31 22:29 | 5.4K | |
| unnamed.png | 2026-01-31 22:29 | 6.3K | |
| unnamed_0.jpg | 2026-01-31 22:29 | 5.2K | |
| unnamed_0.png | 2026-01-31 22:29 | 23K | |
| unnamed_1.jpg | 2026-01-31 22:29 | 4.9K | |
| unnamed_1.png | 2026-01-31 22:29 | 8.9K | |
| unnamed_2.jpg | 2026-01-31 22:29 | 4.4K | |
| unnamed_2.png | 2026-01-31 22:29 | 22K | |
| unnamed_2_0.png | 2026-01-31 22:29 | 23K | |
| unnamed_3.jpg | 2026-01-31 22:29 | 5.3K | |
| unnamed_3.png | 2026-01-31 22:29 | 14K | |
| unnamed_4.jpg | 2026-01-31 22:29 | 2.6K | |
| unnamed_4.png | 2026-01-31 22:29 | 15K | |
| unnamed_5.jpg | 2026-01-31 22:29 | 4.8K | |
| unnamed_5.png | 2026-01-31 22:29 | 18K | |
| unnamed_6.jpg | 2026-01-31 22:29 | 3.8K | |
| unnamed_6.png | 2026-01-31 22:29 | 12K | |
| unnamed_7.jpg | 2026-01-31 22:29 | 3.9K | |
| unnamed_7.png | 2026-01-31 22:29 | 14K | |
| unnamed_8.jpg | 2026-01-31 22:29 | 4.1K | |
| unnamed_9.jpg | 2026-01-31 22:29 | 4.5K | |
| unnamed_10.jpg | 2026-01-31 22:29 | 3.9K | |
| unnamed_11.jpg | 2026-01-31 22:29 | 4.2K | |
| unnamed_12.jpg | 2026-01-31 22:29 | 4.7K | |
| unnamed_13.jpg | 2026-01-31 22:29 | 3.9K | |
| unnamed_14.jpg | 2026-01-31 22:29 | 5.2K | |
| unnamed_15.jpg | 2026-01-31 22:29 | 3.6K | |
| unnamed_16.jpg | 2026-01-31 22:29 | 3.6K | |
| unnamed_17.jpg | 2026-01-31 22:29 | 2.7K | |
| unnamed_18.jpg | 2026-01-31 22:29 | 3.6K | |
| unnamed_19.jpg | 2026-01-31 22:29 | 3.0K | |
| uruguay 2.jpg | 2026-01-31 22:29 | 5.6K | |
| vadole.jpg | 2026-01-31 22:29 | 5.5K | |
| valores1_0.jpg | 2026-01-31 22:29 | 4.0K | |
| vasos-de-alcohol.gif | 2026-01-31 22:29 | 12K | |
| ver.jpg | 2026-01-31 22:29 | 4.3K | |
| viii-debate-en-drogo..> | 2026-01-31 22:29 | 3.3K | |
| violence against wom..> | 2026-01-31 22:29 | 29K | |
| violencia-o-amor[1].jpg | 2026-01-31 22:29 | 2.3K | |
| violencia-sexual-tap..> | 2026-01-31 22:29 | 20K | |
| violencia Voz.png | 2026-01-31 22:29 | 19K | |
| violencia de género..> | 2026-01-31 22:29 | 3.3K | |
| vol59n3y4portada-218..> | 2026-01-31 22:29 | 3.3K | |
| w_logo_desktop_es.png | 2026-01-31 22:29 | 4.0K | |
| web-cuidado-600x300.png | 2026-01-31 22:29 | 6.5K | |
| web-educacionsexual2..> | 2026-01-31 22:29 | 8.2K | |
| webinar-Fb-spa.jpg | 2026-01-31 22:29 | 4.1K | |
| webinar-Fb-spa_0.jpg | 2026-01-31 22:29 | 4.1K | |
| webinar-globalstanda..> | 2026-01-31 22:29 | 3.8K | |
| webinar Niñez en co..> | 2026-01-31 22:29 | 3.8K | |
| webinar Siteal.jpg | 2026-01-31 22:29 | 2.4K | |
| webinar Siteal_0.jpg | 2026-01-31 22:29 | 2.2K | |
| webinar_salud_mental..> | 2026-01-31 22:29 | 2.8K | |
| webinar_salud_mental..> | 2026-01-31 22:29 | 2.8K | |
| whatsapp.png | 2026-01-31 22:29 | 13K | |
| working_together_to_..> | 2026-01-31 22:29 | 12K | |
| x-congreso-apu-2018-..> | 2026-01-31 22:29 | 3.3K | |
| y llego la adolescen..> | 2026-01-31 22:29 | 3.8K | |
| young-people-737150_..> | 2026-01-31 22:29 | 2.3K | |
|
|---|
-11.32.17.png){kind=link}
.png){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
_1.jpg){kind=link}
.png){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.%20El%20manejo%20cl%c3%adnico%20de%20los%20trastornos%20mentales%20neurol%c3%b3gicos%20y%20por%20uso%20de%20sustancias%20en%20las%20emergencias%20humanitarias.jpg){kind=link}
.jpg){kind=link}
informaci%c3%b3n%20sexual.jpg){kind=link}
.jpg){kind=link}
%20(Vol.3).jpg){kind=link}
_P%c3%a1gina_006.jpg){kind=link}
.jpg){kind=link}
.png){kind=link}
_0.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
_1.jpg){kind=link}
_2.jpg){kind=link}
_3.jpg){kind=link}
_4.jpg){kind=link}
_5.jpg){kind=link}
_6.jpg){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
_1.jpg){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
_1.jpg){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
%20Realidades%20y%20Perspectivas.jpg){kind=link}
%20(9).png){kind=link}
%20(9)_0.png){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.png){kind=link}
%204%20y%205%20de%20Marzo%202016%20Valladolid.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
_1.jpg){kind=link}
_2.jpg){kind=link}
_3.jpg){kind=link}
_4.jpg){kind=link}
_5.jpg){kind=link}
_6.jpg){kind=link}
_7.jpg){kind=link}
_8.jpg){kind=link}
_9.jpg){kind=link}
_10.jpg){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
.jpg){kind=link}
_0.jpg){kind=link}
_1.jpg){kind=link}
.jpg){kind=link}
![mailing_2015__3B[4].jpg](mailing_2015__3B%5b4%5d.jpg){kind=link}
.jpg){kind=link}
.png){kind=link}
_0.png){kind=link}
![violencia-o-amor[1].jpg](violencia-o-amor%5b1%5d.jpg){kind=link}
